| Product Name | N-(2-chloro-4-pyridyl)-N'-phenylurea |
| Synonyms | CPPU KT-30 4pu30 4-CPPU cn11-3138 FORCHLORFENURON Forchlorfenuron |
| CAS | 68157-60-8 |
| EINECS | 614-346-0 |
| Chemical Formula | C12H10ClN3O |
| Molecular Weight | 247.68 |
| inchi | InChI=1/C12H10ClN3O/c13-11-8-10(6-7-14-11)16-12(17)15-9-4-2-1-3-5-9/h1-8H,(H2,14,15,16,17) |
| Package | 1KG/Bag |
| Price | RFQ |
| Descriptions | Chloramphenicol, also known as clopidophenylurea, belongs to the phenylurea class of cytokinins, with the chemical name 1- (2-chloro-4-pyridine) -3-phenylurea. Also known as KT30 or CPPU, it was first developed by Japan in the 1980s and later introduced to China. It is a nationally approved plant growth regulator and is not a food additive. Chlorphenicol is widely used in agricultural production and has the effect of increasing fruit quantity in various crops such as persimmons, cantaloupe, bitter gourd, grapes, tomatoes, watermelons, apples, pears, etc. It can promote plant cell division, promote fruit enlargement, and increase yield. It has been used as a fruit enlargement agent in various crops both domestically and internationally. |
| Supplier Website | |
| Last Update | 2026-02-09 10:32:56 |