| 1 | 6513-03-7 | N-PROPYL PELARGONATE | C12H24O2 | 200.32 | | |
| 2 | 6513-06-0 | 4-chlorophenyl 2-ethylbutanoate | C12H15ClO2 | 226.6993 | | |
| 3 | 6513-12-8 | isomaltoheptaose | C42H72O36 | 1153 | | |
| 4 | 6513-20-8 | Benzenesulfonamide, 4-methyl-N-(tetrahydro-2-oxo-3-furanyl)- | C11H13NO4S | 255.29022 | | |
| 5 | 6513-25-3 | PropanaMide, N-(2-aMino-2-oxoethyl)-2-Mercapto- | C5H10N2O2S | 162.21 | | |
| 6 | 6513-49-1 | (2-butoxyphenyl)methanol | C11H16O2 | 180.24 | | |
| 7 | 6513-70-8 | 1-Piperidinecarboxamide,N-(2-oxo-2H-1-benzopyran-3-yl)- | C15H16N2O3 | 272.29914 | | |
| 8 | 6513-93-5 | Urea, N-ethyl-N'-(8-nitro-2-oxo-2H-1-benzopyran-3-yl)-N-phenyl- | C18H15N3O5 | 353.33 | | |
| 9 | 65130-19-0 | 1-[2-(4-CHLOROPHENYL)-2-OXOETHYL]PYRIDINIUM | C13H11ClNO+ | 232.69 | | |
| 10 | 65130-25-8 | Benzenamine, 4,4'-selenobis- | C12H12N2Se | 263.2 | | |
| 11 | 65130-27-0 | Benzene, 1,1'-selenobis[4-fluoro- | C12H8F2Se | 269.1487264 | | |
| 12 | 65130-31-6 | 1-(2-Bromo-5-nitrophenyl)ethanone | C8H6BrNO3 | 244.04 | | |
| 13 | 65130-40-7 | Sulfonium, dimethyl[1-(4-methylphenyl)ethyl]-, bromide | C11H17BrS | 261.22168 | | |
| 14 | 65130-44-1 | Benzene, 1-ethyl-2-[(methylthio)methyl]- (9CI) | C10H14S | 166.28 | | |
| 15 | 65130-46-3 | 1-(1-Bromoethyl)-4-fluorobenzene | C8H8BrF | 203.05 | | |
| 16 | 65130-47-4 | 2-chloro-4-bromoethylbenzene | C8H8BrCl | 219.50612 | | |
| 17 | 65130-51-0 | Sulfonium, dimethyl(1-methylethyl)-, iodide | C5H13IS | 232.12 | | |
| 18 | 65130-67-8 | Benzene, 2,4-bis(1,1-dimethylethyl)-1-fluoro- | C14H21F | 208.3149432 | | |
| 19 | 65130-68-9 | 3-Ethylbenzenesulfonic acid sodium salt | | | | |
| 20 | 65130-69-0 | Benzenesulfonic acid, 3-(1-methylethyl)-, sodium salt (1:1) | C9H13NaO3S | 224.25 | | |
| 21 | 65130-70-3 | N,N-dibenzylglycine | | | | |
| 22 | 65130-71-4 | Glycine, N,N-bis[(4-chlorophenyl)methyl]-, hydrochloride | C16H16Cl3NO2 | 360.66274 | | |
| 23 | 651300-34-4 | 1-Cyclopentene-1-methanamine, N-butyl-N-2-propenyl- | C13H23N | 193.32842 | | |
| 24 | 651301-26-7 | Phosphonic acid, [[4-(di-1H-pyrrol-2-ylmethyl)phenyl]methyl]-, diethyl ester (9CI) | C20H25N2O3P | 372.4 | | |
| 25 | 651301-51-8 | (4-Dimethoxymethylphenyl)-phosphonic acid di-tert-butyl ester | C17H29O5P | 344.38 | | |
| 26 | 651301-78-9 | Phosphonic acid, P-[4-(di-1H-pyrrol-2-ylmethyl)phenyl]-, bis(1,1-dimethylethyl) ester | C23H31N2O3P | 414.48 | | |
| 27 | 651301-80-3 | Methanone, [[(4-ethynylphenyl)methylene]di-1H-pyrrole-5,2-diyl]bis[(4-methylphenyl)- (9CI) | C33H26N2O2 | 482.57 | | |
| 28 | 651301-87-0 | Phosphonic acid, [4-[[5-(4-methylbenzoyl)-1H-pyrrol-2-yl]-1H-pyrrol-2-ylmethyl]phenyl]-, bis(1,1-dimethylethyl) ester (9CI) | C31H37N2O4P | 532.61 | | |
| 29 | 651301-89-2 | Zinc, [(1E)-1-butyl-2-ethyl-1-hexenyl]ethyl- | C14H28Zn | 261.76212 | | |
| 30 | 651302-15-7 | Benzamide, N-(2-aminophenyl)-3,4,5-tris(phenylmethoxy)- | C34H30N2O4 | 530.613 | | |
| 31 | 651302-60-2 | Stannane, tributyl[(3S)-5-(1,3-dithian-2-yl)-3-methyl-2-methylenepentyl]- | C23H46S2Sn | 505.45 | | |
| 32 | 651302-64-6 | beta-L-erythro-Hex-4-enopyranoside, methyl 6-amino-4,6-dideoxy- (9CI) | C7H13NO4 | 175.18242 | | |
| 33 | 651302-67-9 | alpha-D-threo-Hex-3-enopyranoside, methyl 6-amino-3,4,6-trideoxy- (9CI) | C7H13NO3 | 159.18 | | |
| 34 | 651302-70-4 | D-arabino-Hept-3-enitol, 1-amino-2,6-anhydro-1,3,4-trideoxy- (9CI) | C7H13NO3 | 159.18302 | | |
| 35 | 651302-75-9 | Silane, [(3S)-5-iodo-3-methyl-2-methylenepentyl]trimethyl- | C10H21ISi | 296.26 | | |
| 36 | 651302-79-3 | 1,3-Dithiane, 2-[(3S)-3-methyl-4-[(trimethylsilyl)methyl]-4-penten-1-yl]- | C14H28S2Si | 288.59 | | |
| 37 | 651302-88-4 | Phosphonic acid, (4-formylphenyl)- | C7H7O4P | 186.101841 | | |
| 38 | 651302-91-9 | Phosphonic acid, (4-formylphenyl)-, bis(2-cyanoethyl) ester | C13H13N2O4P | 292.227081 | | |
| 39 | 651303-03-6 | Silane, [(2Z)-3-iodo-2-propyl-2-hexenyl]trimethyl- | C12H25ISi | 324.31687 | | |
| 40 | 651303-05-8 | 4-Penten-1-ol, 3-methyl-4-[(trimethylsilyl)methyl]-, (3S)- | C10H22OSi | 186.37 | | |
| 41 | 651303-06-9 | Silane, [(2Z)-3-iodo-2,3-diphenyl-2-propenyl]trimethyl- | C18H21ISi | 392.34931 | | |
| 42 | 651303-25-2 | Magnesium, bromo(2-ethyldecyl)- | C12H25BrMg | 273.54 | | |
| 43 | 651303-26-3 | 6-Tridecen-4-one, 9-butyl-9-hydroxy-6-methyl- | C18H34O2 | 282.46136 | | |
| 44 | 651303-27-4 | 6-Tridecen-4-one, 9-butyl-9-hydroxy-7-methyl- | C18H34O2 | 282.46136 | | |
