| Name | 2,6-Dimethylbenzoquinone |
| Synonyms | Dimethylpbenzoquinone 2,6-DIMETHYL-P-QUINONE 2,6-Dimethylbenzoquinone 2,6-DIMETHYL-P-BENZOQUINONE naphthyridine-3-carbonitrile 2,6-DIMETHYL-1,4-BENZOQUINONE 2,6-DIMETHYL-PARA-BENZOQUINONE 2,6-DIMETHYL-2,5-CYCLOHEXADIENE-1,4-DIONE 2,5-Cyclohexadiene-1,4-dione,2,6-dimethyl- |
| CAS | 527-61-7 |
| EINECS | 208-420-8 |
| InChI | InChI=1/C8H8O2/c1-5-3-7(9)4-6(2)8(5)10/h3-4H,1-2H3 |
| Molecular Formula | C8H8O2 |
| Molar Mass | 136.15 |
| Density | 1.115 |
| Melting Point | 71-73°C(lit.) |
| Boling Point | 201℃ |
| Flash Point | 71℃ |
| Water Solubility | Soluble in chloroform. Insoluble in water. |
| Appearance | Needle-Like Crystalline Solid |
| Color | Yellow to brown |
| BRN | 2041345 |
| Storage Condition | Room Temprature |
| Stability | Stable. Combustible. Incompatible with oxidizing agents. |
| Refractive Index | 1. |
| MDL | MFCD00001605 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S37/39 - Wear suitable gloves and eye/face protection S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. |
| WGK Germany | 3 |
| RTECS | DK4825000 |
| HS Code | 29146990 |