| 1 | 6813-05-4 | [1R,3aβ,7aβ,(-)]-Octahydro-4-methyl-8-methylene-7α-isopropyl-1α,4α-methano-1H-indene | C18H15ClN4O3 | 370.7897 | | |
| 2 | 6813-07-6 | 3,7β-Dihydroxy-24-methyl-27-norlanost-24-en-11-one | C30H50O3 | 458.7162 | | |
| 3 | 6813-08-7 | (3S,9bS)-3,3aβ,4,5,6,6aβ,7,8-Octahydro-8β-(3-furyl)-3-methyl-6-methylene-9aαH-3,9b-propano-2H-pyrano[4,3,2-ij][2]benzopyran-2-one | C20H24O4 | 328.4 | | |
| 4 | 6813-21-4 | (4aR)-3,4,4a,5,6,7,8,8aα-Octahydro-1,4aβ-dimethyl-7-(1-methylethylidene)naphthalene | C15H24 | 204.35 | | |
| 5 | 6813-37-2 | DELTA1,1'-BIISOINDOLINE-3,3'-DITHIONE | C16H10N2S2 | 294.39 | | |
| 6 | 6813-38-3 | 2,2'-Bipyridyl-4,4'-dicarboxylic acid | C12H8N2O4 | 244.2 | >310°C | insoluble |
| 7 | 6813-46-3 | 8H-Thiopyrano[3,2-f]benzothiazol-8-one,6,7-dihydro-(8CI) | C10H7NOS2 | 221.3 | | |
| 8 | 6813-54-3 | 1,4-DIOXA-8-AZASPIRO[4.5]DECAN-7-ONE | C7H11NO3 | 157.17 | | |
| 9 | 6813-59-8 | BETA-AMYRIN | C30H50O2 | 442.73 | | |
| 10 | 6813-82-7 | N-ACETYL L-MANNOSAMINE | C8H15NO6 | 221.21 | | |
| 11 | 6813-89-4 | Bicyclo[4.2.0]octa-1,3,5-trien-7-yl(phenyl) ketone oxime | C15H13NO | 223.27 | | |
| 12 | 6813-90-7 | Benzyl(bicyclo[4.2.0]octa-1,3,5-trien-7-yl) ketone oxime | C16H15NO | 237.3 | | |
| 13 | 6813-91-8 | Bicyclo[4.2.0]octa-1,3,5-trien-7-yl(methyl) ketone O-methyl oxime | C11H13NO | 175.23 | | |
| 14 | 6813-92-9 | Bicyclo[4.2.0]octa-1,3,5-trien-7-yl(methyl) ketone O-(2-hydroxypropyl)oxime | C13H17NO2 | 219.28 | | |
| 15 | 6813-93-0 | Ethanone, 1-bicyclo4.2.0octa-1,3,5-trien-7-yl-, O-acetyloxime | C12H13NO2 | 203.24 | | |
| 16 | 6813-95-2 | Bicyclo[4.2.0]octa-1,3,5-trien-7-yl(methyl) ketone O-allyl oxime | C13H15NO | 201.26 | | |
| 17 | 68130-12-1 | PEG-15 DEDM HYDANTOIN | C2H8BNO3 | 104.90082 | | |
| 18 | 68130-14-3 | 乙酰化二淀粉磷酸酯 | C2H4O2.x(H3PO4).x(C6H10O5) | | | |
| 19 | 68130-15-4 | GUM GUAR CARBOXYMETHYL ETHER 2-HYDROXY-& | | | 246°C (dec.)(lit.) | |
| 20 | 68130-17-6 | 2-Butenedioic acid (2Z)-, homopolymer, butyl ester | C8H12O4 | 172.17848 | | |
| 21 | 68130-18-7 | VANADIUMHYDROXIDEOXIDEPHOSPHATE | HO.O4P.O.V | 178.92 | | |
| 22 | 68130-19-8 | silicic acid, lead nickel salt | NiO6PbSi2 | 418.0608 | | |
| 23 | 68130-20-1 | Starch hydrogen 1,2-benzenedicarboxylate | | | | |
| 24 | 68130-22-3 | Ethanol, 2-methoxy-, ester with boric acid (H3BO3) | C3H11BO5 | 137.93 | | |
| 25 | 68130-24-5 | Decanoic acid, ester with 2,2'-[oxybis(methylene)]bis[2-(hydroxymethyl)-1,3-propanediol] octanoate pentanoate | C42H76O14 | 805.04444 | | |
| 26 | 68130-25-6 | Decanoic acid, ester with 2,2-bis(hydroxymethyl)-1,3-propanediol 2-ethylhexanoate octanoate | C31H64O10 | 596.84 | | 1μg/L at 20℃ |
| 27 | 68130-26-7 | PENTAERYTHRITOL ESTER OF HEPTANOIC, CAPRYLIC, AND CAPRIC ACIDS) | C30H62O10 | 582.80728 | | |
| 28 | 68130-29-0 | Decanoic acid, ester with 2,2-bis[[3-hydroxy-2,2-bis(hydroxymethyl)propoxy]methyl]-1,3-propanediol heptanoate octanoate | C40H82O16 | 819.06948 | | |
| 29 | 68130-30-3 | Decanoic acid, ester with 2,2-bis[[3-hydroxy-2,2-bis(hydroxymethyl)propoxy]methyl]-1,3-propanediol octanoate pentanoate | C38H78O16 | 791.01632 | | |
| 30 | 68130-31-4 | Oxirane, (chloromethyl)-, polymer with α-hydro-ω-hydroxypoly[ oxy(methyl-1,2-ethanediyl)], 2-propenoate | ((C3H6O)nH2O.C3H5ClO)x.xC3H4O2 | | | |
| 31 | 68130-33-6 | Hexanedioic acid, polymer with 2,2-bis(hydroxymethyl)-1,3-propanediol, (9Z)-9-octadecenoate | C29H54O9 | 546.73366 | | |
| 32 | 68130-34-7 | Hexanedioic acid, polymer with 2,2-bis(hydroxymethyl)-1,3-propanediol, octadecanoate | C29H58O10 | 566.77 | | |
| 33 | 68130-35-8 | Decanedioic acid, polymer with α-hydro-ω-hydroxypoly( oxy-1,2-ethanediyl), 2-ethylhexyl ester | (C10H18O4.(C2H4O)nH2O)x.xC8H18O | | | |
| 34 | 68130-36-9 | Molybdenum nickel hydroxide oxide phosphate | H4Mo3Ni3O24P4 | 975.812604 | | |
| 35 | 68130-37-0 | Cobalt molybdenum hydroxide oxide phosphate | Co3H4Mo3O24P4 | 976.532004 | | |
| 36 | 68130-38-1 | ammonium trisodium divanadate | H4NNa3O6V2+2 | 284.88717 | | |
| 37 | 68130-39-2 | Ethanol, 2,2'-iminobis-, N-coco alkyl derivs., phosphates (salts) | | | | |
| 38 | 68130-40-5 | Polyoxy(methyl-1,2-ethanediyl), .alpha.-hydro-.omega.-hydroxy-, ether with 2-ethyl-2-(hydroxymethyl)-1,3-propanediol (3:1), polymer with .alpha.-hydro-.omega.-hydroxypolyoxy(methyl-1,2-ethanediyl) and 1,1-methylenebis4-isocyanatobenzene, isocyanate-termin | (C15H10N2O2.(C3H6O)n(C3H6O)n(C3H6O)nC6H14O3.(C3H6O)nH2O)x | | | |
| 39 | 68130-41-6 | 1,3-Propanediol, 2-ethyl-2-(hydroxymethyl)-, polymer with α-hydro-ω-hydroxypoly[ oxy(methyl-1,2-ethanediyl)] and 1,1'-methylenebis[4-isocyanatobenzene], Me Et ketone oxime-blocked | (C15H10N2O2.C6H14O3.C4H9NO.(C3H6O)nH2O)x | | | |
| 40 | 68130-44-9 | Poly(oxy-1,2-ethanediyl), .alpha.- hydro-.omega.-hydroxy-, mono-C12-13-alkyl ethers, phosphates, potassium salts | | | | |