| 45 | 651303-34-3 | 2-Cyclopenten-1-one, 2,3-diethyl-4,5-diphenyl- | C21H22O | 290.4 | | |
| 46 | 651303-35-4 | 1H-Inden-1-one,2,3-diethyl-2,3,4,5,6,7-hexahydro-(9CI) | C13H20O | 192.2973 | | |
| 47 | 651303-37-6 | Benzene, (2,3-diethyl-2,4-cyclopentadien-1-yl)- | C15H18 | 198.30342 | | |
| 48 | 651303-39-8 | Silane, (1,4-diethyl-5,6,7,8-tetrahydro-3-methyl-2-naphthalenyl)trimethyl- | C18H30Si | 274.5163 | | |
| 49 | 651303-42-3 | [1,1'-Biphenyl]-3,4-dicarboxylic acid, 5,6-diethyl-, dimethyl ester | C20H22O4 | 326.38628 | | |
| 50 | 651303-49-0 | Benzene, 1,1',1''-[(4-iodophenyl)methylidyne]tris[4-methyl- | C28H25I | 488.40257 | | |
| 51 | 651304-10-8 | Magnesium, chloro[(2-methylcyclohexyl)methyl]- | C8H15ClMg | 170.96 | | |
| 52 | 651304-15-3 | Magnesium, bromo[1-(1-ethylpropylidene)-2-pentyn-1-yl]- | C10H15BrMg | 239.44 | | |
| 53 | 651304-19-7 | Magnesium, chloro[(2-methylcyclopentyl)methyl]- | C7H13ClMg | 156.94 | | |
| 54 | 651304-51-7 | 1,4-Butanediol, 2-(6-methoxy-4-hexenyl)- | C11H22O3 | 202.29058 | | |
| 55 | 651304-52-8 | 2-Nonene-1,9-diol, 7-(hydroxymethyl)- | C10H20O3 | 188.26 | | |
| 56 | 651304-53-9 | 1-Butanol, 2-[(phenylthio)methyl]-, (2S)- | C11H16OS | 196.31 | | |
| 57 | 651304-60-8 | 1,3,7-Octatrien-5-yne, 2,7-dimethyl-, (3Z)- | C10H12 | 132.20228 | | |
| 58 | 651304-77-7 | Phenol, 2-[1-[(5-hydroxypentyl)imino]ethyl]- | C13H19NO2 | 221.29546 | | |
| 59 | 651304-78-8 | Phenol, 2-[1-[(3-hydroxypropyl)imino]propyl]- | C12H17NO2 | 207.26888 | | |
| 60 | 651304-79-9 | Phenol, 2-[1-[(5-hydroxypentyl)imino]propyl]- | C14H21NO2 | 235.32204 | | |
| 61 | 651304-80-2 | Phenol, 2-[1-[(5-hydroxypentyl)amino]ethyl]- | C13H21NO2 | 223.31134 | | |
| 62 | 651304-81-3 | Phenol, 2-[1-[(3-hydroxypropyl)amino]propyl]- | C12H19NO2 | 209.28476 | | |
| 63 | 651304-82-4 | Phenol, 2-[1-[(5-hydroxypentyl)amino]propyl]- | C14H23NO2 | 237.33792 | | |
| 64 | 651304-85-7 | 2H-1,3-Benzoxazine-3(4H)-pentanol, 4-methyl- | C14H21NO2 | 235.32204 | | |
| 65 | 651304-86-8 | 2H-1,3-Benzoxazine-3(4H)-ethanol,4-ethyl-(9CI) | C12H17NO2 | 207.26888 | | |
| 66 | 651304-88-0 | 2H-1,3-Benzoxazine-3(4H)-propanol,4-ethyl-(9CI) | C13H19NO2 | 221.3 | | |
| 67 | 651304-90-4 | 2H-1,3-Benzoxazine-3(4H)-pentanol, 4-ethyl- | C15H23NO2 | 249.34862 | | |
| 68 | 651305-03-2 | 2H-1,3-Benzoxazine-3(4H)-ethanol,4-ethyl-,(-)-(9CI) | C12H17NO2 | | | |
| 69 | 651305-04-3 | 2H-1,3-Benzoxazine-3(4H)-propanol,4-ethyl-,(+)-(9CI) | C13H19NO2 | | | |
| 70 | 651305-08-7 | 2H-1,3-Benzoxazine-3(4H)-ethanol,4-ethyl-,(+)-(9CI) | C12H17NO2 | | | |
| 71 | 651305-09-8 | 2H-1,3-Benzoxazine-3(4H)-propanol,4-ethyl-,(-)-(9CI) | C13H19NO2 | 221.3 | | |
| 72 | 651305-21-4 | 2-(3-chlorophenyl)-1-methyl-2-oxoethyl 2-benzyl-1,3-dioxo-5-isoindolinecarboxylate | C25H18ClNO5 | 447.87 | | |
| 73 | 651305-25-8 | 2-[4-(benzyloxy)phenyl]-1-methyl-2-oxoethyl 3-(2,5-dimethyl-1H-pyrrol-1-yl)benzoate | C29H27NO4 | 453.52898 | | |
| 74 | 651305-29-2 | 4-Isothiazolecarboxamide, 3-(cyclohexylmethoxy)-5-(pyrazinylamino)- | C15H19N5O2S | 333.40866 | | |
| 75 | 651305-35-0 | 4-Isothiazolecarboxamide, 3-(cyclohexylmethoxy)-5-(2-pyridinylamino)- | C16H20N4O2S | 332.4206 | | |
| 76 | 651305-37-2 | 4-Isothiazolecarboxamide, 3-(cyclohexylmethoxy)-5-(3-pyridinylamino)- | C16H20N4O2S | 332.4206 | | |
| 77 | 651305-38-3 | 4-Isothiazolecarboxamide, 3-(cyclohexylmethoxy)-5-(4-pyridinylamino)- | C16H20N4O2S | 332.4206 | | |
| 78 | 651305-50-9 | 4-Isothiazolecarboxamide, 3-(hexylthio)-5-(4-pyridinylamino)- | C15H20N4OS2 | 336.48 | | |
| 79 | 651305-51-0 | 4-Isothiazolecarboxamide, 3-(cyclohexylthio)-5-(4-pyridinylamino)- | C15H18N4OS2 | 334.46 | | |
| 80 | 651305-52-1 | 4-Isothiazolecarboxamide, 3-[(2-phenylethyl)thio]-5-(4-pyridinylamino)- | C17H16N4OS2 | 356.46514 | | |
| 81 | 651305-55-4 | 4-Isothiazolecarboxamide, 3-[(1-phenylethyl)thio]-5-(3-pyridinylamino)- | C17H16N4OS2 | 356.46514 | | |
| 82 | 651305-60-1 | 4-Isothiazolecarboxamide, 3-[(1-phenylpropyl)thio]-5-(3-pyridinylamino)- | C18H18N4OS2 | 370.49172 | | |
| 83 | 651305-70-3 | 4-Isothiazolecarbonitrile, 3-(cyclohexylmethoxy)-5-(methylthio)- | C12H16N2OS2 | 268.39824 | | |
| 84 | 651305-71-4 | 4-Isothiazolecarboxamide, 3-(cyclohexylmethoxy)-5-(methylsulfonyl)- | C12H18N2O4S2 | 318.41232 | | |
| 85 | 651305-72-5 | 4-Isothiazolecarboxamide, 3-(cyclohexylmethoxy)-5-(methylthio)- | C12H18N2O2S2 | 286.41352 | | |
