| Supplier Name | XiangYang King Success Fine Chemical co., ltd. |
| Tel | 0710-3510276 |
| Mobile | 19871282568 |
| sales_kingsuccess@163.com | |
| Website | http://www.king-success.com/ |
| Product Name | 2-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-((hexyl)oxy)phenol |
| Synonyms | UV-1577 UV 1577 TINUVIN 1577 Absorbent UV-1577 5-TRIAZIN-2-YL)-5-(( 2-(4,6-DIPHENYL-1,3,5-TRIAZIN-2-YL)-5-(( 2-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-((hexyl)oxy)phenol |
| CAS | 147315-50-2 |
| EINECS | 411-380-6 |
| Chemical Formula | C27H27N3O2 |
| Molecular Weight | 425.52 |
| inchi | InChI=1/C27H27N3O2/c1-2-3-4-11-18-32-22-16-17-23(24(31)19-22)27-29-25(20-12-7-5-8-13-20)28-26(30-27)21-14-9-6-10-15-21/h5-10,12-17,19,31H,2-4,11,18H2,1H3 |
| Package | Email to quote |
| Price | Email to quote |
| Descriptions | |
| Supplier Website | |
| Last Update | 2023-04-27 18:30:20 |