| Name | 1,4-Dibromonaphthalene |
| Synonyms | 1,4-DBN 1,4-DIBROMONAPHTHALE 1,4-DIBROMONAPTHALENE 1,4-Dibromonaphthalene 1,4-dibromo-naphthalen 1,4-DIBROMONAPHTHALENE Naphthalene, 1,4-dibromo- 1,4-dibroMinated Naphthalenes |
| CAS | 83-53-4 |
| EINECS | 201-484-8 |
| InChI | InChI=1/C10H6Br2/c11-9-5-6-10(12)8-4-2-1-3-7(8)9/h1-6H |
| InChIKey | IBGUDZMIAZLJNY-UHFFFAOYSA-N |
| Molecular Formula | C10H6Br2 |
| Molar Mass | 285.96 |
| Density | 1.8199 (estimate) |
| Melting Point | 80-82 °C |
| Boling Point | 288.1°C (rough estimate) |
| Flash Point | 181.4°C |
| Water Solubility | 347.9ug/L(25 ºC) |
| Solubility | Chloroform, DMSO (Slightly), Methanol (Slightly) |
| Vapor Presure | 0-93.326Pa at 25℃ |
| Appearance | Orange-brown fine crystal |
| Color | White to light beige |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.6000 (estimate) |
| MDL | MFCD00041823 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S24/25 - Avoid contact with skin and eyes. S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. |
| TSCA | Yes |
| HS Code | 29039990 |
| Hazard Class | IRRITANT |
| melting point | 80-82 °C |
| boiling point | 288.1°C (rough estimate) |
| density | 1.8199 (estimate) |
| refractive index | 1.6000 (estimate) |
| storage conditions | Sealed in dry,Room Temperature |
| morphology | Crystalline Powder or Crystals |
| color | White to light beige |
| water solubility | 347.9ug/L(25 °C) |
| InChIKey | IBGUDZMIAZLJNY-UHFFFAOYSA-N |
| EPA chemical information | Naphthalene, 1,4-dibromo- (83-53-4) |
| LogP | 4.95-5.02 |
| EPA chemical substance information | information provided by: ofmpeb.epa.gov (external link) |
| Use | 1, 4-dibromonaphthalene is used for the enucleation of polycyclic aromatic hydrocarbons. It is also used in the synthesis of novel orally active dual NK1/NK2 antagonists. |
| dangerous goods mark | Xi |
| hazard category code | 36/37/38 |
| safety instructions | 24/25-26 |
| TSCA | Yes |
| HazardClass | IRRITANT |
| customs code | 29039990 |
| use | 1, 4-dibromo naphthalene is mainly used in pharmaceutical and biochemical industries. |
| use | 1, 4-dibromnaphthalene is used for enucleation of polycyclic aromatic hydrocarbons. It is also used to synthesize novel orally active dual NK1/NK2 antagonists. |