| Name | (1S,2S)-(+)-1,2-Diaminocyclohexane |
| Synonyms | S-DACH (S,S)-1,2-DIAMINOCYCLOHEXANE (1S,2S)-Cyclohexane-1,2-Diamin (S,S)-(+)-1,2-DIAMINOCYCLOHEXANE (+)-(S,S)-1,2-DIAMINOCYCLOHEXANE (1S,2S)-(+)-1,2-Diaminocyclohexane (1S,2S)-(+)-1,2-DIAMINOCYCLOHEXANE (S,S)-DACH |
| CAS | 21436-03-3 |
| InChI | InChI=1/C6H14N2/c7-5-3-1-2-4-6(5)8/h5-6H,1-4,7-8H2 |
| InChIKey | SSJXIUAHEKJCMH-WDSKDSINSA-N |
| Molecular Formula | C6H14N2 |
| Molar Mass | 114.19 |
| Density | 0.951 |
| Melting Point | 39-45℃ |
| Boling Point | 104-110℃ (40 mmHg) |
| Flash Point | 76℃ |
| Water Solubility | soluble |
| Appearance | Morphological Crystals or Powder |
| Color | White to light beige |
| BRN | 2801645 |
| pKa | 10.76±0.70(Predicted) |
| Storage Condition | Keep in dark place,Inert atmosphere,2-8°C |
| Sensitive | Air Sensitive |
| Refractive Index | 1.4886 |
| Physical and Chemical Properties | Melting Point: 40-43°C(lit.) specific optical rotation 25.25 ° (589nm, c = 5, 1 M HCl) boiling point 104-110 ° C 40mm Hg(lit.) density 0.951 refractive index 1.4886 flash point 169 ° F storage conditions 2-8°C water soluble sensitivity Air Sensitive BRN 2801645 |
| Use | For the synthesis of a variety of Chiral reagents and pharmaceutical intermediates |
| Hazard Symbols | C - Corrosive![]() |
| Risk Codes | R34 - Causes burns |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. S45 - In case of accident or if you feel unwell, seek medical advice immediately (show the label whenever possible.) |
| UN IDs | UN 3259 |
| WGK Germany | 3 |
| HS Code | 29213000 |
| Hazard Class | 8 |
| Packing Group | III |
| specific rotation | 25.25 ° (589nm, c=5, 1 M HCl) |
| boiling point | 104-110 °C/40 mmHg (lit.) |
| density | 0.951 |
| refractive index | 1.4886 |
| flash point | 169 °F |
| storage conditions | Keep in dark place,Inert atmosphere,2-8°C |
| morphology | Crystals or Powder |
| acidity coefficient (pKa) | 10.76±0.70(Predicted) |
| color | White to light beige |
| optical activity (optical activity) | [α]20/D 25°, c = 5 in 1 M HCl |
| water solubility | soluble |
| sensitivity | Air Sensitive |
| BRN | 2801645 |
| InChIKey | SSJXIUAHEKJCMH-WDSKDSINSA-N |
| NIST chemical information | (1S,2S)-( )-1,2-Diaminocyclohexane(21436-03-3) |
use
(1S,2S)-( )-1, 2-cyclohexanediamine can be used as a variety of chiral synthesis reagents. It is an organic synthesis intermediate and a pharmaceutical intermediate. It can be used in laboratory research and development processes and biochemical production processes. It is mainly used as an intermediate for bulk drug oxaliplatin.
A variety of chiral synthetic reagents, oxaliplatin intermediates.
for the synthesis of a variety of chiral reagents and pharmaceutical intermediates