![]() | |
| Supplier Name | Nantong Reform Petro-Chemical CO., LTD. |
| Contact | Miss cai |
| Tel | +86-13776910623 |
| Mobile | +86-13776910623 |
| r@reformchem.com | |
| Website | https://www.reformchem.com |
| chemical6666 | |
| Product Name | Ethyl acetate |
| Synonyms | RFE acetic ester Acetic Ether Ethyl acetate SPIRIT OF WINE METHYLCARBINOL REAGENT ALCOHOL |
| CAS | 141-78-6 |
| EINECS | 205-500-4 |
| Chemical Formula | C4H8O2 |
| Molecular Weight | 88.1051 |
| inchi | InChI=1/C4H8O2/c1-3-6-4(2)5/h3H2,1-2H3 |
| Package | 1kg, 25kg, 200kg |
| Price | Email to quote |
| Descriptions | |
| Supplier Website | |
| Last Update | 2026-02-10 10:28:05 |