| Product Name | 1,4-bis(methoxymethyl)-benzene |
| Synonyms | PXDM p-XYLENE DIMETHYL ETHER P-XYLENE DIMETHYL ETHER XYLENE(P-) DIMETHYL ETHER Para xylene dimethyl ester 1,4-Bis(methoxymethyl)benzene 1,4-BIS(METHOXYMETHYL)BENZENE |
| CAS | 6770-38-3 |
| EINECS | 229-828-2 |
| Chemical Formula | C10H14O2 |
| Molecular Weight | 166.22 |
| inchi | InChI=1/C10H14O2/c1-11-7-9-3-5-10(6-4-9)8-12-2/h3-6H,7-8H2,1-2H3 |
| Package | 1kg/25kg/200kg |
| Price | RFQ |
| Descriptions | The English name for p-phenyldimethyl ether is Benzene, 1,4-bis (methoxymethyl) -, also known as 1,4-bis (methoxymethyl) benzene in Chinese. Its CAS number is 6770-38-3, molecular formula is C10H14O2, and molecular weight is 166.22. It belongs to the category of pharmaceutical intermediates and can be used as an organic synthesis intermediate for resin synthesis. |
| Supplier Website | |
| Last Update | 2026-02-09 10:32:56 |