| Supplier Name | Chengdu Baishixing Science and Technology Industry Co.,Ltd |
| Tel | 028-88536627 |
| Mobile | 13408677798 |
| gina@cd-bsx.com | |
| Website | http://www.cd-bsx.com |
| Product Name | Glycylglycine |
| Synonyms | Gly-Gly GLY-GLY DIGLYCINE Diglycine GLY-GLY-OH H-Gly-Gly-OH H-GLY-GLY-OH |
| CAS | 556-50-3 |
| EINECS | 209-127-8 |
| Chemical Formula | C4H8N2O3 |
| Molecular Weight | 132.12 |
| inchi | InChI=1/C4H8N2O3/c5-1-3(7)6-2-4(8)9/h1-2,5H2,(H,6,7)(H,8,9) |
| Package | Email to quote |
| Price | Email to quote |
| Descriptions | |
| Supplier Website | |
| Last Update | 2023-04-27 18:30:20 |