![]() | |
| Supplier Name | |
| Tel | |
| Mobile | 18186386804 |
| 2885409035@qq.com | |
| Website | http:// |
| 18186386804 | |
| Product Name | DL-3-Hydroxy-n-butyric Acid |
| Synonyms | 3 HBA RARECHEM AL BO 1231 beta-hydroxybutyrate 3-Hydroxybutyric acid 3-hydroxy-butanoicaci (3R)-3-hydroxybutanoate dl-B-hydroxybutyric acid |
| CAS | 300-85-6;625-71-8 |
| EINECS | 206-099-9 |
| Chemical Formula | C4H8O3 |
| Molecular Weight | 104.1 |
| inchi | InChI=1/C4H8O3/c1-3(5)2-4(6)7/h3,5H,2H2,1H3,(H,6,7)/p-1/t3-/m1/s1 |
| Package | Email to quote |
| Price | Email to quote |
| Descriptions | |
| Supplier Website | |
| Last Update | 2026-02-14 14:36:03 |