| 41 | 68130-45-0 | Poly(oxy-1,2-ethanediyl), .alpha.-hydro-.omega.-hydroxy-, mono-C12-13-alkyl ethers, phosphates | | | | |
| 42 | 68130-47-2 | Poly(oxy-1,2-ethanediyl), .alpha.-hydro-.omega.-hydroxy-, mono-C8-10-alkyl ethers, phosphates | | | | |
| 43 | 68130-48-3 | Octanoic acid, mixed diesters with hexanoic acid and triethylene glycol | C8H16O2.C6H14O4.C6H12O2 | 410.55 | | |
| 44 | 68130-49-4 | 1,2-Benzenedicarboxylic acid, mixed cyclohexyl and 2-ethylhexyl esters | C22H32O4 | 360.48708 | | |
| 45 | 68130-50-7 | 1,2,4-Benzenetricarboxylic acid, mixed decyl and hexyl and octyl esters | C15H31NO7 | 337.40914 | | |
| 46 | 68130-51-8 | Decanoic acid, mixed esters with heptanoic acid, isovaleric acid, octanoic acid and pentaerythritol | C37H68O8 | 640.93102 | | |
| 47 | 68130-52-9 | Decanoic acid, mixed esters with hexanoic acid, octanoic acid and trimethylolpropane | C30H62O9 | 566.80788 | | |
| 48 | 68130-53-0 | Decanoic acid, mixed esters with heptanoic acid, octanoic acid and trimethylolpropane | C10H20O2.C8H16O2.C7H14O2.C6H14O3 | 580.84 | | |
| 49 | 68130-55-2 | Hexanedioic acid, mixed esters with decanoic acid, heptanoic acid, octanoic acid and pentaerythritol | C36H58O10 | 650.83972 | | 1mg/L at 20℃ |
| 50 | 68130-56-3 | Formaldehyde, polymer with 6-phenyl-1,3,5-triazine-2,4-diamine, methylated | C10H11N5O | 217.22724 | | |
| 51 | 68130-60-9 | 2-Methyl-2-propenoic acid polymer with ethenylbenzene ethyl 2-propenoate and N-(hydroxymethyl)-2-propenamide butylated | C21H29NO6 | 391.46 | | |
| 52 | 68130-62-1 | 2-Propenamide, polymer with ethenylbenzene, ethyl 2-propenoate and formaldehyde, butylated | C17H23NO4 | 305.36882 | | |
| 53 | 68130-63-2 | 2-Propenamide, homopolymer, reaction products with dimethylamine and formaldehyde | C6H14N2O2 | 146.18756 | | |
| 54 | 68130-65-4 | Propanenitrile, 3-amino-, N-C11-13-isoalkyl derivs. | C3H6N2 | 70.09314 | | |
| 55 | 68130-67-6 | Propanenitrile, 3-(C12-18-alkyloxy) derivs. | C3H5N | 55.0785 | | |
| 56 | 68130-68-7 | 1,3-Propanediamine, N-[3-(C12-18-alkyloxy)propyl] derivs. | | | | |
| 57 | 68130-69-8 | 1-Propanamine, 3-(C16-22-alkyloxy) derivs. | C3H9N | | | |
| 58 | 68130-70-1 | 1-Propanamine, 3-(C12-18-alkyloxy) derivs. | C3H9N | | | |
| 59 | 68130-71-2 | Poly(oxy-1,2-ethanediyl), .alpha.-sulfo-.omega.-hydroxy-, ether with phenol 1-(methylphenyl)ethyl derivs., ammonium salts | ((C2H4O)nC6H6O4S.H3N)x | | | |
| 60 | 68130-72-3 | Poly(oxy-1,2-ethanediyl), .alpha.-1,1-biphenylyl-.omega.-hydroxy-, benzylated | | | | |
| 61 | 68130-75-6 | Phosphoric acid, C14-18 and C16-18-unsatd. alkyl esters, sodium salts | | | | |
| 62 | 68130-80-3 | Phenol, 4,4-(1-methylethylidene)bis-, polymer with (chloromethyl)oxirane, monoesters with C18-unsatd. fatty acid dimers | | | | |
| 63 | 68130-88-1 | Nonanedioic acid, reaction products with triethanolamine | C15H31NO7 | 337.41 | | |
| 64 | 68130-89-2 | Nonanedioic acid, reaction products with diethanolamine | C13H27NO6 | 293.35658 | | |
| 65 | 68130-96-1 | Benzenesulfonic acid, dodecyl-, compds. with 4,5-dihydro-1H-imidazole-1-ethanamine 2-nortall-oil alkyl derivs. (2:1) | C41H71N3O6S2 | 766.14894 | | |
| 66 | 68130-97-2 | POLYETHYLENEIMINE | C4H9Cl2N | 142.02 | | |
| 67 | 68130-98-3 | Aziridine, homopolymer, ethoxylated, phosphonomethylated | C2H5N | 43.0678 | | |
| 68 | 68130-99-4 | POLYETHYLENE GLYCOL) | C2H5N | | | |
| 69 | 68131-01-1 | Fatty acids, tall-oil, polymers with ethylene glycol, pentaerythritol, phthalic anhydride and tung oil | | | | |
| 70 | 68131-02-2 | Gelatins, phthalated | | | | |
| 71 | 68131-04-4 | Humic acid,sodium salt | C9H8Na2O4 | 226.14 | >300°C(lit.) | Soluble in water (33.3 mg in 1 mL) |
| 72 | 68131-05-5 | Hydrocarbon oils, process blends | | | | |
| 73 | 68131-08-8 | Linseed oil, polymer with formaldehyde, glycerol, pentaerythritol, phenol, phthalic anhydride and rosin | | | | |
| 74 | 68131-12-4 | Meat meal | | | | |
| 75 | 68131-13-5 | Naphthenic acids, reaction products with diethylenetriamine | | | | |
| 76 | 68131-23-7 | Rosin, reaction products with diethanolamine | | | | |
| 77 | 68131-27-1 | Soybean oil, polymer with ethylene glycol, pentaerythritol, phthalic anhydride and tung oil | | | | |
| 78 | 68131-29-3 | Soybean oil, polymer with phthalic anhydride, trimellitic anhydride and trimethylolpropane | | | | |
| 79 | 68131-30-6 | Sulfite liquors and Cooking liquors, green | | | | |
| 80 | 68131-31-7 | Sulfite liquors and Cooking liquors, spent, alkali-treated | | | | |
| 81 | 68131-32-8 | Sulfite liquors and Cooking liquors, spent, fermented | | | | |
| 82 | 68131-33-9 | Sulfite liquors and Cooking liquors, white | | | | |
| 83 | 68131-36-2 | sunflower oil/phthalic anhydride/pentaerythritol/EG resin | | | | |
| 84 | 68131-37-3 | Syrups, corn, dehydrated | | | | |
