| Name | 3,4-diamino-1-fluorobenzene |
| Synonyms | Fluoroophenylenediamine 3,4-DIAMINOFLUOROBENZENE 3,4-Diaminofluorobenzene 4-FLUORO-O-PHENYLENEDIAMINE 1,2-Diamino-4-fluorobenzene 3,4-diamino-1-fluorobenzene 4-FLUORO-1,2-DIAMINOBENZENE 4-FLUORO-BENZENE-1,2-DIAMINE 4-Fluoro-1,2-phenylenediamine 4-FLUORO-1,2-PHENYLENEDIAMINE 1,2-Diamino-4-fluorobenzene~3,4-Diaminofluorobenzene |
| CAS | 367-31-7 |
| EINECS | 206-691-7 |
| InChI | InChI=1/C6H7FN2/c7-4-1-2-5(8)6(9)3-4/h1-3H,8-9H2 |
| Molecular Formula | C6H7FN2 |
| Molar Mass | 126.13 |
| Density | 1.284±0.06 g/cm3(Predicted) |
| Melting Point | 94-98°C |
| Boling Point | 266.1±20.0 °C(Predicted) |
| Water Solubility | Slightly soluble in water. |
| Solubility | DMSO (Slightly), Methanol (Slightly) |
| Appearance | Brown crystalline powder |
| Color | deep brown |
| BRN | 2081075 |
| pKa | 4.22±0.10(Predicted) |
| Storage Condition | Keep in dark place,Sealed in dry,Room Temperature |
| Sensitive | Light Sensitive |
| MDL | MFCD00042228 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| UN IDs | UN2811 |
| WGK Germany | 3 |
| FLUKA BRAND F CODES | 8 |
| HS Code | 29215110 |
| Hazard Note | Irritant |
| Hazard Class | 6.1 |
| Packing Group | III |
| use | 4-fluoro-1, 2-phenylenediamine is an important intermediate for the synthesis of new anti-tumor drugs such as cedaraniline, benzimidazole, quinoxaline and 1-H-1, 5-benzoazepine, so it is of great significance to study its synthesis method. |
| synthesis method | 135g(0.86mol)4-fluoro -2-nitroaniline, 1000mL anhydrous ethanol and 27g Raney nickel are added to a 2000mL reaction kettle, hydrogen is introduced, and after reacting at 1.0MPa for 8h, TLC shows that the reaction is complete. After cooling, the filter residue is Raney nickel, which is recycled and recycled. Distilled under reduced pressure to give 99.59g of off-white solid. Yield: 91.3%,m.p.97~98 ℃ (literature value: m.p.89 ~ 91 ℃). 1HNMR(DMSO-d 6,400MHz),δ:4.27(s,2H),4.75(s,2H),6.11(t,1H,J = 8.54Hz),6.29(d,1H,J = 10.92Hz),6.42(t,1H,J = 7.14Hz). MS(m/Z):127.1[M + H]+. |