![]() | |
| Supplier Name | Shandong Zhengji Chemical Co.,ltd |
| Contact | zhangxiaowei |
| Tel | |
| Mobile | +8618369999171 |
| sales2@promisechemical.com | |
| Website | www.promisechemical.com |
| +8618369999171 | |
| Product Name | Diethofencarb |
| Synonyms | DIETHOFENCARB Diethofencarb Biethofencarb Diethofenacarb isopropyl3,4-diethoxycarbanilate Isopropyl 3,4-diethyloxy carbamate isopropyl3,4-diethoxyphenylcarbamate |
| CAS | 87130-20-9 |
| EINECS | 403-870-3 |
| Chemical Formula | C14H21NO4 |
| Molecular Weight | 267.32 |
| inchi | InChI=1/C14H21NO4/c1-5-17-12-8-7-11(9-13(12)18-6-2)15-14(16)19-10(3)4/h7-10H,5-6H2,1-4H3,(H,15,16) |
| Package | Email to quote |
| Price | Email to quote |
| Descriptions | |
| Supplier Website | |
| Last Update | 2024-12-22 14:31:53 |