![]() | |
| Supplier Name | |
| Tel | |
| Mobile | 18186386804 |
| 2885409035@qq.com | |
| Website | http:// |
| 18186386804 | |
| Product Name | 2-diethylaminoethyl 4-amino-2-chlorobenzoate hydrochloride |
| Synonyms | nesecaine-ce nesacainehydrochloride Chloroprocaine Hydrochloride 2-chloroprocainehydrochloride CHLOROPROCAINE HYDROCHLORIDE (200 MG) 2-diethylaminoethyl 4-amino-2-chlorobenzoate hydrochloride |
| CAS | 3858-89-7 |
| EINECS | 223-371-2 |
| Chemical Formula | C13H20Cl2N2O2 |
| Molecular Weight | 307.2161 |
| inchi | InChI=1/C13H19ClN2O2.ClH/c1-3-16(4-2)7-8-18-13(17)11-6-5-10(15)9-12(11)14;/h5-6,9H,3-4,7-8,15H2,1-2H3;1H |
| Package | Email to quote |
| Price | Email to quote |
| Descriptions | |
| Supplier Website | |
| Last Update | 2026-02-14 14:36:03 |