![]() | |
| Supplier Name | Nantong Reform Petro-Chemical CO., LTD. |
| Contact | Miss cai |
| Tel | +86-13776910623 |
| Mobile | +86-13776910623 |
| r@reformchem.com | |
| Website | https://www.reformchem.com |
| chemical6666 | |
| Product Name | Potassium bitartrate |
| Synonyms | Cream of tartar L(+)-Potassium hydro Potassium bitartrate Potassium Bitartarate Radix Notoginseng P.E. Potassium acid tartrate Acid potassium tartrate |
| CAS | 868-14-4;35-04-1;6381-58-4 |
| EINECS | 212-769-1 |
| Chemical Formula | C4H5KO6 |
| Molecular Weight | 188.18 |
| inchi | InChI=1/C4H6O6.K/c5-1(3(7)8)2(6)4(9)10;/h1-2,5-6H,(H,7,8)(H,9,10);/q;+1/p-2 |
| Package | 1kg, 25kg, 200kg |
| Price | Email to quote |
| Descriptions | |
| Supplier Website | |
| Last Update | 2026-02-10 10:28:05 |