![]() | |
| Supplier Name | |
| Tel | |
| Mobile | 18186386804 |
| 2885409035@qq.com | |
| Website | http:// |
| 18186386804 | |
| Product Name | dl-noradrenaline hydrochloride |
| Synonyms | DL-Arterenol dl-noradrenaline hydrochloride DL-Norepinephrine hydrochloride [+-]-NORADRENALIN HYDROCHLORIDE [+-]-NOREPINEPHRINE HYDROCHLORIDE 3,4-DIHYDROXYPHENYLETHANOLAMINE HYDROCHLORIDE |
| CAS | 55-27-6 |
| EINECS | 200-229-8 |
| Chemical Formula | C8H12ClNO3 |
| Molecular Weight | 205.64 |
| inchi | InChI=1/C8H11NO3/c9-4-8(12)5-1-2-6(10)7(11)3-5/h1-3,8,10-12H,4,9H2/p+1/t8-/m0/s1 |
| Package | Email to quote |
| Price | Email to quote |
| Descriptions | |
| Supplier Website | |
| Last Update | 2026-02-14 14:36:03 |