| Product Name | 2-Methylbutyric Acid |
| Synonyms | FEMA 2695 RARECHEM AL BO 0094 2-Methylbutyric Acid 2-METHYLBUTYRIC ACID 2-Methyl Butyic Acid 2-METHYLBUTANOIC ACID 2-Methyl Butyric Acid |
| CAS | 116-53-0 |
| EINECS | 204-145-2 |
| Chemical Formula | C5H10O2 |
| Molecular Weight | 102.13 |
| inchi | InChI=1/C5H10O2/c1-3-4(2)5(6)7/h4H,3H2,1-2H3,(H,6,7)/p-1/t4-/m0/s1 |
| Package | Email to quote |
| Price | Email to quote |
| Descriptions | |
| Supplier Website | |
| Last Update | 2024-10-29 21:06:34 |