![]() | |
| Supplier Name | |
| Tel | 010-50973130 |
| Mobile | 18101056239(微信同号) |
| 3193328036@qq.com | |
| Website | http://solarbio.com |
| 18101056239 | |
| Product Name | Itopride Hydrochloride |
| Synonyms | hsr803 ITOPRIDE HCL Itopride HCl ITOPRIDE HYDROCHLORIDE Itopride Hydrochloride N-(p-(2-(Dimethylamino)ethoxy)benzyl)veratramide Hydrochloride N-{4-[2-(Dimethylamino)ethoxy]benzyl}-3,4-dimethoxybenzamide Hydrochloride |
| CAS | 122892-31-3 |
| EINECS | 602-905-1 |
| Chemical Formula | C20H27ClN2O4 |
| Molecular Weight | 394.89 |
| inchi | InChI=1/C20H26N2O4.ClH/c1-22(2)11-12-26-17-8-5-15(6-9-17)14-21-20(23)16-7-10-18(24-3)19(13-16)25-4;/h5-10,13H,11-12,14H2,1-4H3,(H,21,23);1H |
| Package | Email to quote |
| Price | Email to quote |
| Descriptions | |
| Supplier Website | |
| Last Update | 2026-02-10 11:15:19 |