| 86 | 651305-73-6 | 4-Isothiazolecarbonitrile, 3-(methylthio)-5-(4-pyridinylamino)- | C10H8N4S2 | 248.32732 | | |
| 87 | 651305-74-7 | 4-Isothiazolecarboxamide, 3-(methylthio)-5-(4-pyridinylamino)- | C10H10N4OS2 | 266.3426 | | |
| 88 | 651305-75-8 | 4-Isothiazolecarboxamide, 3-(methylsulfonyl)-5-(4-pyridinylamino)- | C10H10N4O3S2 | 298.3414 | | |
| 89 | 651305-76-9 | Ethanimidothioic acid, 2-cyano-, (2,4,6-trimethoxyphenyl)methyl ester | C13H16N2O3S | 280.34274 | | |
| 90 | 651305-79-2 | 4-Isothiazolecarboxamide, 2,3-dihydro-5-(3-pyridinylamino)-3-thioxo- | C9H8N4OS2 | 252.31602 | | |
| 91 | 651305-80-5 | 4-Isothiazolecarboxylic acid, 3,5-bis(methylsulfonyl)-, methyl ester | C7H9NO6S3 | 299.34446 | | |
| 92 | 651305-81-6 | 4-Isothiazolecarboxylic acid, 5-amino-3-(methylsulfonyl)-, methyl ester | C6H8N2O4S2 | 236.26872 | | |
| 93 | 651306-05-7 | Iodonium, bis(pentafluorophenyl)-, perchlorate | C12ClF10IO4 | 560.467502 | | |
| 94 | 651306-29-5 | Carbamimidic acid, hydroxy-, 4-methoxyphenyl ester | C8H10N2O3 | 182.1766 | | |
| 95 | 651306-31-9 | Carbamimidic acid, hydroxy-, 4-cyanophenyl ester (9CI) | C8H7N3O2 | 177.16008 | | |
| 96 | 651306-32-0 | Carbamimidic acid, [(methylsulfonyl)oxy]-, phenyl ester | C8H10N2O4S | 230.241 | | |
| 97 | 651306-34-2 | Carbamimidic acid, [(methylsulfonyl)oxy]-, 4-methoxyphenyl ester | C9H12N2O5S | 260.26698 | | |
| 98 | 651306-36-4 | Carbamimidic acid, [(methylsulfonyl)oxy]-, 4-methylphenyl ester | C9H12N2O4S | 244.26758 | | |
| 99 | 651306-38-6 | Carbamimidic acid, [(methylsulfonyl)oxy]-, 4-chlorophenyl ester | C8H9ClN2O4S | 264.68606 | | |
| 100 | 651306-40-0 | Carbamimidic acid, [(methylsulfonyl)oxy]-, 4-cyanophenyl ester | C9H9N3O4S | 255.25 | | |
| 101 | 651306-42-2 | 3H-Diazirine, 3-chloro-3-(4-methoxyphenoxy)- | C8H7ClN2O2 | 198.60638 | | |
| 102 | 651306-47-7 | 3H-Diazirine, 3-chloro-3-(4-chlorophenoxy)- | C7H4Cl2N2O | 203.03 | | |
| 103 | 651306-49-9 | Benzonitrile, 4-[(3-chloro-3H-diazirin-3-yl)oxy]- | C8H4ClN3O | 193.58986 | | |
| 104 | 651306-51-3 | 3H-Diazirine, 3,3-diphenoxy- | C13H10N2O2 | 226.2307 | | |
| 105 | 651306-52-4 | 3H-Diazirine, 3,3-bis(4-methoxyphenoxy)- | C15H14N2O4 | 286.28266 | | |
| 106 | 651306-53-5 | 3H-Diazirine, 3,3-bis(4-methylphenoxy)- | C15H14N2O2 | 254.28386 | | |
| 107 | 651306-54-6 | 3H-Diazirine, 3,3-bis(4-chlorophenoxy)- | C13H8Cl2N2O2 | 295.12082 | | |
| 108 | 651306-55-7 | 3H-Diazirine, 3-(4-methoxyphenoxy)-3-phenoxy- | C14H12N2O3 | 256.25668 | | |
| 109 | 651306-56-8 | 3H-Diazirine, 3-(4-chlorophenoxy)-3-phenoxy- | C13H9ClN2O2 | 260.67576 | | |
| 110 | 651306-57-9 | 3H-Diazirine, 3-(4-chlorophenoxy)-3-(4-methoxyphenoxy)- | C14H11ClN2O3 | 290.70174 | | |
| 111 | 651306-62-6 | Cyclopropanecarbonitrile, 2-(4-methoxyphenoxy)-2-phenoxy- | C17H15NO3 | 281.3059 | | |
| 112 | 651306-63-7 | Cyclopropanecarbonitrile, 2-(4-chlorophenoxy)-2-phenoxy- | C16H12ClNO2 | 285.72498 | | |
| 113 | 651306-64-8 | Cyclopropanecarbonitrile, 2-(4-chlorophenoxy)-2-(4-methoxyphenoxy)- | C17H14ClNO3 | 315.75096 | | |
| 114 | 651306-65-9 | Cyclopropanecarbonitrile, 2,2-bis(4-methoxyphenoxy)- | C18H17NO4 | 311.33188 | | |
| 115 | 651306-96-6 | 1-Isoquinolinamine, 5-(3-aminopropoxy)-, hydrochloride | C12H16ClN3O | 253.72794 | | |
| 116 | 651306-97-7 | 1-Isoquinolinamine, 5-(3-piperidinylmethoxy)-, hydrochloride | C15H20ClN3O | 293.7918 | | |
| 117 | 651307-01-6 | 1,2-Ethanediamine, N-5-isoquinolinyl-, hydrochloride | C11H14ClN3 | 223.70196 | | |
| 118 | 651307-02-7 | 1,3-Propanediamine, N-5-isoquinolinyl-, hydrochloride | C12H16ClN3 | 237.72854 | | |
| 119 | 651307-03-8 | 1,3-Propanediamine, N-5-isoquinolinyl-N-methyl-, hydrochloride | C13H18ClN3 | 251.75512 | | |
| 120 | 651307-04-9 | 1,4-Butanediamine, N-5-isoquinolinyl-, hydrochloride | C13H18ClN3 | 251.75512 | | |
| 121 | 651307-05-0 | 1,5-Pentanediamine, N-5-isoquinolinyl-, hydrochloride | C14H20ClN3 | 265.7817 | | |
| 122 | 651307-06-1 | 5-Isoquinolinamine, N-4-piperidinyl-, hydrochloride | C14H18ClN3 | 263.76582 | | |
| 123 | 651307-07-2 | 5-Isoquinolinamine, N-(4-piperidinylmethyl)-, hydrochloride | C15H20ClN3 | 277.7924 | | |
| 124 | 651307-08-3 | 5-Isoquinolinamine, N-(3-piperidinylmethyl)-, hydrochloride | C15H20ClN3 | 277.7924 | | |
| 125 | 651307-11-8 | 1,3-Cyclohexanediamine, N-5-isoquinolinyl-, hydrochloride | C15H20ClN3 | 277.7924 | | |
