| Supplier Name | TOTAI (Inner Mongolia) Corporation |
| Tel | 1516-9697069 |
| Mobile | 15169697069 15689899394 |
| 15169697069@163.com | |
| Website | http://http://www.totaitech.com |
| Product Name | Methyl sulfoxide |
| Synonyms | DMSO FEMA 3875 Methyl sulfoxide Diemthyl Sulfoxide Dimethyl sulfoxide DIMETHYL SULFOXIDE Dimethyl sulphoxide |
| CAS | 67-68-5 |
| EINECS | 200-664-3 |
| Chemical Formula | C2H6OS |
| Molecular Weight | 78.13 |
| inchi | InChI=1/C2H6OS/c1-4(2)3/h1-2H3 |
| Package | Email to quote |
| Price | Email to quote |
| Descriptions | |
| Supplier Website | |
| Last Update | 2023-04-27 18:30:20 |