| Supplier Name | |
| Tel | 0724-4355788 |
| Mobile | 19307245857 |
| 1931978409@qq.com | |
| Website | http://www.liduxcl.com |
| Product Name | Methyl ethyl carbonate |
| Synonyms | EMC Methylethylcarbonate ETHYL METHYL CARBONATE Methyl ethyl carbonate Ethyl Methyl Carbonate EthylMethylCarbonate(Emc) Carbonic acid ethyl methyl |
| CAS | 623-53-0 |
| EINECS | 208-760-7 |
| Chemical Formula | C4H8O3 |
| Molecular Weight | 104.1 |
| inchi | InChI=1/C4H8O3/c1-3-7-4(5)6-2/h3H2,1-2H3 |
| Package | Email to quote |
| Price | Email to quote |
| Descriptions | |
| Supplier Website | |
| Last Update | 2023-04-27 18:30:20 |