| 126 | 651307-13-0 | Isoquinoline, 5-(4-piperidinyloxy)-, hydrochloride | C14H17ClN2O | 264.75058 | | |
| 127 | 651307-14-1 | 5-Isoquinolinamine, N-methyl-N-4-piperidinyl-, hydrochloride | C15H20ClN3 | 277.7924 | | |
| 128 | 651307-15-2 | 5-Isoquinolinamine, N-3-piperidinyl-, hydrochloride | C14H18ClN3 | 263.76582 | | |
| 129 | 651307-16-3 | 5-Isoquinolinesulfonamide, N-(2-aminoethyl)-N-(3-phenylpropyl)- | C20H23N3O2S | 369.48052 | | |
| 130 | 651307-17-4 | 5-Isoquinolinesulfonamide, N-(2-aminoethyl)-N-(2-phenylethyl)- | C19H21N3O2S | 355.45394 | | |
| 131 | 651307-18-5 | 5-Isoquinolinesulfonamide, N-(2-aminoethyl)-N-[2-(2-thienyl)ethyl]- | C17H19N3O2S2 | 361.48166 | | |
| 132 | 651307-19-6 | 5-Isoquinolinesulfonamide, N-(2-aminoethyl)-N-[2-(3-thienyl)ethyl]- | C17H19N3O2S2 | 361.48166 | | |
| 133 | 651307-21-0 | 5-Isoquinolinesulfonamide, N-(2-aminoethyl)-N-[2-(phenylthio)ethyl]- | C19H21N3O2S2 | 387.51894 | | |
| 134 | 651307-22-1 | 5-Isoquinolinesulfonamide, N-(2-aminoethyl)-N-[2-(4-fluorophenyl)ethyl]- | C19H20FN3O2S | 373.4444032 | | |
| 135 | 651307-23-2 | 5-Isoquinolinesulfonamide, N-(2-aminoethyl)-N-(3-phenylbutyl)- | C21H25N3O2S | 383.5071 | | |
| 136 | 651307-24-3 | 5-Isoquinolinesulfonamide, N-(2-aminoethyl)-N-(2-cyclopentylethyl)- | C18H25N3O2S | 347.475 | | |
| 137 | 651307-25-4 | 5-Isoquinolinesulfonamide, N-(2-aminoethyl)-N-[2-(2-fluorophenyl)ethyl]- | C19H20FN3O2S | 373.4444032 | | |
| 138 | 651307-26-5 | 5-Isoquinolinesulfonamide, N-(3-aminopropyl)-N-(2-phenylethyl)- | C20H23N3O2S | 369.48052 | | |
| 139 | 651307-27-6 | 5-Isoquinolinesulfonamide, N-(3-aminopropyl)-N-[2-(3-thienyl)ethyl]- | C18H21N3O2S2 | 375.50824 | | |
| 140 | 651307-29-8 | 5-Isoquinolinesulfonamide, N-(3-aminopropyl)-N-[2-(phenylthio)ethyl]- | C20H23N3O2S2 | 401.55 | | |
| 141 | 651307-31-2 | 5-Isoquinolinesulfonamide, N-(3-aminopropyl)-N-(3-phenylbutyl)- | C22H27N3O2S | 397.53368 | | |
| 142 | 651307-32-3 | 5-Isoquinolinesulfonamide, N-(3-aminopropyl)-N-(2-cyclopentylethyl)- | C19H27N3O2S | 361.50158 | | |
| 143 | 651307-34-5 | 5-Isoquinolinesulfonamide, N-(4-aminobutyl)-N-(3-phenylpropyl)- | C22H27N3O2S | 397.53368 | | |
| 144 | 651307-35-6 | 5-Isoquinolinesulfonamide, N-(4-aminobutyl)-N-(2-phenylethyl)- | C21H25N3O2S | 383.5071 | | |
| 145 | 651307-36-7 | 5-Isoquinolinesulfonamide, N-(4-aminobutyl)-N-[2-(2-thienyl)ethyl]- | C19H23N3O2S2 | 389.53 | | |
| 146 | 651307-37-8 | 5-Isoquinolinesulfonamide, N-(4-aminobutyl)-N-[2-(3-thienyl)ethyl]- | C19H23N3O2S2 | 389.53482 | | |
| 147 | 651307-39-0 | 5-Isoquinolinesulfonamide, N-(4-aminobutyl)-N-[2-(phenylthio)ethyl]- | C21H25N3O2S2 | 415.5721 | | |
| 148 | 651307-40-3 | 5-Isoquinolinesulfonamide, N-(4-aminobutyl)-N-[2-(4-fluorophenyl)ethyl]- | C21H24FN3O2S | 401.4975632 | | |
| 149 | 651307-41-4 | 5-Isoquinolinesulfonamide, N-(4-aminobutyl)-N-(3-phenylbutyl)- | C23H29N3O2S | 411.56026 | | |
| 150 | 651307-42-5 | 5-Isoquinolinesulfonamide, N-(4-aminobutyl)-N-(2-cyclopentylethyl)- | C20H29N3O2S | 375.52816 | | |
| 151 | 651307-43-6 | 5-Isoquinolinesulfonamide, N-(4-aminobutyl)-N-[2-(2-fluorophenyl)ethyl]- | C21H24FN3O2S | 401.4975632 | | |
| 152 | 651307-44-7 | 5-Isoquinolinesulfonamide, N-(4-aminobutyl)-N-[2-(phenylsulfonyl)ethyl]- | C21H25N3O4S2 | 447.5709 | | |
| 153 | 651307-56-1 | 5-Isoquinolinesulfonamide, N-(3-aminocyclohexyl)-N-(3-phenylpropyl)- | C24H29N3O2S | 423.57096 | | |
| 154 | 651307-57-2 | 5-Isoquinolinesulfonamide, N-(3-aminocyclohexyl)-N-(2-phenylethyl)- | C23H27N3O2S | 409.54438 | | |
| 155 | 651307-58-3 | 5-Isoquinolinesulfonamide, N-(3-aminocyclohexyl)-N-[2-(2-thienyl)ethyl]- | C21H25N3O2S2 | 415.5721 | | |
| 156 | 651307-59-4 | 5-Isoquinolinesulfonamide, N-(3-aminocyclohexyl)-N-[2-(3-thienyl)ethyl]- | C21H25N3O2S2 | 415.5721 | | |
| 157 | 651307-63-0 | 5-Isoquinolinesulfonamide, N-(3-aminocyclohexyl)-N-(3-phenylbutyl)- | C25H31N3O2S | 437.59754 | | |
| 158 | 651307-89-0 | 5-Isoquinolinamine, 4-bromo-N-4-piperidinyl-, hydrochloride | C14H17BrClN3 | 342.66188 | | |
| 159 | 651307-90-3 | 5-Isoquinolinamine, 4-fluoro-N-4-piperidinyl-, hydrochloride | C14H17ClFN3 | 281.7562832 | | |
| 160 | 651307-91-4 | 5-Isoquinolinamine, 4-(methylthio)-N-4-piperidinyl-, hydrochloride | C15H20ClN3S | 309.8574 | | |
| 161 | 651307-92-5 | 5-Isoquinolinamine, 4-methyl-N-4-piperidinyl-, hydrochloride | C15H20ClN3 | 277.7924 | | |