| 85 | 68131-38-4 | Alkenes, ethylene-manuf.-by-product dicyclopentadiene-conc., polymers with ethylene-manuf.-by-product C5-cut alkene oligomers and tall oil, maleated | | | | |
| 86 | 68131-39-5 | C12-15 PARETH-2 | C12H25O.(C2H4O)n | 1199.55 | | |
| 87 | 68131-40-8 | POLYETHYLENE GLYCOL TRIMETHYLNONYL ETHER | | | | |
| 88 | 68131-41-9 | Alkenes, ethylene-manuf.-by-product C5-cut, oligomers, polymers with ethylene-manuf.-by-product dicyclopentadiene-conc. alkenes | | | | |
| 89 | 68131-43-1 | Alkenes, ethylene-manuf.-by-product dicyclopentadiene-conc., polymd. | | | | |
| 90 | 68131-44-2 | Alkenes, ethylene-manuf.-by-product dicyclopentadiene-conc., polymers with ethylene-manuf.-by-product piperylene-cut alkenes | | | | |
| 91 | 68131-47-5 | Alkenes, ethylene-manuf.-by-product piperylene-cut, polymd. | | | | |
| 92 | 68131-49-7 | Aromatic hydrocarbons, C6-10, acid-treated, neutralized | | | | |
| 93 | 68131-51-1 | Caseins,borated | | | | |
| 94 | 68131-52-2 | Carboxymethylcasein | | | | |
| 95 | 68131-54-4 | POTASSIUM CASEINATE | | | | |
| 96 | 68131-55-5 | Castor oil, polymer with glycerol and sebacic acid | | | | |
| 97 | 68131-57-7 | Fatty acids, C12-18, barium salts | | | | |
| 98 | 68131-58-8 | Fatty acids, C10-18, cadmium salts | | | | |
| 99 | 68131-59-9 | Fatty acids, C12-18, cadmium salts | | | | |
| 100 | 68131-60-2 | Fatty acids, C12-18, lead salts | | | | |
| 101 | 68131-61-3 | Fatty acids, C12-18, zinc salts | | | | |
| 102 | 68131-71-5 | Polyphosphoric acids, esters with triethanolamine | | | | |
| 103 | 68131-72-6 | Polyphosphoric acids, esters with triethanolamine, sodium salts | | | | |
| 104 | 68131-73-7 | Polyethylene Polyamine | C12H5N7O12 | 439.211 | | 50g/L at 20℃ |
| 105 | 68131-74-8 | Ashes (residues) | | | | |
| 106 | 68131-75-9 | Gases (petroleum), C3-4 | | | | |
| 107 | 68131-76-0 | Alkenes,ethylene-manuf.-by-product C5-cut,oligomers,polymers with steam-cracked petroleum distillates | | | | |
| 108 | 68131-79-3 | distillates, petroleum, steam cracked/coal naphtha | | | | |
| 109 | 68131-80-6 | distillates (petroleum), steam-cracked, polymers withacid-treated coal solvent naphtha and phenol | (C6H6O·W99·W99)x | | | |
| 110 | 68131-81-7 | distillates, petroleum, steam cracked/coal naphtha polymer | | | | |
| 111 | 68131-82-8 | Distillates (petroleum), steam-cracked, polymers with coal solvent naphtha and methylstyrene | | | | |
| 112 | 68131-83-9 | distillates, petroleum, steam cracked/coal naphtha/phenol | | | | |
| 113 | 68131-84-0 | Alkenes, ethylene-manuf.-by-product C5-cut, oligomers, polymers with ethylene-manuf.-by-product dicyclopentadiene-conc. alkenes and steam-cracked petroleum distillates | | | | |
| 114 | 68131-87-3 | Alkenes, ethylene-manuf.-by-product dicyclopentadiene-conc., polymers with steam-cracked petroleum distillates | | | | |
| 115 | 68131-89-5 | Alkenes, ethylene-manuf.-by-product piperylene-cut, polymers with steam-cracked petroleum distillates | | | | |
| 116 | 68131-92-0 | Extract residues, acidified pigskin, heavy layer | | | | |
| 117 | 68131-93-1 | Extract residues, acidified pigskin, light layer | | | | |
| 118 | 68131-98-6 | Leather, scrap | | | | |
| 119 | 68131-99-7 | Naphtha (petroleum), light steam-cracked, debenzenized, polymers | | | | |
| 120 | 68132-00-3 | POLYCYCLOPENTADIENE | N3- | 42.0201 | | |
| 121 | 68132-02-5 | Solvent naphtha (coal), polymd. | | | | |
| 122 | 68132-03-6 | POLYMERIZEDSOLVENTNAPHTHA(COALDERIVED) | | | | |
| 123 | 68132-04-7 | Solvent naphtha (coal), polymer with methylstyrene | | | | |
| 124 | 68132-06-9 | Tar acids, cresylic, reaction products with coal solvent naphtha | | | | |
| 125 | 68132-16-1 | soybean oil/ rosin/ maleic anhydride/ glycerol resin | | | | |
| 126 | 68132-18-3 | Quaternary ammonium compounds, [1,2-ethanediylbis(oxy-2,1-ethanediyl)]bis[coco alkyldimethyl, dichlorides | | | | |
| 127 | 68132-19-4 | Polyphosphoric acids, compds. with ethoxylated coco alkylamines | | | | |
| 128 | 68132-21-8 | Perilla oil | C24H38O4 | 390.55612 | | |
| 129 | 68132-27-4 | Imidazolium compounds, 1,1'-(1,2-ethanediyl)bis[4,5-dihydro-1-methyl-2-nortallow alkyl, bis(Me sulfates) | | | | |
| 130 | 68132-29-6 | Glycerides, C10-12 | C11H22O4 | 218.28998 | | |
| 131 | 68132-40-1 | Fatty acids, tall-oil, compds. with 2-[(2-aminoethyl)amino]ethanol-tall-oil fatty acid reaction products | | | | |
| 132 | 68132-42-3 | fatty acids, tall-oil, polymers with glycerol,phthalic anhydride and vinyltoluene | (C9H10·C8H4O3·C3H8O3·W99)x | | | |
| 133 | 68132-45-6 | Fatty acids, tall-oil, polymers with allyl alc. and styrene | | | | |
| 134 | 68132-46-7 | Fatty acids, tall-oil, compds. with triethanolamine | | | | 1g/L |
| 135 | 68132-47-8 | Fatty acids, tall-oil, compds. with ethanolamine | | | | |
| 136 | 68132-48-9 | Fatty acids, tall-oil, compds. with 4,5-dihydro-2-nortall-oil alkyl-1H-imidazole-1-ethanol | | | | |
