| Supplier Name | |
| Tel | 13395316108 |
| Mobile | 13395316108 |
| 2942653126@qq.com | |
| Website | http:// |
| Product Name | L-Epinephrine Hydrochloride |
| Synonyms | nci-c55663 Racepinephrine HCL adrenalin chloride supranephrinsolution Adrenaline Hydrochloride (-)-adrenalinehydrochlorid l-epinephrine hydrochloride |
| CAS | 55-31-2;329-63-5 |
| EINECS | 200-230-3 |
| Chemical Formula | C9H14ClNO3 |
| Molecular Weight | 219.67 |
| inchi | InChI=1/C9H13NO3.2ClH/c1-10-5-9(13)6-2-3-7(11)8(12)4-6;;/h2-4,9-13H,5H2,1H3;2*1H/p-1/t9-;;/m0../s1 |
| Package | Email to quote |
| Price | Email to quote |
| Descriptions | |
| Supplier Website | |
| Last Update | 2023-12-20 11:20:13 |