| 162 | 651307-93-6 | 1,4-Cyclohexanediamine, N-(4-bromo-5-isoquinolinyl)-, hydrochloride | C15H19BrClN3 | 356.68846 | | |
| 163 | 651307-94-7 | 1,4-Cyclohexanediamine, N-(4-fluoro-5-isoquinolinyl)-, hydrochloride | C15H19ClFN3 | 295.7828632 | | |
| 164 | 651307-96-9 | 5-Isoquinolinamine, 4-(methylsulfinyl)-N-4-piperidinyl-, hydrochloride | C15H20ClN3OS | 325.8568 | | |
| 165 | 651307-97-0 | 5-Isoquinolinamine, 4-(methylsulfonyl)-N-4-piperidinyl-, hydrochloride | C15H20ClN3O2S | 341.8562 | | |
| 166 | 651307-98-1 | 5-Isoquinolinamine, 4-ethenyl-N-4-piperidinyl-, hydrochloride | C16H20ClN3 | 289.8031 | | |
| 167 | 651307-99-2 | 5-Isoquinolinamine, 4-ethyl-N-4-piperidinyl-, hydrochloride | C16H22ClN3 | 291.81898 | | |
| 168 | 651308-01-9 | 5-Isoquinolinamine, 1-chloro-N-4-piperidinyl-, trifluoroacetate | C16H17ClF3N3O2 | 375.7732896 | | |
| 169 | 651308-02-0 | 1(2H)-Isoquinolinone, 5-(4-piperidinylamino)-, hydrochloride | C14H18ClN3O | 279.76522 | | |
| 170 | 651308-03-1 | 1,4-Cyclohexanediamine, N-(4-ethenyl-5-isoquinolinyl)-, hydrochloride | C17H22ClN3 | 303.82968 | | |
| 171 | 651308-04-2 | 1,4-Cyclohexanediamine, N-(4-ethyl-5-isoquinolinyl)-, hydrochloride | C17H24ClN3 | 305.84556 | | |
| 172 | 651308-05-3 | 5-Isoquinolinamine, 4-chloro-N-4-piperidinyl-, hydrochloride | C14H17Cl2N3 | 298.21088 | | |
| 173 | 651308-06-4 | 1,4-Cyclohexanediamine, N-(4-chloro-5-isoquinolinyl)-, hydrochloride | C15H19Cl2N3 | 312.23746 | | |
| 174 | 651308-09-7 | 5-Isoquinolinamine, 4-methoxy-N-4-piperidinyl-, hydrochloride | C15H20ClN3O | 293.7918 | | |
| 175 | 651308-10-0 | 1,4-Cyclohexanediamine, N-(4-methoxy-5-isoquinolinyl)-, hydrochloride | C16H22ClN3O | 307.81838 | | |
| 176 | 651308-30-4 | 4-Isoquinolinecarbonitrile, 5-(4-piperidinylamino)-, hydrochloride | C15H17ClN4 | 288.77528 | | |
| 177 | 651308-48-4 | Isoquinoline, 4-methyl-5-(4-piperidinyloxy)- | C15H18N2O | 242.31622 | | |
| 178 | 651308-49-5 | Isoquinoline, 4-ethyl-5-(4-piperidinyloxy)- | C16H20N2O | 256.3428 | | |
| 179 | 651308-50-8 | 4-Isoquinolinecarbonitrile, 5-(4-piperidinyloxy)- | C15H15N3O | 253.2991 | | |
| 180 | 651308-51-9 | Cyclohexanamine, 4-[(4-methyl-5-isoquinolinyl)oxy]-, trans- | C16H20N2O | 256.3428 | | |
| 181 | 651308-52-0 | Cyclohexanamine, 4-[(4-ethyl-5-isoquinolinyl)oxy]-, trans- | C17H22N2O | 270.36938 | | |
| 182 | 651308-53-1 | 4-Isoquinolinecarbonitrile, 5-[(trans-4-aminocyclohexyl)oxy]- | C16H17N3O | 267.32568 | | |
| 183 | 651308-59-7 | 4-Isoquinolinecarbonitrile, 5-[[1-(2-hydroxyethyl)-4-piperidinyl]oxy]- | C17H19N3O2 | 297.35166 | | |
| 184 | 651308-60-0 | Ethanol, 2-[[trans-4-[(4-methyl-5-isoquinolinyl)oxy]cyclohexyl]amino]- | C18H24N2O2 | 300.39536 | | |
| 185 | 651308-61-1 | Ethanol, 2-[[trans-4-[(4-ethyl-5-isoquinolinyl)oxy]cyclohexyl]amino]- | C19H26N2O2 | 314.42194 | | |
| 186 | 651308-68-8 | 4-Isoquinolinecarbonitrile, 5-[[1-(3-hydroxypropyl)-4-piperidinyl]oxy]- | C18H21N3O2 | 311.37824 | | |
| 187 | 651308-69-9 | 1-Propanol, 3-[[trans-4-[(4-methyl-5-isoquinolinyl)oxy]cyclohexyl]amino]- | C19H26N2O2 | 314.42194 | | |
| 188 | 651308-70-2 | 1-Propanol, 3-[[trans-4-[(4-ethyl-5-isoquinolinyl)oxy]cyclohexyl]amino]- | C20H28N2O2 | 328.45 | | |
| 189 | 651308-75-7 | 1(2H)-Isoquinolinone, 4-methyl-5-(4-piperidinyloxy)- | C15H18N2O2 | 258.31562 | | |
| 190 | 651308-76-8 | 1(2H)-Isoquinolinone, 4-ethyl-5-(4-piperidinyloxy)- | C16H20N2O2 | 272.3422 | | |
| 191 | 651308-77-9 | 1(2H)-Isoquinolinone, 5-[(trans-4-aminocyclohexyl)oxy]-4-methyl- | C16H20N2O2 | 272.3422 | | |
| 192 | 651308-78-0 | 1(2H)-Isoquinolinone, 5-[(trans-4-aminocyclohexyl)oxy]-4-ethyl- | C17H22N2O2 | 286.36878 | | |
| 193 | 651308-81-5 | 5-Isoquinolinamine, 4-ethenyl-N-4-piperidinyl- | C16H19N3 | 253.34216 | | |
| 194 | 651308-82-6 | 1,4-Cyclohexanediamine, N-(4-methyl-5-isoquinolinyl)-, trans- | C16H21N3 | 255.35804 | | |
| 195 | 651308-83-7 | 1,4-Cyclohexanediamine, N-(4-ethyl-5-isoquinolinyl)-, trans- | C17H23N3 | 269.38462 | | |
| 196 | 651308-84-8 | 1,4-Cyclohexanediamine, N-(4-ethenyl-5-isoquinolinyl)-, trans- | C17H21N3 | 267.36874 | | |
| 197 | 651308-95-1 | Ethanol, 2-[[trans-4-[(4-methyl-5-isoquinolinyl)amino]cyclohexyl]amino]- | C18H25N3O | 299.4106 | | |
| 198 | 651308-97-3 | Ethanol, 2-[[trans-4-[(4-ethyl-5-isoquinolinyl)amino]cyclohexyl]amino]- | C19H27N3O | 313.43718 | | |
| 199 | 651308-98-4 | Ethanol, 2-[[trans-4-[(4-ethenyl-5-isoquinolinyl)amino]cyclohexyl]amino]- | C19H25N3O | 311.42 | | |