| 137 | 68132-49-0 | Fatty acids, tall-oil, compds. with N-butyl-1-butanamine | | | | |
| 138 | 68132-50-3 | Fatty acids, tall-oil, ammonium salts | C7H9NO5 | 187.15006 | | |
| 139 | 68132-59-2 | fatty acids/ tall oil ethoxylate/ polyethylenepolyamine | | | | |
| 140 | 68132-60-5 | Fatty acids, tall-oil, compds. with N-[2-(4,5-dihydro-2-nortall-oil alkyl-1H-imidazol-1-yl)ethyl]tall-oil fatty amides | | | | |
| 141 | 68132-61-6 | Fatty acids, C18-unsatd., dimers, compds. with 4,5-dihydro- 2-nortall-oil alkyl-1H-imidazole-1-ethanol | | | | |
| 142 | 68132-65-0 | Fatty acids, tallow, compds. with morpholine | | | | |
| 143 | 68132-66-1 | Fatty acids, coco, reaction products with diethanolamine and tallow fatty acids | | | | |
| 144 | 68132-68-3 | Fatty acids, coco, polymers with phthalic anhydride and trimethylolpropane | (C8H4O3·C6H14O3·W99)x | | | |
| 145 | 68132-74-1 | Castor oil, dehydrated, polymer with glycerol, phthalic anhydride and soybean oil | (C8H4O3·C3H8O3·W99·W99)x | | | |
| 146 | 68132-79-6 | Distillates (petroleum), oxidized light, compds. with 4,5-dihydro-2-nortall-oil alkyl-1H-imidazole-1-ethanamine | | | | |
| 147 | 68132-80-9 | allyl trimethylhexanoate | C12H22O2 | 198.31 | | |
| 148 | 68132-81-0 | sodium 2-[2-[2-[bis(2-methylpropyl)phenoxy]ethoxy]ethoxy]ethanesulphonate | C20H33NaO6S | 424.52719 | | |
| 149 | 68132-82-1 | alpha,2(or beta,2)-dimethyl-1H-imidazole-1-ethanol | C7H12N2O | 140.18298 | | |
| 150 | 68132-83-2 | alpha(or beta)-methyl-1H-imidazole-1-ethanol | C6H10N2O | 126.1564 | | |
| 151 | 68132-85-4 | Polyoxy(methyl-1,2-ethanediyl), .alpha.,.alpha.,.alpha.-1,2,3-propanetriyltris.omega.-hydroxy-, polymer with 1,1-methylenebis4-isocyanatocyclohexane | (C15H22N2O2.(C3H6O)n(C3H6O)n(C3H6O)nC3H8O3)x | | | |
| 152 | 68132-86-5 | Oxirane, methyl-, polymer with 1,3-diisocyanatomethylbenzene, .alpha.-hydro-.omega.-hydroxypoly(oxy-1,4-butanediyl) and oxirane | (C9H6N2O2.(C4H8O)nH2O.C3H6O.C2H4O)x | | | |
| 153 | 68132-89-8 | 3-[[4-[(6-amino-1-hydroxy-3-sulpho-2-naphthyl)azo]-5-methoxy-o-tolyl]azo]naphthalene-1,5-disulphonic acid, lithium salt, compound with 2,2',2''-nitrilotriethanol | C34H38LiN6O14S3+ | 857.83332 | | |
| 154 | 68132-90-1 | Methanaminium, N-[4-[[4-(dimethylamino)phenyl]phenylmethylene]-2,5-cyclohexadien-1-ylidene]-N-methyl-, tetracosa-mu-oxododecaoxo[mu12-[phosphato(3-)-O:O:O:O':O':O':O'':O'':O'':O''':O''':O''']]dodecatungstate(3-) (3:1) | C70H79N6+3 | 1004.41646 | | |
| 155 | 68132-91-2 | Cuprate(6-), [2-[[[[3-[[4-chloro-6-[[4-[[4-chloro-6-[(3-sulfophenyl)amino]-1,3,5-triazin-2-yl]amino]-2,5-disulfophenyl]amino]-1,3,5-triazin-2-yl]amino]-2-hydroxy-5-sulfophenyl]azo]phenylmethyl]azo]-5-sulfobenzoato(8-)]-, pentasodium hydroge | C38H21Cl2CuN14Na5O18S5 | 1371.38219 | | |
| 156 | 68132-92-3 | tetrasodium hydrogen bis[5-[(4-chloro-6-methoxy-1,3,5-triazin-2-yl)amino]-4-hydroxy-3-[(2-hydroxy-5-nitrophenyl)azo]naphthalene-2,7-disulphonato(4-)]chromate(5-) | C40H21Cl2CrN14Na4O22S4 | 1392.79652 | | |
| 157 | 68132-93-4 | tetrasodium hydrogen bis[5-[(4-chloro-6-methoxy-1,3,5-triazin-2-yl)amino]-4-hydroxy-3-[(2-hydroxy-5-nitrophenyl)azo]naphthalene-2,7-disulphonato(4-)]cobaltate(5-) | C40H21Cl2CoN14Na4O22S4 | 1399.73362 | | |
| 158 | 68132-94-5 | lithium diethyldiphenylborate(1-) | C16H20BLi | 230.082 | | |
| 159 | 68132-95-6 | lithium dimethyldiphenylborate(1-) | C14H16BLi | 202.02884 | | |
| 160 | 68132-96-7 | Polyoxy(methyl-1,2-ethanediyl), .alpha.-2-(diethylmethylammonio)ethyl-.omega.-hydroxy-, chloride | (C3H6O)nC7H18NO.Cl | | | |
| 161 | 68133-00-6 | Ethanesulfonic acid, 2-(((hydroxy-sec-pentylphenyl)methyl)methylamino)-, monosodium salt | C15H24NNaO4S | 337 | | |
| 162 | 68133-01-7 | 2-Butenedioic acid (Z)-, polymer with 1,3-butadiene, ammonium salt | C8H10O4 | 170.16 | | |
| 163 | 68133-02-8 | 5,8-dibromo-2-(3-hydroxyquinolin-2-yl)-1H-benz[f]indene-1,3(2H)-dione | C22H11Br2NO3 | 497.14 | | |
| 164 | 68133-04-0 | dibenzyl (Z,Z,Z)-6,6,13,13-tetroctyl-4,8,11,15-tetraoxo-5,7,12,14-tetraoxa-6,13-distannoctadeca-2,9,16-trienedioate | C58H88O12Sn2 | 1214.73 | | |
| 165 | 68133-05-1 | sodium 5-[(2-hydroxy-1-naphthyl)azo]naphthalene-2-sulphonate | C20H13N2NaO4S | 400.38299 | | |
| 166 | 68133-06-2 | N-[2-[(2-aminoethyl)amino]ethyl]isooctadecan-1-amide | C22H47N3O | 369.62808 | | |
| 167 | 68133-07-3 | POLY[TRIMETHYLOLPROPANE/DI(PROPYLENE GLYCOL)-ALT-ADIPIC ACID/PHTHALIC ANHYDRIDE], POLYOL | C26H42O13 | 562.60388 | <−25°C(lit.) | |
| 168 | 68133-11-9 | Poly(oxy-1,2-ethanediyl),.alpha.-sulfo-.omega.-[(1,1-dimethylpropyl)phenoxy]-,ammoniumsalt | (C2H4O)nC11H16O4S.H3N | | | |
| 169 | 68133-13-1 | diisooctyl 4-octylphenyl phosphite | C30H55O3P | 494.729661 | | |
| 170 | 68133-14-2 | Bis[[3-(isocyanatomethyl)phenyl]carbamic acid][[(diethoxyphosphinyl)methyl]imino]bis(2,1-ethanediyl) ester | C27H34N5O9P | 603.57 | | |
