| Supplier Name | Nanjing DSCbio-chem Co.,Ltd |
| Tel | |
| Mobile | 18012963792 |
| Website | http://www.dscbio-chem.com |
| Product Name | Phenylacetyl Disulphide |
| Synonyms | PADS Phenylacetyldisulfide PHENYLACETYL DISULFIDE Phenylacetyl Disulfide Phenylacetyl Disulphide PHENYLACETYL DISULPHIDE DIPHENYLACETYL DISULFIDE |
| CAS | 15088-78-5 |
| EINECS | 215-742-2 |
| Chemical Formula | C16H14O2S2 |
| Molecular Weight | 302.41 |
| inchi | InChI=1/C16H14O2S2/c17-15(11-13-7-3-1-4-8-13)19-20-16(18)12-14-9-5-2-6-10-14/h1-10H,11-12H2 |
| Package | Email to quote |
| Price | Email to quote |
| Descriptions | |
| Supplier Website | |
| Last Update | 2023-04-27 18:30:20 |