![]() | |
| Supplier Name | |
| Tel | 010-50973130 |
| Mobile | 18101056239(微信同号) |
| 3193328036@qq.com | |
| Website | http://solarbio.com |
| 18101056239 | |
| Product Name | benzyl 2-methoxy-4-prop-1-enylphenyl ether |
| Synonyms | Benzyl Iso-eugenyl ether 1-.alpha.-Phenyl-4-propenylveratrole Benzyl alcohol, ether with isoeugenol 1-Benzyloxy-2-Methoxy-4-Propenylbenzene 1-Benzyloxy-2-methoxy-4-propenylbenzene 1-(benzyloxy)-2-methoxy-4-propenyl-benzen |
| CAS | 120-11-6 |
| EINECS | 204-370-6 |
| Chemical Formula | C17H18O2 |
| Molecular Weight | 254.32 |
| inchi | InChI=1/C17H18O2/c1-3-7-14-10-11-16(17(12-14)18-2)19-13-15-8-5-4-6-9-15/h3-12H,13H2,1-2H3/b7-3- |
| Package | Email to quote |
| Price | Email to quote |
| Descriptions | |
| Supplier Website | |
| Last Update | 2026-02-10 11:15:19 |