| 171 | 68133-15-3 | Naphthalenedisulfonicacid,disodiumsalt,polymerwithformaldehyde | (C10H8O6S2.CH2O.2Na)x | | | |
| 172 | 68133-17-5 | Naphthalenedisulfonicacid,diammoniumsalt,polymerwithformaldehyde | (C10H8O6S2.CH2O.2H3N)x | | | |
| 173 | 68133-18-6 | 2-Propenenitrile,polymer with diethenylbenzene and 2-methyl-1,3-butadiene | (C10H10·C5H8·C3H3N)x | | | |
| 174 | 68133-21-1 | Formaldehyde, polymer with dinonylphenol, methyloxirane, nonylphenol and oxirane | C45H78O5 | 699.09782 | | |
| 175 | 68133-22-2 | Formaldehyde, polymer with 4-(1,1-dimethylethyl)phenol, dinonylphenol, methyloxirane, nonylphenol and oxirane | C55H92O6 | 849.31538 | | |
| 176 | 68133-23-3 | hexasodium 6,3-dichloro-3,10-bis[[4-[[4-chloro-6-[(3-phosphonophenyl)amino]-1,3,5-triazin-2-yl]amino]-2,5-disulphonatophenyl]amino]triphenodioxazine-4,11-disulphonate | C48H26Cl4N14Na6O26P2S6 | 1748.886382 | | |
| 177 | 68133-24-4 | hexasodium 4-amino-3,6-bis[[5-[[4-chloro-6-[(3-sulphonatophenyl)amino]-1,3,5-triazin-2-yl]amino]-2-sulphonatophenyl]azo]-5-hydroxynaphthalene-2,7-disulphonate | C40H23Cl2N15Na6O19S6 | 1418.93434 | | |
| 178 | 68133-25-5 | 2-methoxyethyl N-(2-methoxy-5-nitrophenyl)-beta-alaninate | C13H18N2O6 | 298.29 | | |
| 179 | 68133-26-6 | 2-methoxyethyl N-(5-amino-2-methoxyphenyl)-beta-alaninate | C13H20N2O4 | 268.31 | | |
| 180 | 68133-27-7 | 4-hydroxy-3-[(4-methoxy-2-sulphophenyl)azo]-6-(methylamino)naphthalene-2-sulphonic acid | C18H17N3O8S2 | 467.47 | | |
| 181 | 68133-28-8 | sodium hydrogen 6-(acetylmethylamino)-4-hydroxy-3-[(3-phosphonatophenyl)azo]naphthalene-2-sulphonate | C19H16N3Na2O8PS | 523.363941 | | |
| 182 | 68133-29-9 | sodium trihydrogen 4,5-dihydro-5-oxo-4-[(3-phosphonatophenyl)azo]-1-(4-sulphonatophenyl)-1H-pyrazole-3-carboxylate | C16H10N4Na3O9PS | 534.280071 | | |
| 183 | 68133-31-3 | disodium 2-[3-(2,4-dichlorophenyl)-1-ethyltriazen-2-yl]-5-sulphonatobenzoate | C15H12Cl2N3Na2O5S | 463.22342 | | |
| 184 | 68133-32-4 | disodium 2,2'-[(2,2'-dimethoxy[1,1'-biphenyl]-4,4'-diyl)bis(1-methyl-2-triazene-3,1-diyl)]bisethanesulphonate | C20H26N6Na2O8S2 | 588.56538 | | |
| 185 | 68133-33-5 | disodium 2,2'-[(3,3'-dichloro[1,1'-biphenyl]-4,4'-diyl)bis(1-methyl-2-triazene-3,1-diyl)]bisethanesulphonate | C18H20Cl2N6Na2O6S2 | 597.40354 | | |
| 186 | 68133-34-6 | N-[2-(diethylamino)ethyl]stearamide phosphate | C24H53N2O5P | 480.661781 | | |
| 187 | 68133-35-7 | 2-[(6-amino-1-hydroxy-3-sulpho-2-naphthyl)azo]benzoic acid | C17H13N3O6S | 387.37 | | |
| 188 | 68133-36-8 | (4-ethyl-2-heptadecyl-4,5-dihydrooxazol-4-yl)methyl stearate | C41H79NO3 | 634.07 | | |
| 189 | 68133-37-9 | N,N'-ethylenebis[N-(carboxymethyl)glycine], compound with 2,2'-iminobis(ethanol) (1:1) | C14H27N3O10 | 397.38 | | |
| 190 | 68133-38-0 | N-[2-[[2-[[2-[(2-aminoethyl)amino]ethyl]amino]ethyl]amino]ethyl]octanamide | C16H37N5O | 315.5 | | |
| 191 | 68133-39-1 | 1-chloro-3-(N-ethyl-m-toluidino)propan-2-ol hydrochloride | C12H19Cl2NO | 264.19136 | | |
| 192 | 68133-40-4 | octasodium 7,7'-[(2,2'-disulphonato[1,1'-biphenyl]-4,4'-diyl)bis[imino(6-chloro-1,3,5-triazine-4,2-diyl)imino[2-(carbamoylamino)]-4,1-phenylene]azo]]bis(naphthalene-1,3,6-trisulphonate) | C52H39Cl2N18NaO26S8 | 1682.35 | | |
| 193 | 68133-41-5 | 4-[(4-chloro-2-methylphenyl)azo]-3-hydroxy-N-(2-methylphenyl)naphthalene-2-carboxamide | C25H20ClN3O2 | 429.9 | | |
| 194 | 68133-42-6 | N-(2,5-dichlorophenyl)-3-hydroxy-4-[[2-methoxy-5-[(phenylamino)carbonyl]phenyl]azo]naphthalene-2-carboxamide | C31H22Cl2N4O4 | 585.44 | | |
| 195 | 68133-43-7 | dipotassium 2-butoxyethyl phosphate | C6H13K2O5P | 274.334781 | | |
| 196 | 68133-47-1 | 1,3-Propanediol, 2-amino-2-(hydroxymethyl)-, polymer with methyloxirane and oxirane | C9H21NO5 | 223.27 | | |
| 197 | 68133-49-3 | Methyloxirane,oxirane,2-ethyl-2-(hydroxymethyl)-1,3-propanediol ether,1,1'-methylenebis[4-isocyanatobenzene] polymer | C26H34N2O7 | 486.57 | | |
| 198 | 68133-51-7 | 1,3-Benzenedicarboxylic acid, polymer with 1,4-benzenedicarboxylic acid, 1,4-butanediol and hexahydro-1,3-isobenzofurandione | C28H32O13 | 576.54588 | | |
| 199 | 68133-56-2 | 5-amino-1,3,3-trimethylcyclohexanemethylamine toluene-p-sulphonate | C17H30N2O3S | 342.4967 | | |
| 200 | 68133-57-3 | N-aminoethylethylenediamine 4-methylbenzenesulphonate | C11H21N3O3S | 275.36774 | | |
| 201 | 68133-58-4 | stearic acid, compound with 2-amino-2-methylpropan-1-ol (1:1) | C22H47NO3 | 373.62 | | |
| 202 | 68133-59-5 | (2-aminoethanolato-N,O)platinum | C2H6NOPt- | 255.15314 | | |
| 203 | 68133-60-8 | 1-BENZYL-3-SODIUMCARBOXY-PYRIDINIUM CHLORIDE | C13H11ClNNaO2 | 271.67 | | 898g/L at 20℃ |
| 204 | 68133-61-9 | 5-[(3-ethyl-5,6-dimethylbenzoxazol-2(3H)-ylidene)ethylidene]-4-oxo-2-thioxothiazolidin-3-acetic acid | C18H18N2O4S2 | 390.48 | | |
| 205 | 68133-62-0 | oleic acid, compound with 2-(ethylamino)ethanol (1:1) | C22H45NO3 | 371.5976 | | |
