![]() | |
| Supplier Name | Shandong Zhengji Chemical Co.,ltd |
| Contact | zhangxiaowei |
| Tel | |
| Mobile | +8618369999171 |
| sales2@promisechemical.com | |
| Website | www.promisechemical.com |
| +8618369999171 | |
| Product Name | 3,3',4,4'-Biphenyltetracarboxylic acid |
| Synonyms | 3,3',4,4'-Biphenylte 4,4'-Biphthalic acid 5,5'-Bi[phthalic acid] 3,4,3',4'-Biphenyltetracarboxylic acid 3,3',4,4'-Biphenyltetracarboxylic acid Biphenyl-3,3',4,4'-tetracarboxylicacid 3,3',4,4'-[1,1'-Biphenyl]tetracarboxylic acid |
| CAS | 22803-05-0 |
| EINECS | |
| Chemical Formula | C16H10O8 |
| Molecular Weight | 330.25 |
| inchi | InChI=1/C16H10O8/c17-13(18)9-3-1-7(5-11(9)15(21)22)8-2-4-10(14(19)20)12(6-8)16(23)24/h1-6H,(H,17,18)(H,19,20)(H,21,22)(H,23,24) |
| Package | Email to quote |
| Price | Email to quote |
| Descriptions | |
| Supplier Website | |
| Last Update | 2023-04-27 18:30:20 |