![]() | |
| Supplier Name | |
| Tel | |
| Mobile | 18186386804 |
| 2885409035@qq.com | |
| Website | http:// |
| 18186386804 | |
| Product Name | trimetazidine |
| Synonyms | AKOS B006602 trimetazidine TRIMETAZIDINE TRIMETAZIDINE HCL ART-CHEM-BB B006602 ART-CHEM-BB B014361 TIMTEC-BB SBB007020 |
| CAS | 5011-34-7 |
| EINECS | 225-690-2 |
| Chemical Formula | C14H22N2O3 |
| Molecular Weight | 266.34 |
| inchi | InChI=1/C14H22N2O3/c1-17-12-5-4-11(13(18-2)14(12)19-3)10-16-8-6-15-7-9-16/h4-5,15H,6-10H2,1-3H3 |
| Package | Email to quote |
| Price | Email to quote |
| Descriptions | |
| Supplier Website | |
| Last Update | 2026-02-14 14:36:03 |