| Product Name | o-Cresyl glycidyl ether |
| Synonyms | o-Cresyl glycidyl ether Glycidyl-(o-tolyl)-ether 2-Methylphenyl Glycidyl ether Glycidyl 2-methylphenyl ether 2,3-epoxypropyl o-tolyl ether 2-[(2-methylphenoxy)methyl]oxirane (2S)-2-[(2-methylphenoxy)methyl]oxirane |
| CAS | 2210-79-9 |
| EINECS | 218-645-3 |
| Chemical Formula | C10H12O2 |
| Molecular Weight | 164.20 |
| inchi | InChI=1/C10H12O2/c1-8-4-2-3-5-10(8)12-7-9-6-11-9/h2-5,9H,6-7H2,1H3/t9-/m0/s1 |
| Package | 200KG/Drum |
| Price | RFQ |
| Descriptions | 2-Toluene glycidyl ether is an effective diluent for high viscosity epoxy resin. Due to its unique structure and steric hindrance, it has approached or surpassed many properties of epoxide diluents, especially in solvent resistance and water resistance, which are significantly better than other diluents. |
| Supplier Website | |
| Last Update | 2026-02-09 10:32:56 |