| Name | 5-bromo-2,4-dimethyl-1,3-thiazole |
| Synonyms | 5-bromo-2,4-dimethylthiazole Thiazole,5-bromo-2,4-dimethyl- 5-BROMO-2,4-DIMETHYL-1,3-THIAZOLE 5-bromo-2,4-dimethyl-1,3-thiazole |
| CAS | 28599-52-2 |
| EINECS | 200-258-5 |
| InChI | InChI=1/C5H6BrNS/c1-3-5(6)8-4(2)7-3/h1-2H3 |
| Molecular Formula | C5H6BrNS |
| Molar Mass | 192.08 |
| Density | 1.589±0.06 g/cm3(Predicted) |
| Melting Point | 153-155 °C |
| Boling Point | 188-190 °C(Press: 745 Torr) |
| Flash Point | 87.5°C |
| Vapor Presure | 0.162mmHg at 25°C |
| pKa | 2.93±0.10(Predicted) |
| Storage Condition | -20℃ |
| Refractive Index | 1.577 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S37/39 - Wear suitable gloves and eye/face protection |
| Hazard Note | Irritant |
| Downstream Products | Trimethyl thiazole 2,4-Dimethylthiazole-5-carboxylic acid |
| Hazard Note | Irritant |