![]() | |
| Supplier Name | Nantong Reform Petro-Chemical CO., LTD. |
| Contact | Miss cai |
| Tel | +86-13776910623 |
| Mobile | +86-13776910623 |
| r@reformchem.com | |
| Website | https://www.reformchem.com |
| chemical6666 | |
| Product Name | 2,3-Dihydroxybenzoic acid |
| Synonyms | DOBK 2,3 DHB NSC 27435 BRN 2209117 Pyrocatechuic acid RARECHEM AL BE 0035 TIMTEC-BB SBB008367 |
| CAS | 303-38-8 |
| EINECS | 206-139-5 |
| Chemical Formula | C7H6O4 |
| Molecular Weight | 154.12 |
| inchi | InChI=1/C7H6O4/c8-5-3-1-2-4(6(5)9)7(10)11/h1-3,8-9H,(H,10,11)/p-1 |
| Package | 1kg, 25kg, 200kg |
| Price | Email to quote |
| Descriptions | |
| Supplier Website | |
| Last Update | 2026-02-10 10:28:05 |