| Name | 4-Amino-2,6-dichlorophenol |
| Synonyms | 4-Amino-2,6-dichlorophenol 4-amino-2,6-dichloro-pheno 2,6-dichloro-4-amine phenol 2,6-dichloro-4-chloro phenol 2,6-Dichloro-4-aminophenol 3,5-Dichloro-4-hydroxyaniline phenol,{(2,6-chloro)-4-amino} 4-amino-2,6-dichlorophen-3,5-D2-ol 4-Amino-2,6-Dichlorophenol 2,6-Dichloro-4-Aminophenol |
| CAS | 5930-28-9 |
| EINECS | 227-671-4 |
| InChI | InChI=1/C6H5Cl2NO/c7-4-1-3(9)2-5(8)6(4)10/h1-2,10H,9H2 |
| Molecular Formula | C6H5Cl2NO |
| Molar Mass | 178.02 |
| Density | 1.2549 (rough estimate) |
| Melting Point | 167-170 °C (lit.) |
| Boling Point | 303.6±42.0 °C(Predicted) |
| Solubility | soluble in Methanol |
| Appearance | White solid |
| Color | Beige or slightly brown to pale reddish |
| BRN | 2361665 |
| pKa | 7.29±0.23(Predicted) |
| Storage Condition | Keep in dark place,Inert atmosphere,Room temperature |
| Stability | Stable. Incompatible with acids, acid chlorides, acid anhydrides, chloroformates, strong oxidizing agents. |
| Refractive Index | 1.5680 (estimate) |
| MDL | MFCD00007875 |
| Physical and Chemical Properties | Melting point 164-168°C light gray or white crystalized powder "light soluble in hot water and alcoholic acid. Insoluble in cold water. Soluble in organic solvent suchas aether and ethanol, also soluble in dangerous acid and alkali. Water 1.0% Melting point:166-168 ℃ Heavy metal:≦ 20ppm Purity(HPLC):≧ 99% Individual importance: 0.5% Total importance: 1.0% |
| Use | Used as a pesticide intermediate |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S37/39 - Wear suitable gloves and eye/face protection |
| WGK Germany | 3 |
| RTECS | SJ5774500 |
| TSCA | Yes |
| HS Code | 29222990 |
| dangerous goods mark | Xi |
| hazard category code | 36/37/38 |
| safety instructions | 26-37/39 |
| WGK Germany | 3 |
| RTECS number | SJ5774500 |
| TSCA | Yes |
| customs code | 29222990 |
| chemical properties | this product is colorless solid, m.p.167 ~ 170 ℃, insoluble in water, soluble in benzene, toluene and other solvents. |
| use | 2, 6-dichloro-4-aminophenol, also known as 3, 5-dichloro-4-hydroxyaniline, is an intermediate for the synthesis of fluorolubolluron 3, 5-dichloro-4-(1,1,2, 2-tetrafluoroethoxy) aniline, or an intermediate for the synthesis of fluoropyridine 4-(3-chloro-5-trifluoromethylpyridine, 5-dichloroaniline. |
| use | Pesticides, dyes, pharmaceutical intermediates. |
| use | Used as pesticide intermediate |
| use | organic synthesis |
| use | Used as an intermediate for pesticide flubolluron |
| production method | The preparation method is to use 2, 6-dichloro p-nitrophenol in the presence of palladium/carbon, with diethylene glycol methyl ether as the solvent, and a high yield product can be obtained. The reaction equation is shown in the figure: |
| melting point | 167-170°C (lit.) |
| boiling point | 303.6±42.0 °C(Predicted) |
| density | 1.2549 (rough estimate) |
| refractive index | 1.5680 (estimate) |
| storage conditions | Keep in dark place,Inert atmosphere,Room temperature |
| acidity coefficient (pKa) | 7.29±0.23(Predicted) |
| morphology | Powder |
| color | Beige or slightly brown to pale reddish |
| BRN | 2361665 |
| stability | Stable. Incompatible with acids, acid chlorides, acid anhydrides, chloroformates, strong oxidizing agents. |
| NIST chemical information | Phenol, 4-amino-2,6-dichloro-(5930-28-9) |
| EPA chemical information | Phenol, 4-amino-2,6-dichloro- (5930-28-9) |
| NIST chemical information | information provided by: webbook.nist.gov (external link) |
| EPA chemical substance information | information provided by: ofmpeb.epa.gov (external link) |
| Use | 2, 6-dichloro-4-aminophenol, also known as 3, 5-dichloro-4-hydroxyaniline, intermediate 3, 5-dichloro-4-(1,1,2, 2-tetrafluoroethoxy) aniline for the synthesis of flourea, or 4-(3-chloro-5-trifluoromethylpyridin-2-oxy)-3, 5-dichloroaniline, an intermediate in the synthesis of fluorirea. pesticides, dyes, pharmaceutical intermediates. used as pesticide intermediate organic synthesis used as pesticide intermediate of fluxuron |
| production method | the preparation method is to use 2, 6-dichloro-p-nitrophenol in the presence of palladium/carbon, with diethylene glycol methyl ether as solvent, the product with high yield can be obtained. Reaction equation: |