| Name | N,N,N',N'-Tetraphenylbenzidine |
| Synonyms | TPB TETRAPHENYLBENZIDINE Tetraphenylbenzidine TETRA-N-PHENYLBENZIDINE TETRAPHENYLBENZIDINE (TPB) N,N,N1,N1-Tetraphenylbenzidine N,N,N',N'-Tetraphenylbenzidine N,N,N',N'-TETRAPHENYLBENZIDINE 4,4'-BIS(DIPHENYLAMINO)BIPHENYL N,N,N',N'-tetraphenylbiphenyl-4,4'-diamine N,N,N',N'-Tetraphenyl(1,1'-biphenyl)-4,4'-diamine N,N,N',N'-Tetraphenyl[1,1'-biphenyl]-4,4'-diamine (1,1'-Biphenyl)-4,4'-diamine, N,N,N',N'-tetraphenyl- (1,1'-Biphenyl)-4,4'-diamine, N4,N4,N4',N4'-tetraphenyl- [1,1'-Biphenyl]-4,4'-diamine, N,N,N',N'-tetraphenyl-(9CI) Tetraphenylbenzidine, TPB, N,N,Nμ,Nμ-Tetraphenylbenzidine |
| CAS | 15546-43-7 |
| EINECS | 239-599-0 |
| InChI | InChI=1/C36H28N2/c1-5-13-31(14-6-1)37(32-15-7-2-8-16-32)35-25-21-29(22-26-35)30-23-27-36(28-24-30)38(33-17-9-3-10-18-33)34-19-11-4-12-20-34/h1-28H |
| Molecular Formula | C36H28N2 |
| Molar Mass | 488.62 |
| Density | 1.171±0.06 g/cm3(Predicted) |
| Melting Point | 230-234°C |
| Boling Point | 649.7±48.0 °C(Predicted) |
| Flash Point | 291.2°C |
| Vapor Presure | 9.18E-17mmHg at 25°C |
| Appearance | Solid |
| Color | White to Light yellow |
| Maximum wavelength(λmax) | ['354nm(CHCl3)(lit.)'] |
| pKa | -2.62±0.60(Predicted) |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.685 |
| MDL | MFCD00228123 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| WGK Germany | 3 |
| TSCA | Yes |
| HS Code | 29215900 |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |