| Product Name | 1,3,5-triazine-2,4,6-trithiol triso. S. sol. |
| Synonyms | 1,3,5-triazinane-2,4,6-trithione TMTH-15 waste water treatMent agent Trithiocyanuric Acid Trisodium salt Trithiocyanuric acid TrisodillM salt Trithiocyanuric acid Trisodillm salt TriMercapto-s-Triazine-trisodium salt |
| CAS | 17766-26-6 |
| EINECS | 241-749-5 |
| Chemical Formula | C3N3Na3S3 |
| Molecular Weight | 243.22 |
| inchi | InChI=1/C3H3N3S3.3Na/c7-1-4-2(8)6-3(9)5-1;;;/h(H3,4,5,6,7,8,9);;;/q;3*+1/p-3 |
| Package | Email to quote |
| Price | Email to quote |
| Descriptions | |
| Supplier Website | |
| Last Update | 2024-10-29 21:06:34 |