| 200 | 651309-04-5 | 2-((Cis-4-((4-ethylisoquinolin-5-yl)amino)cyclohexyl)amino)ethanol | C19H27N3O | 313.44 | | |
| 201 | 651309-07-8 | 1-Propanol, 3-[[cis-4-[(4-ethyl-5-isoquinolinyl)amino]cyclohexyl]amino]- | C20H29N3O | 327.46376 | | |
| 202 | 651309-09-0 | 1(2H)-Isoquinolinone, 4-methyl-5-(4-piperidinylamino)- | C15H19N3O | 257.33086 | | |
| 203 | 651309-10-3 | 1(2H)-Isoquinolinone, 4-ethyl-5-(4-piperidinylamino)- | C16H21N3O | 271.35744 | | |
| 204 | 651309-11-4 | 1(2H)-Isoquinolinone, 5-[(trans-4-aminocyclohexyl)amino]-4-methyl- | C16H21N3O | 271.36 | | |
| 205 | 651309-12-5 | 1(2H)-Isoquinolinone, 5-[(trans-4-aminocyclohexyl)amino]-4-ethyl- | C17H23N3O | 285.38 | | |
| 206 | 651309-72-7 | Carbamic acid, [2-[(5-isoquinolinylsulfonyl)amino]ethyl]-, 1,1-dimethylethyl ester (9CI) | C16H21N3O4S | 351.42 | | |
| 207 | 65131-09-1 | 7-Methoxy-3-Phenylsulfonyl-1(3H)-Isobenzofuranone | C15H12O5S | 304.32 | 184℃ | |
| 208 | 65131-31-9 | 2-Aethinylcyclopropancarbonsaeure | C6H6O2 | 110.11064 | | |
| 209 | 651310-21-3 | 5-Isoquinolinamine,4-chloro-(9CI) | C9H7ClN2 | | | |
| 210 | 651310-24-6 | 5-Bromo-4-methylisoquinoline | C10H8BrN | 222.08 | | |
| 211 | 651310-29-1 | 3-(4-(methylsulfonyl)phenyl)propan-1-ol | C10H14O3S | 214.28 | | |
| 212 | 651310-31-5 | 2-Propyn-1-ol, 3-[3-(methylsulfonyl)phenyl]- | C10H10O3S | 210.2496 | | |
| 213 | 651310-32-6 | Benzenepropanol, 3-(methylsulfonyl)- | C10H14O3S | 214.28136 | | |
| 214 | 651310-34-8 | 2-Propyn-1-ol, 3-[2-(methylsulfonyl)phenyl]- | C10H10O3S | 210.2496 | | |
| 215 | 651310-35-9 | Benzenepropanol, 2-(methylsulfonyl)- | C10H14O3S | 214.28136 | | |
| 216 | 651310-41-7 | 4-Bromoisoquinolin-5-ol | C9H6BrNO | 224.05 | | |
| 217 | 651310-48-4 | 5-Isoquinolinol, 4-methyl- (9CI) | C10H9NO | 159.18456 | | |
| 218 | 651311-02-3 | 2-Propenenitrile, 3,3-bis(methylsulfonyl)-2-(2-naphthalenylsulfonyl)- | C15H13NO6S3 | 399.46182 | | |
| 219 | 651311-81-8 | Tricyclo[3.3.1.13,7]decan-1-amine, 3,5-diethyl-7-methyl- (9CI) | C15H27N | 221.38 | | |
| 220 | 651311-88-5 | Tricyclo[3.3.1.13,7]decan-1-amine, 3-ethyl-5-propyl- (9CI) | C15H27N | 221.38158 | | |
| 221 | 651312-66-2 | 1,2-Benzenediol, 4-[2-[(dimethylamino)methyl]cyclohexyl]- | C15H23NO2 | 249.34862 | | |
| 222 | 651312-68-4 | Phenol, 3-[2-(aminomethyl)cyclohexyl]- | C13H19NO | 205.29606 | | |
| 223 | 651312-70-8 | Cyclohexanemethanamine, 2-(3-methoxyphenyl)- | C14H21NO | 219.32264 | | |
| 224 | 651312-76-4 | Phenol, 3-[(1R,2R)-2-[(methylamino)methyl]cyclohexyl]-, hydrochloride (1:1) | C14H22ClNO | 255.79 | | |
| 225 | 651312-80-0 | Ditelluride, bis(3,5-dimethyl-2-nitrophenyl) | C16H16N2O4Te2 | 555.50924 | | |
| 226 | 651312-86-6 | 2,4(1H,3H)-Pyrimidinedione,6-(2-cyclopenten-1-yl)-5-hydroxy-1,3-dimethyl-(9CI) | C11H14N2O3 | 222.24046 | | |
| 227 | 651312-87-7 | 2,4,6(1H,3H,5H)-Pyrimidinetrione, 5-(2-cyclopenten-1-yl)-1,3-dimethyl- | C11H14N2O3 | 222.24046 | | |
| 228 | 651312-90-2 | Propanedioic acid, [(1-oxohexadecyl)amino]- | C19H35NO5 | 357.4849 | | |
| 229 | 651312-92-4 | Propanedioic acid, [(1-oxooctadecyl)amino]-, diethyl ester | C25H47NO5 | 441.64438 | | |
| 230 | 651312-94-6 | Propanedioic acid, [(1-oxooctadecyl)amino]- | C21H39NO5 | 385.53806 | | |
| 231 | 651312-96-8 | Propanedioic acid, [(1-oxodocosyl)amino]-, diethyl ester | C29H55NO5 | 497.7507 | | |
| 232 | 651313-00-7 | Propanedioic acid, 2,2'-[(1,14-dioxo-1,14-tetradecanediyl)diimino]bis- | C20H32N2O10 | 460.47548 | | |
| 233 | 651313-01-8 | Propanedioic acid, (dodecylamino)-, hydrochloride | C15H30ClNO4 | 323.856 | | |
| 234 | 651313-02-9 | 1,1,3-Propanetricarboxylic acid, 2-decyl- | C16H28O6 | 316.38992 | | |
| 235 | 651313-05-2 | Glycine, L-leucyl-L-arginyl-L-leucyl-L-arginylglycyl- | C28H54N12O7 | 670.8 | | |
| 236 | 651313-06-3 | L-Tyrosine, glycylglycyl-L-alanyl-L-threonyl- (9CI) | C20H29N5O8 | 467.47 | | |
| 237 | 651313-95-0 | 1H-Pyrrolizine, hexahydro-7a-[(1Z)-2-(5-isoxazolyl)ethenyl]- | C12H16N2O | 204.26824 | | |
| 238 | 651313-96-1 | 1H-Pyrrolizine, hexahydro-7a-(5-isoxazolylethynyl)- | C12H14N2O | 202.25236 | | |
| 239 | 651313-97-2 | Indolizine, octahydro-8a-[(1E)-2-(5-isoxazolyl)ethenyl]- | C13H18N2O | 218.29482 | | |
| 240 | 651313-99-4 | Indolizine, octahydro-8a-(5-isoxazolylethynyl)- | C13H16N2O | 216.27894 | | |
| 241 | 651314-00-0 | 2H-Quinolizine, octahydro-9a-[(1E)-2-(5-isoxazolyl)ethenyl]- | C14H20N2O | 232.3214 | | |
