| Product Name | Ethyl 2-methylpentanoate |
| Synonyms | MANZANATE Melon Valerate RARECHEM AL BI 0135 Ethyl 2-methylvalerate ETHYL 2-METHYLPENTANOATE Ethyl 2-methylpentanoate Ethyl alpha-methylvalerate |
| CAS | 39255-32-8 |
| EINECS | 254-384-1 |
| Chemical Formula | C8H16O2 |
| Molecular Weight | 144.21 |
| inchi | InChI=1/C8H16O2/c1-4-6-7(3)8(9)10-5-2/h7H,4-6H2,1-3H3/t7-/m0/s1 |
| Package | 25KG/Drum |
| Price | RFQ |
| Descriptions | 2-Methylvalerate ethyl ester is a colorless to light yellow liquid that is insoluble in water and soluble in ethanol. It can be used for the preparation of daily chemical essence. |
| Supplier Website | |
| Last Update | 2026-02-09 10:32:56 |