![]() | |
| Supplier Name | |
| Tel | |
| Mobile | 18186386804 |
| 2885409035@qq.com | |
| Website | http:// |
| 18186386804 | |
| Product Name | 5-amino-2-methyl benzoic acid |
| Synonyms | TIMTEC-BB SBB007566 RARECHEM AL BO 1282 2-Methyl-5-Aminobenzoic 5-amino-2-methylbenzoic acid 2-methyl-5-aminobenzoic acid 2-METHYL-5-AMINOBENZOIC ACID 5-Amino-2-methylbenzoic acid |
| CAS | 2840-04-2 |
| EINECS | |
| Chemical Formula | C8H9NO2 |
| Molecular Weight | 151.16 |
| inchi | InChI=1/C8H9NO2/c1-5-2-3-6(9)4-7(5)8(10)11/h2-4H,9H2,1H3,(H,10,11) |
| Package | Email to quote |
| Price | Email to quote |
| Descriptions | |
| Supplier Website | |
| Last Update | 2026-02-14 14:36:03 |