| Supplier Name | Zhuhai Long Success Chemical Industry Co Ltd |
| Tel | |
| Mobile | |
| sales@LSChem.com.cn | |
| Website | http://lschem.com.cn |
| Product Name | Diisopropyl ether |
| Synonyms | DIPE (iso-C3H7)2O Isopropyl Ether Diisopropyl oxide Diisopropyl ether 2,2'-Oxybispropane |
| CAS | 108-20-3 |
| EINECS | 203-560-6 |
| Chemical Formula | C6H14O |
| Molecular Weight | 102.17 |
| inchi | InChI=1/C6H14O/c1-5(2)7-6(3)4/h5-6H,1-4H3 |
| Package | Email to quote |
| Price | Email to quote |
| Descriptions | |
| Supplier Website | |
| Last Update | 2023-04-27 18:30:20 |