| 206 | 68133-68-6 | sodium 1-(2-ethylhexyl) 4-hexyl 2-sulphonatosuccinate | C18H34NaO7S | 417.51313 | | |
| 207 | 68133-69-7 | 2-[(2-cyanoethyl)[4-[(6-nitrobenzothiazol-2-yl)azo]phenyl]amino]ethyl acetate | C20H18N6O4S | 438.46 | 167 °C | |
| 208 | 68133-70-0 | 1,5-dihydroxy-4-[(2-hydroxyethyl)amino]-8-(phenylamino)anthraquinone | C22H18N2O5 | 390.39 | | |
| 209 | 68133-71-1 | DISODIUM TRIDECYLSULFOSUCCINATE | C17H30Na2O7S | 424.46044 | | |
| 210 | 68133-72-2 | CIS-3-HEXENYL OXY-ACETALDEHYDE | C8H14O2 | 142.2 | | |
| 211 | 68133-73-3 | ISOAMYL GERANATE | C15H26O2 | 238.37 | | |
| 212 | 68133-74-4 | 2-(hex-3-enyl)cyclopentan-1-one | C11H18O | 166.26002 | | |
| 213 | 68133-75-5 | CINNAMIC ACID CIS-3-HEXEN-1-YL ESTER | C15H18O2 | 230.3 | | |
| 214 | 68133-76-6 | cis-3-Hexenyl Pyruvate | C9H14O3 | 170.21 | | |
| 215 | 68133-77-7 | TRANS-2-HEXENYL SALICYLATE | C13H16O3 | 220.26 | | |
| 216 | 68133-78-8 | trans-2-Hexen-1-yl Phenylacetate | C14H18O2 | 218.29 | | |
| 217 | 68133-79-9 | Geranyl Cyclopentanone | C15H24O | 220.35 | | |
| 218 | 68133-80-2 | (Z)-1,1-Dimethoxy-4-decene | C12H24O2 | 200.32 | | |
| 219 | 68133-81-3 | Cuprate(5-), [2-[[4-chloro-6-[(2-methyl-5-sulfophenyl)amino]-1,3,5-triazin-2-yl]amino]-6-[[4-[(2,5-disulfophenyl)azo]-2-hydroxy-5-methylphenyl]azo]-5-hydroxy-1,7-naphthalenedisulfonato(7-)]-, pentasodium | C33H19ClCuN9Na5O17S5 | 1187.82691 | | |
| 220 | 68133-82-4 | dihydrogen bis[2-[(6-amino-1-hydroxy-3-sulpho-2-naphthyl)azo]benzoato(3-)]chromate(2-) | C34H21CrN6O12S2- | 821.69 | | |
| 221 | 68133-83-5 | triiodonitrosylruthenium | I3NORu | 511.78951 | | |
| 222 | 68133-84-6 | [(2-amino-2-oxoethoxy)acetato(2-)]nickel | C4H4NNiO4 | 188.77 | | |
| 223 | 68133-85-7 | [(2-amino-2-oxoethoxy)acetato(2-)]cobalt | C4H5CoNO4 | 190.02 | | |
| 224 | 68133-86-8 | tetrasodium pentakis(cyano-C)aurate | C5AuN5Na4 | 419.01263 | | |
| 225 | 68133-87-9 | tetrapotassium pentakis(cyano-C)aurate | C5AuKN5(-3) | 366.16 | | |
| 226 | 68133-88-0 | AMMONIUM AQUOPENTACHLORORUTHENATE(III) | Cl5H8N2Ru | 314.41 | | |
| 227 | 68133-89-1 | tris(ethylenediamine-N,N')platinum tetranitrate | C6H24N7O3Pt+3 | 437.37786 | | |
| 228 | 68133-90-4 | dihydrogen hexahydroxyplatinate, compound with 2-aminoethanol (1:2) | C2H8NO7Pt- | 353.17 | | |
| 229 | 68133-91-5 | bis(tetramethylammonium) platinate | C8H30N2O6Pt | 445.4116 | | |
| 230 | 68133-95-9 | Hexanedioic acid, polymer with 1,3-diisocyanatomethylbenzene, 1,6-hexanediol and 2,2'-oxybis[ethanol] | C25H40N2O11 | 544.5919 | | |
| 231 | 68133-97-1 | hydrogen 3-(2-carboxylatoethyl)-2-[3-[3-(2-carboxylatoethyl)-3H-benzoxazol-2-ylidene]prop-1-enyl]benzoxazolium | C23H20N2O6 | 420.42 | | |
| 232 | 68133-98-2 | 4-Nitro-N-propylbenzylamine hydrochloride | C10H14N2O2.HCl | 230.7 | 233-235°C (lit.) | |
| 233 | 68134-00-9 | Decanedioic acid, polymer with 1,2-ethanediamine, 1,6-hexanediamine and (Z,Z)-9,12-octadecadienoic acid dimer | C36H74N4O6 | 659.01 | | |
| 234 | 68134-01-0 | citric acid, ammonium zinc salt | C6H9NO7Zn | 272.52816 | | |
| 235 | 68134-02-1 | (R)-12-hydroxyoleic acid, compound with morpholine (1:1) | C22H43NO4 | 385.59 | | |
| 236 | 68134-03-2 | 1,5-bis(hydroxymethyl)biguanide monohydrochloride | C4H12ClN5O2 | 197.62338 | | |
| 237 | 68134-04-3 | hexasodium 2,2'-[vinylenebis[(3-sulphonato-4,1-phenylene)imino[6-[(3-amino-3-oxopropyl)(phenylmethyl)amino]-1,3,5-triazine-4,2-diyl]imino]]bis(benzene-1,4-disulphonate) | C52H44N14Na6O20S6 | 1515.31618 | | |
| 238 | 68134-05-4 | 2-ethoxyethyl oleate | C22H42O3 | 354.57 | | |
| 239 | 68134-06-5 | 1,3-DIMETHYLBUTYLGLYCIDYLETHER | C9H18O2 | 158.24 | | |
| 240 | 68134-07-6 | 6-METHYLHEPTYLGLYCIDYLETHER | C11H22O2 | 186.29 | | |
| 241 | 68134-08-7 | 4,4'-bis[[6-anilino-4-[(2-hydroxypropyl)amino]-1,3,5-triazin-2-yl]amino]stilbene-2,2'-disulphonic acid | C38H40N12O8S2 | 856.93 | | |
| 242 | 68134-12-3 | N,N',N'',N'''-[carbonylbis(nitrilodiethylene)]tetrastearamide diacetate | C85H168N6O9 | 1418.27822 | | |
| 243 | 68134-13-4 | [2-[(2-hydroxyethyl)ammonio]ethyl](stearoyl)ammonium hydrogen phosphate | C22H49N2O6P | 468.608021 | | |
| 244 | 68134-14-5 | 2-heptadecyl-1-(2-hydroxyethyl)-4,5-dihydro-1H-imidazolium dihydrogen phosphate | C22H47N2O5P | 450.592741 | | |
| 245 | 68134-15-6 | sodium 2-hydroxy-3-[(2-hydroxyethyl)[2-[(1-oxo-9-octadecenyl)amino]ethyl]amino]propanesulphonate | C25H49N2NaO6S | 528.72113 | | |
| 246 | 68134-16-7 | 5-(Acetylamino)-4-hydroxy-3-[[4-[[2-(sulfooxy)ethyl]sulfonyl]phenyl]azo]-2,7-naphthalenedisulfonic acid | C20H19N3O14S4 | 653.64 | | |
| 247 | 68134-17-8 | N-Methyl-N-phenyl-9-[(sodiosulfo)oxy]octadecanamide | C25H43NO5S.Na | 492.68 | | |
| 248 | 68134-18-9 | 4-[[3-[[3-[[4,5-Dihydro-3-methyl-5-oxo-4-[(4-sulfophenyl)azo]-1H-pyrazol]-1-yl]phenyl]azo]-2,4-dihydroxyphenyl]azo]-5-hydroxy-6-(phenylazo)-2,7-naphthalenedisulfonic acid | C38H28N10O13S3 | 928.88 | | |