| 242 | 651314-02-2 | 2H-Quinolizine, octahydro-9a-(5-isoxazolylethynyl)- | C14H18N2O | 230.30552 | | |
| 243 | 651314-03-3 | 1-Azabicyclo[4.2.0]octane, 6-[(1E)-2-(5-isoxazolyl)ethenyl]- | C12H16N2O | 204.26824 | | |
| 244 | 651314-04-4 | 1-Azabicyclo[4.2.0]octane, 6-[(1Z)-2-(5-isoxazolyl)ethenyl]- | C12H16N2O | 204.27 | | |
| 245 | 651314-05-5 | 1-Azabicyclo[4.2.0]octane, 6-(5-isoxazolylethynyl)- | C12H14N2O | 202.25236 | | |
| 246 | 651314-06-6 | 1-Azabicyclo[3.2.0]heptane, 5-[(1E)-2-(5-isoxazolyl)ethenyl]- | C11H14N2O | 190.24166 | | |
| 247 | 651314-08-8 | 1-Azabicyclo[3.2.0]heptane, 5-(5-isoxazolylethynyl)- | C11H12N2O | 188.22578 | | |
| 248 | 651314-09-9 | 1H-Pyrrolizine, hexahydro-7a-[(1E)-2-(1,2,4-oxadiazol-5-yl)ethenyl]- | C11H15N3O | 205.2563 | | |
| 249 | 651314-11-3 | 1H-Pyrrolizine, hexahydro-7a-(1,2,4-oxadiazol-5-ylethynyl)- | C11H13N3O | 203.24042 | | |
| 250 | 651314-12-4 | 1H-Pyrrolizine, hexahydro-7a-[(1E)-2-(5-isothiazolyl)ethenyl]- | C12H16N2S | 220.33384 | | |
| 251 | 651314-14-6 | 1H-Pyrrolizine, hexahydro-7a-(5-isothiazolylethynyl)- | C12H14N2S | 218.32 | | |
| 252 | 651314-15-7 | 1H-Pyrrolizine, hexahydro-7a-[(1E)-2-(5-oxazolyl)ethenyl]- | C12H16N2O | 204.27 | | |
| 253 | 651314-17-9 | 1H-Pyrrolizine, hexahydro-7a-(5-oxazolylethynyl)- | C12H14N2O | 202.25236 | | |
| 254 | 651314-18-0 | 1H-Pyrrolizine, hexahydro-7a-[(1E)-2-(1H-pyrazol-3-yl)ethenyl]- | C12H17N3 | 203.28348 | | |
| 255 | 651314-20-4 | 1H-Pyrrolizine, hexahydro-7a-(1H-pyrazol-3-ylethynyl)- | C12H15N3 | 201.27 | | |
| 256 | 651314-21-5 | 1H-Pyrrolizine, hexahydro-7a-[(1E)-2-(1H-imidazol-4-yl)ethenyl]- | C12H17N3 | 203.28348 | | |
| 257 | 651314-23-7 | 1H-Pyrrolizine, hexahydro-7a-(1H-imidazol-4-ylethynyl)- | C12H15N3 | 201.2676 | | |
| 258 | 651314-24-8 | 1H-Pyrrolizine, hexahydro-7a-[(1E)-2-(1H-1,2,3-triazol-4-yl)ethenyl]- | C11H16N4 | 204.27154 | | |
| 259 | 651314-25-9 | 1H-Pyrrolizine, hexahydro-7a-[(1Z)-2-(1H-1,2,4-triazol-3-yl)ethenyl]- | C11H16N4 | 204.27154 | | |
| 260 | 651314-26-0 | 1H-Pyrrolizine, hexahydro-7a-(1H-1,2,4-triazol-3-ylethynyl)- | C11H14N4 | 202.25566 | | |
| 261 | 651314-27-1 | 1H-Pyrrolizine, hexahydro-7a-[(1E)-2-(5-thiazolyl)ethenyl]- | C12H16N2S | 220.33384 | | |
| 262 | 651314-29-3 | 1H-Pyrrolizine, hexahydro-7a-(5-thiazolylethynyl)- | C12H14N2S | 218.31796 | | |
| 263 | 651314-30-6 | Isoxazole, 5-[(1Z)-2-(2-pyrrolidinyl)ethenyl]- (9CI) | C9H12N2O | 164.20438 | | |
| 264 | 651314-31-7 | Isoxazole, 5-(2-pyrrolidinylethynyl)- (9CI) | C9H10N2O | 162.1885 | | |
| 265 | 651314-32-8 | Piperidine, 2-[(1Z)-2-(5-isoxazolyl)ethenyl]- | C10H14N2O | 178.23096 | | |
| 266 | 651314-33-9 | Piperidine, 2-(5-isoxazolylethynyl)- | C10H12N2O | 176.21508 | | |
| 267 | 651314-34-0 | Pyridine, 1,2,3,4-tetrahydro-2-[(1E)-2-(5-isoxazolyl)ethenyl]- | C10H12N2O | 176.21508 | | |
| 268 | 651314-70-4 | 1-Azabicyclo[3.2.2]nonane, 7-(5-isoxazolylethynyl)- | C13H16N2O | 216.27894 | | |
| 269 | 651314-71-5 | Isoxazole, 5-[(1E)-3-(2-pyrrolidinyl)-1-propenyl]- | C10H14N2O | 178.23 | | |
| 270 | 651314-73-7 | Isoxazole, 5-[3-(2-pyrrolidinyl)-1-propynyl]- | C10H12N2O | 176.21508 | | |
| 271 | 651314-74-8 | Piperidine, 2-[(2E)-3-(5-isoxazolyl)-2-propen-1-yl]- | C11H16N2O | 192.26 | | |
| 272 | 651314-76-0 | Piperidine, 2-[3-(5-isoxazolyl)-2-propynyl]- | C11H14N2O | 190.24166 | | |
| 273 | 651314-77-1 | Morpholine, 3-[(2E)-3-(5-isoxazolyl)-2-propen-1-yl]- | C10H14N2O2 | 194.23 | | |
| 274 | 651314-83-9 | 1-Azabicyclo[2.2.1]heptane, 2-[3-(5-isoxazolyl)-2-propynyl]- | C12H14N2O | 202.25236 | | |
| 275 | 651315-16-1 | Cyclohexaneacetic acid, 2-oxo-1-(phenylthio)-, ethyl ester | C16H20O3S | 292.3932 | | |
| 276 | 651315-21-8 | 2H-Indol-2-one, 1-[2-(2-furanyl)ethyl]-1,3,3a,4,5,6-hexahydro-3a-methyl- | C15H19NO2 | 245.31686 | | |
| 277 | 651315-30-9 | Furan, 2-(3-azidopropyl)-5-ethyl- | C9H13N3O | 179.21902 | | |
| 278 | 651315-40-1 | 2(1H)-Quinolinone, 3,4-dihydro-3-propyl- | C12H15NO | 189.2536 | | |
| 279 | 651315-41-2 | 2(1H)-Quinolinone, 3-(3-chloropropyl)-3,4-dihydro- | C12H14ClNO | 223.69866 | | |
| 280 | 651315-42-3 | 2(1H)-Quinolinone, 3-(3-fluoropropyl)-3,4-dihydro- | C12H14FNO | 207.2440632 | | |
| 281 | 651315-43-4 | 2(1H)-Quinolinone, 3,4-dihydro-3-methyl-6-nitro- | C10H10N2O3 | 206.2 | | |
| 282 | 651315-44-5 | 2(1H)-Quinolinone,3-ethyl-3,4-dihydro-6-nitro-(9CI) | C11H12N2O3 | 220.22458 | | |
