| Supplier Name | Jinan Huifengda Chemical Co.,Ltd. |
| Tel | 0531-89702876/88691896/88872378/89702654 |
| Mobile | 13181710695 |
| jnhfdchem@163.com | |
| Website | http://www.jnhfdchem.com |
| Product Name | Ethyl acetate |
| Synonyms | RFE acetic ester Acetic Ether Ethyl acetate SPIRIT OF WINE METHYLCARBINOL REAGENT ALCOHOL |
| CAS | 141-78-6 |
| EINECS | 205-500-4 |
| Chemical Formula | C4H8O2 |
| Molecular Weight | 88.1051 |
| inchi | InChI=1/C4H8O2/c1-3-6-4(2)5/h3H2,1-2H3 |
| Package | 180kg |
| Price | Email to quote |
| Descriptions | |
| Supplier Website | |
| Last Update | 2023-04-27 18:30:20 |