| Supplier Name | Wuhan Shuer Biological Technology Co., Ltd. |
| Tel | 13277972784 |
| Mobile | 13277972784 |
| Website | http:// |
| Product Name | 2-(N-Methyl-p-toluidino)ethanol |
| Synonyms | FirstCure MHPT 2-(N-Methyl-p-toluidino)ethanol 2-(N-methyl-p-toluidino)ethanol 2-(N-Methyl-N-4-tolylamino)ethanol N-Methyl-N-hydroxyethyl-P-toluidine 2-[Methyl(4-methylphenyl)amino]ethanol |
| CAS | 2842-44-6 |
| EINECS | 220-638-5 |
| Chemical Formula | C10H15NO |
| Molecular Weight | 165.23 |
| inchi | InChI=1/C10H15NO/c1-9-3-5-10(6-4-9)11(2)7-8-12/h3-6,12H,7-8H2,1-2H3 |
| Package | Email to quote |
| Price | Email to quote |
| Descriptions | |
| Supplier Website | |
| Last Update | 2023-04-27 18:30:20 |