| Supplier Name | |
| Tel | 13639499855 |
| Mobile | 13639499855 |
| 455422263@qq.com | |
| Website | http:// |
| Product Name | Naftifine hydrochloride |
| Synonyms | NAFTINE HCL NAFTIFINE HCL Naftifine HCl NAFTIFENE HYDROCHLORIDE NAFTIFINE HYDROCHLORIDE Naftifine hydrochloride Naftifine hyrdrochloride |
| CAS | 65473-14-5 |
| EINECS | 620-502-9 |
| Chemical Formula | C21H22ClN |
| Molecular Weight | 323.86 |
| inchi | InChI=1/C21H21N.ClH/c1-22(16-8-11-18-9-3-2-4-10-18)17-20-14-7-13-19-12-5-6-15-21(19)20;/h2-15H,16-17H2,1H3;1H/b11-8+ |
| Package | Email to quote |
| Price | Email to quote |
| Descriptions | |
| Supplier Website | |
| Last Update | 2025-10-09 09:37:08 |