| 249 | 68134-19-0 | 2-[[4-[[2-Hydroxy-5-[(4-nitro-2-sulfophenyl)amino]phenyl]azo]phenyl]amino]-5-nitrobenzenesulfonic acid | C24H18N6O11S2 | 630.56 | | |
| 250 | 68134-20-3 | 4-amino-6-[(2-chloro-4-nitrophenyl)azo]-5-hydroxy-3-[[2-hydroxy-4-[[3-hydroxy-4-[[4-[(4-nitro-2-sulphophenyl)amino]phenyl]azo]phenyl]amino]phenyl]azo]naphthalene-2,7-disulphonic acid | C40H28ClN11O16S3 | 1050.36 | | |
| 251 | 68134-21-4 | 4-Hydroxy-5-[[2-hydroxy-4-[[3-hydroxy-4-[[4-[(4-nitro-2-sulfophenyl)amino]phenyl]azo]phenyl]amino]phenyl]azo]-3-[(4-methoxyphenyl)azo]-2,7-naphthalenedisulfonic acid | C41H31N9O15S3 | 985.93 | | |
| 252 | 68134-22-5 | Pigment Yellow 154 | C18H14F3N5O3 | 405.33 | | 14.2μg/L at 23℃ |
| 253 | 68134-23-6 | butyl 2-oxocyclohexanepropionate | C13H22O3 | 226.31 | | |
| 254 | 68134-24-7 | 1-[2-(tert-butoxy)ethoxy]butane | C10H22O2 | 174.28 | | |
| 255 | 68134-25-8 | 2-amino-3,4-xylenol | C8H11NO | 137.18 | | |
| 256 | 68134-26-9 | 2-(2-heptadecyl-4,5-dihydro-1H-imidazol-1-yl)ethyl stearate | C40H78N2O2 | 619.06 | | |
| 257 | 68134-27-0 | 2-(2-heptadecyl-4,5-dihydro-1H-imidazol-1-yl)ethyl stearate, monoacetate | C42H82N2O4 | 679.11148 | | |
| 258 | 68134-28-1 | potassium ethyl octylphosphonate | C10H22KO3P | 260.351941 | | |
| 259 | 68134-30-5 | 6-[(hydroxymethyl)(phenylsulphonyl)amino]hexanoic acid, compound with 2,2',2''-nitrilotriethanol (1:1) | C19H34N2O8S | 450.54686 | | |
| 260 | 68134-31-6 | L-glycero-L-ido-heptonic acid, cyclic 5,6-ester with boric acid, disodium salt | C7H13BO9.2Na | 297.97 | | |
| 261 | 68134-32-7 | 1-(2-cyanoethyl)-2-[4-[(2-ethoxyethyl)ethylamino]phenyl]benz[cd]indolium chloride | C26H28ClN3O | 433.97302 | | |
| 262 | 68134-33-8 | 2-[[4-(diethylamino)phenyl]azo]-6-ethoxy-3-ethylbenzothiazolium chloride | C21H27ClN4OS | 418.98328 | | |
| 263 | 68134-34-9 | 3-[[4-[(2-cyanoethyl)ethylamino]phenyl]azo]-7-(diethylamino)-5-phenylphenazinium chloride | C33H34ClN7 | 564.12296 | | |
| 264 | 68134-35-0 | 1,3,3-trimethyl-2-[1-(methylphenylhydrazono)ethyl]-3H-indolium chloride | C20H24ClN3 | 341.87766 | | |
| 265 | 68134-36-1 | 5-chloro-2-[2-[4-[(2-hydroxyethyl)methylamino]phenyl]vinyl]-1,3,3-trimethyl-3H-indolium chloride | C22H26Cl2N2O | 405.36064 | | |
| 266 | 68134-37-2 | 1,3,3-trimethyl-2-[[methyl(4-phenoxyphenyl)hydrazono]methyl]-3H-indolium chloride | C25H26ClN3O | 419.94644 | | |
| 267 | 68134-38-3 | 1,3,3-trimethyl-2-[[methyl(p-tolyl)hydrazono]methyl]-3H-indolium chloride | C20H24ClN3 | 341.88 | | 16.02g/L at 20℃ |
| 268 | 68134-39-4 | N-[2-[(2-cyano-6-iodo-4-nitrophenyl)azo]-5-(dimethylamino)phenyl]propionamide | C18H17IN6O3 | 492.27 | | |
| 269 | 68134-40-7 | ethyl N-[3-(acetylamino)-4-[(2-chloro-4-nitrophenyl)azo]phenyl]-N-(3-ethoxy-3-oxopropyl)-beta-alaninate | C24H28ClN5O7 | 533.96 | | |
| 270 | 68134-42-9 | Formaldehyde, oligomeric reaction products with 2-amino-2-(hydroxymethyl)-1,3-propanediol | C5H13NO4 | 151.16 | | |
| 271 | 68134-44-1 | Hexanedioic acid, polymer with 5-amino-1,3,3-trimethylcyclohexanemethanamine, 5-isocyanato-1-(isocyanatomethyl)-1,3,3-trimethylcyclohexane and 1,2-propanediol | C31H58N4O8 | 614.83 | | |
| 272 | 68134-56-5 | polymer with (chloromethyl)oxirane, n-(1,3-dimethylbutylidene)-n'-2-oxepanon | C49H87ClN4O11 | 943.68828 | | |
| 273 | 68134-58-7 | dihydrogen bis[dimethyl(3-sulphonatobenzyl)(3-sulphonatophenyl)ammonium], calcium salt | C15H19CaNO6S2 | 413.52 | | |
| 274 | 68134-59-8 | formic acid, copper nickel salt | C4H4CuNiO8 | 302.30916 | | |
| 275 | 68134-60-1 | 4-[(benzyl)amino]-9-(diethylamino)spiro[12H-benzo[a]xanthene-12,1'(3'H)-isobenzofuran]-3'-one | C35H30N2O3 | 526.6243 | | |
| 276 | 68134-61-2 | 6'-(diethylamino)-2'-[[3-(trifluoromethyl)phenyl]amino]spiro[isobenzofuran-1(3H),9'-[9H]xanthene]-3-one | C31H25F3N2O3 | 530.54 | | |
| 277 | 68134-62-3 | 1,2-Propanediol,3,3'-oxybis-,polymer with(chloromethyl)oxirane | C9H19ClO6 | 258.69656 | | |
| 278 | 68134-63-4 | 2-butenoic acid, polymer with ethenyl acetate and alpha-hydro-omega-hydroxypo | (C4H6O2.C4H6O2.(C2H4O)nH2O)x | | | |
| 279 | 68134-65-6 | 1,5(or 1,8)-diamino-2-bromo-4,8(or 4,5)-dihydroxyanthraquinone | C14H9BrN2O4 | 349.13626 | | |
| 280 | 68134-76-9 | 5-cis-8-cis-Tetradecadienoyl-CoA | C35H58N7O17P3S | 973.86 | | |
| 281 | 68134-79-2 | 1,8-Dihydroxy-2,8-dithiocyclotetradecane | C12H20O2S2 | 260.42 | 175-176℃ | |
| 282 | 68134-81-6 | Gacyclidine | C16H25NS | 263.44 | 80-81 °C(Solv: hexane (110-54-3); ethyl ether (60-29-7)) | |
| 283 | 68135-16-0 | 4'-Deoxy Vincristine | C46H56N4O9 | 808.96 | 186-188°C | |
| 284 | 68135-50-2 | Carbamic acid, N-(2-ethoxyphenyl)-, 2-(dimethylamino)ethyl ester, hydrochloride (1:1) | C13H20N2O3.ClH | 288.77 | | |
| 285 | 68136-21-0 | Manganese nickel oxide | MnNiO2 | 145.630249 | | |
