![]() | |
| Supplier Name | Nantong Reform Petro-Chemical CO., LTD. |
| Contact | Miss cai |
| Tel | +86-13776910623 |
| Mobile | +86-13776910623 |
| r@reformchem.com | |
| Website | https://www.reformchem.com |
| chemical6666 | |
| Product Name | Potassium carbonate |
| Synonyms | K2CO3 Pearl ash Salt of tartar alt of wormwood Potassiumcarbonate Potassium carbonate Carbonate Of Potash |
| CAS | 584-08-7 |
| EINECS | 209-529-3 |
| Chemical Formula | K2CO3 |
| Molecular Weight | 138.21 |
| inchi | InChI=1/CH2O3.2K.2H/c2-1(3)4;;;;/h(H2,2,3,4);;;;/p-2/rCH2O3.2HK/c2-1(3)4;;/h(H2,2,3,4);2*1H/p-2 |
| Package | 1kg, 25kg, 200kg |
| Price | Email to quote |
| Descriptions | |
| Supplier Website | |
| Last Update | 2026-02-10 10:28:05 |