| Supplier Name | |
| Tel | |
| Mobile | 13957167880 |
| triggerchem@126.com | |
| Website | http://www.triggerchem.cn |
| Product Name | 3a-methyl-5,6-dihydro-4H-isobenzofuran-1,3-dione |
| Synonyms | MTHPA AC-METHYL 1,3-Isobenzofurandione, 3a,4 tetrahydromethylphthalic anhydride Methyltetrahydrophthalic anhydride 4-METHYL TETRAHYDROPHTHALIC ANHYDRIDE |
| CAS | 11070-44-3;19438-64-3 |
| EINECS | 234-290-7 |
| Chemical Formula | C9H10O3 |
| Molecular Weight | 166.17 |
| inchi | InChI=1/C9H10O3/c1-9-5-3-2-4-6(9)7(10)12-8(9)11/h3,5-6H,2,4H2,1H3 |
| Package | Email to quote |
| Price | Email to quote |
| Descriptions | |
| Supplier Website | |
| Last Update | 2023-04-27 18:30:20 |