| 286 | 68136-35-6 | angiohypotensin | | | | |
| 287 | 68136-43-6 | 2-Oxepanone, homopolymer, hexadecyl ester | C22H44O3 | 356.59 | | |
| 288 | 68136-61-8 | Pyrophyllite (alh(sio3)2) | AlH6O9Si3+3 | 261.280278 | | |
| 289 | 68136-90-3 | Ethanesulfonyl fluoride, 1,1,2,2-tetrafluoro-2-[(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-hexadecafluoro-8-iodooctyl)oxy]- | C10F21IO3S | 726.04 | | |
| 290 | 68137-08-6 | 4-methyl-2-nitro-phenol | C7H7NO3 | | | |
| 291 | 68138-53-4 | 2-Phenyl-6-methyl-4-oxo-4,5,6,7-tetrahydrobenzofuran | C15H14O2 | 226.27046 | | |
| 292 | 68138-65-8 | 24,25-epoxycholesterol | C27H46O2 | 402.65 | | |
| 293 | 68139-00-4 | 2,4-dimethyl-2-(4-methyl-3-pentenyl)-1,3-dioxane | C12H22O2 | 198.3 | | |
| 294 | 68139-02-6 | 5-bicyclo[2.2.1]hept-2-yl-2,4-dimethylpent-2-en-1-al | C14H22O | 206.32 | | |
| 295 | 68139-09-3 | 1H-Pyrazolo[4,3-f]benzothiazole(9CI) | C8H5N3S | 175.21 | | |
| 296 | 68139-23-1 | Linseed oil, polymer with isophthalic acid, pentaerythritol and tall oil | | | | |
| 297 | 68139-26-4 | Rosin-linseed oil copolymer | | | | |
| 298 | 68139-30-0 | RALUFON CAS-OH | C20H42N2O5S | 422.62 | | 520g/L |
| 299 | 68139-32-2 | Ethanaminium, 2-amino-N-(2-aminoethyl)-N-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-N-methyl-, N,N'-ditallow acyl derivs., Me sulfates (salts) | | | | |
| 300 | 68139-35-5 | Fatty acids, tall-oil, polymers with benzoic acid, diethylene glycol, pentaerythritol and phthalic anhydride | | | | |
| 301 | 68139-36-6 | Fatty acids, tall-oil, polymers with benzoic acid, dipentaerythritol, pentaerythritol and phthalic anhydride | | | | |
| 302 | 68139-38-8 | Fatty acids, tall-oil, polymers with benzoic acid, maleic anhydride, pentaerythritol, phthalic anhydride and trimethylolethane | | | | |
| 303 | 68139-40-2 | Fatty acids, tall oil polymers with bisphenol A, epichlorohydrin and trimellitic anhydride | | | | |
| 304 | 68139-45-7 | Tall oil fatty acids,pentaerythritol,dipentaerythritol,ethylene glycol,phthalic anhydride resin | | | | |
| 305 | 68139-46-8 | Tall oil fatty acid,pentaerythritol,dipentaerythritol,glycerin,phthalic anhydride resin | | | | |
| 306 | 68139-52-6 | Fatty acids, tall-oil, polymers with isophthalic acid, trimellitic anhydride and trimethylolethane | | | | |
| 307 | 68139-53-7 | Fatty acids, tall oil polymers with linseed oil, pentaerythritol, phthalic anhydride and soybean oil | | | | |
| 308 | 68139-54-8 | Fatty acids, tall oil polymers with maleic anhydride, phthalic anhydride and trimethylolethane | | | | |
| 309 | 68139-61-7 | Fatty acids,C18-unsatd.,dimers,diesters with polyethylene glycol | | | | |
| 310 | 68139-62-8 | Fatty acids, C18-unsatd., dimers, polymers with adipic acid and ethylenediamine | | | | |
| 311 | 68139-64-0 | Fatty acids, (C=18)-unsatd., dimers polymers with adipic acid, ethylenediamine and piperazine | | | | |
| 312 | 68139-67-3 | fatty acids/isophthalic acid/adipic acid/propylene glycol | | | | |
| 313 | 68139-68-4 | Fatty acids, C18-unsatd., dimers, polymers with azelaic acid and ethylenediamine | | | | |
| 314 | 68139-70-8 | POLY(DIMER ACID-CO-ALKYL POLYAMINE) | | | | |
| 315 | 68139-72-0 | Fatty acids, C18-unsatd., dimers, polymers with azelaic acid, ethylenediamine and tall-oil fatty acids | | | | |
| 316 | 68139-75-3 | Fatty acids, C18-unsatd., dimers, polymers with diethylenetriamine and tall-oil fatty acids | | | | |
| 317 | 68139-78-6 | Fatty acids, C18-unsatd., dimers, polymers with ethylenediamine and sebacic acid | | | | |
| 318 | 68139-79-7 | Fatty acid,C18-unsatd,dimers,polymers with ethylenediamine and soya fatty acid | | | | |
| 319 | 68139-80-0 | Fatty acids, C18-unsatd., dimers, polymers with ethylenediamine and tall-oil fatty acids | | | | |
| 320 | 68139-81-1 | Fatty acids, C18-unsatd., dimers, polymers with ethylenediamine, piperazine and sebacic acid | | | | |
| 321 | 68139-82-2 | Fatty acids, C18-unsatd., dimers, reaction products with formaldehyde-phenol polymer glycidyl ether | (C6H6O·CH2O·W99)x | | | |
| 322 | 68139-89-9 | Fatty acids, tall-oil, maleated | | | | |
| 323 | 68139-91-3 | PEG 400 DILAURATE | | | | |
| 324 | 68139-92-4 | Castor oil, reaction products with 2-[(2-aminoethyl)amino]ethanol and maleic anhydride | | | | |
| 325 | 68139-93-5 | Castor oil, reaction products with 2-[(2-aminoethyl)amino]ethanol | | | | |
| 326 | 68139-94-6 | Amines, tallow alkyl, dodecylbenzenesulfonates | | | | |
| 327 | 68139-95-7 | Amines, tallow alkyl, compds. with linoleic acid trimer | | | | |
| 328 | 68139-96-8 | Amides, tallow, N-[2-(4,5-dihydro-2-nortallow alkyl-1H-imidazol-1-yl)ethyl] | | | | |
| 329 | 68139-97-9 | Amides, tallow, N,N'-[[[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]imino]di-2,1-ethanediyl]bis- | | | | |
| 330 | 68139-98-0 | Amides, coco, N-[2-(4,5-dihydro-2-norcoco alkyl-1H-imidazol-1-yl)ethyl] | | | | |