| Supplier Name | Hangzhou FST pharmaceutical Co., Ltd |
| Tel | +86-571-88938567 |
| Mobile | 13208001826 |
| jj@fstchem.com | |
| Website | http://www.fstpharm.com/ |
| Product Name | (1S,5R,6S)-Ethyl 5-(pentan-3-yl-oxy)-7-oxa-bicyclo[4.1.0]hept-3-ene-3-carboxylate |
| Synonyms | Cyclo oxygene Int intermediate for oseltamivir (3r,4s,5s)-4,5-epoxy-3-(1-ethyl-propoxy) cyclohex-1-ene-1-carboxylate ethyl(3r,4s,5s)-4,5-epoxy-3-(1-ethyl-opoxy)cyclohex-1-ene-1-carboxylate Ethyl (3R,4S,5S)4,5-Epoxy-3-(1-ethylpropoxy)cyclohex-1-ene-1-carboxylate |
| CAS | 204254-96-6 |
| EINECS | 1308068-626-2 |
| Chemical Formula | C14H22O4 |
| Molecular Weight | 254.32 |
| inchi | InChI=1/C14H22O4/c1-4-10(5-2)17-11-7-9(14(15)16-6-3)8-12-13(11)18-12/h7,10-13H,4-6,8H2,1-3H3/t11-,12+,13-/m1/s1 |
| Package | Email to quote |
| Price | Email to quote |
| Descriptions | |
| Supplier Website | |
| Last Update | 2023-04-27 18:30:20 |