| 283 | 651315-50-3 | 2(1H)-Quinolinone, 3,4-dihydro-3-(3-hydroxypropyl)- | C12H15NO2 | 205.25 | | |
| 284 | 651315-51-4 | 2(1H)-Quinolinone, 3,4-dihydro-3-(3-hydroxypropyl)-6-nitro- | C12H14N2O4 | 250.25056 | | |
| 285 | 651315-70-7 | Pyrimidine, 4-chloro-5,6-diphenyl-2-(trifluoromethyl)- | C17H10ClF3N2 | 334.7229096 | | |
| 286 | 651315-71-8 | Pyrimidine, 4-chloro-6-(4-methylphenyl)-5-phenyl-2-(trifluoromethyl)- | C18H12ClF3N2 | 348.7494896 | | |
| 287 | 651315-72-9 | Pyrimidine, 4-chloro-6-(4-fluorophenyl)-5-phenyl-2-(trifluoromethyl)- | C17H9ClF4N2 | 352.7133728 | | |
| 288 | 651315-76-3 | Pyrimidine, 2,4-dichloro-5,6-diphenyl- | C16H10Cl2N2 | 301.17 | | |
| 289 | 651315-77-4 | Pyrimidine, 2,4-dichloro-6-(4-methylphenyl)-5-phenyl- | C17H12Cl2N2 | 315.19658 | | |
| 290 | 651315-78-5 | Pyrimidine, 2,4-dichloro-6-(4-chlorophenyl)-5-phenyl- | C16H9Cl3N2 | 335.61506 | | |
| 291 | 651315-79-6 | Pyrimidine, 2,4-dichloro-5-(4-chlorophenyl)-6-phenyl- | C16H9Cl3N2 | 335.61506 | | |
| 292 | 651315-80-9 | Pyrimidine, 2,4-dichloro-5-(4-methoxyphenyl)-6-phenyl- | C17H12Cl2N2O | 331.19598 | | |
| 293 | 651315-81-0 | Pyrimidine, 2,4-dichloro-5-[4-(methylthio)phenyl]-6-phenyl- | C17H12Cl2N2S | 347.26158 | | |
| 294 | 651315-82-1 | Pyrimidine, 2,4-dichloro-6-(4-chlorophenyl)-5-[4-(methylthio)phenyl]- | C17H11Cl3N2S | 381.71 | | |
| 295 | 651315-83-2 | Pyrimidine, 2,4-dichloro-5-(4-chlorophenyl)-6-(4-methylphenyl)- | C17H11Cl3N2 | 349.64 | | |
| 296 | 651315-84-3 | Pyrimidine, 4-azido-5,6-diphenyl-2-(trifluoromethyl)- | C17H10F3N5 | 341.2900096 | | |
| 297 | 651315-88-7 | Pyrimidine, 2,4-diazido-5,6-diphenyl- | C16H10N8 | 314.3042 | | |
| 298 | 651315-89-8 | Pyrimidine, 2,4-diazido-5-(4-chlorophenyl)-6-phenyl- | C16H9ClN8 | 348.75 | | |
| 299 | 651315-90-1 | 4(1H)-Pyrimidinone, 5,6-diphenyl-2-(trifluoromethyl)-, hydrazone | C17H13F3N4 | 330.3071296 | | |
| 300 | 651315-94-5 | Pyrimidine, 5-(4-chlorophenyl)-4-hydrazinyl-6-[4-(methylsulfonyl)phenyl]-2-(trifluoromethyl)- | C18H14ClF3N4O2S | 442.84 | | |
| 301 | 651315-96-7 | 4(1H)-Pyrimidinone, 2-chloro-5,6-diphenyl-, hydrazone | C16H13ClN4 | 296.75422 | | |
| 302 | 651315-98-9 | 2,4(1H,3H)-Pyrimidinedione, 5,6-diphenyl-, dihydrazone | C16H16N6 | 292.33844 | | |
| 303 | 651316-07-3 | 2(1H)-Pyrimidinone, 4-chloro-1,6-diphenyl- | C16H11ClN2O | 282.72434 | | |
| 304 | 651316-08-4 | 4(1H)-Pyrimidinone, 6-(4-methylphenyl)-5-phenyl-2-(trifluoromethyl)- | C18H13F3N2O | 330.3038296 | | |
| 305 | 651316-09-5 | 4(1H)-Pyrimidinone, 6-(4-fluorophenyl)-5-phenyl-2-(trifluoromethyl)- | C17H10F4N2O | 334.2677128 | | |
| 306 | 651316-11-9 | 1H-1-Benzazepine-8-carboxylic acid, 2,3,4,5-tetrahydro-2,5-dioxo- | C11H9NO4 | 219.19346 | | |
| 307 | 651316-12-0 | 1H-1-Benzazepine-2,5-dione, 3,4-dihydro-, 5-oxime | C10H10N2O2 | 190.1986 | | |
| 308 | 651316-14-2 | 1H-1-Benzazepine-2,5-dione, 3,4-dihydro-7-methyl-, 5-oxime | C11H12N2O2 | 204.22518 | | |
| 309 | 651316-16-4 | 1H-1-Benzazepine-2,5-dione, 7-bromo-3,4-dihydro-, 5-oxime | C10H9BrN2O2 | 269.09466 | | |
| 310 | 651316-19-7 | 1,6-Benzodiazocine-2,5-dione, 1,3,4,6-tetrahydro-8-methyl- | C11H12N2O2 | 204.22518 | | |
| 311 | 651316-20-0 | 2(1H)-Pyrimidinone, 4-azido-6-[4-(methylthio)phenyl]-1-phenyl- | C17H13N5OS | 335.38302 | | |
| 312 | 651316-23-3 | 1,6-Benzodiazocine-2,5-dione, 8-bromo-1,3,4,6-tetrahydro- | C10H9BrN2O2 | 269.09466 | | |
| 313 | 651316-31-3 | Pyrimidine, 4,5-bis(4-methylphenyl)-6-(methylthio)- | C19H18N2S | 306.42462 | | |
| 314 | 651316-32-4 | 2(1H)-Pyrimidinone, 4-(methylthio)-5,6-diphenyl- | C17H14N2OS | 294.37086 | | |
| 315 | 651316-33-5 | Pyrimidine, 4,5-bis(4-methylphenyl)-6-(methylsulfonyl)- | C19H18N2O2S | 338.42 | | |
| 316 | 651316-34-6 | 2(1H)-Pyrimidinone, 1,6-diphenyl-4-(trifluoromethyl)- | C17H11F3N2O | 316.2772496 | | |
| 317 | 651316-36-8 | Pyrimidine, 4-(methylthio)-6-[4-(methylthio)phenyl]-5-phenyl- | C18H16N2S2 | 324.46304 | | |
| 318 | 651316-37-9 | Pyrimidine, 2-chloro-4,5-bis(4-methylphenyl)-6-(methylthio)- | C19H17ClN2S | 340.86968 | | |
| 319 | 651316-41-5 | Benzenesulfonamide, 4-[2-chloro-6-(methylthio)-5-phenyl-4-pyrimidinyl]- | C17H14ClN3O2S2 | 391.89496 | | |
| 320 | 651316-42-6 | Pyrimidine, 2-chloro-4,5-bis(4-methoxyphenyl)-6-(methylthio)- | C19H17ClN2O2S | 372.86848 | | |
| 321 | 651316-43-7 | Pyrimidine, 2-chloro-4-(methylthio)-6-[4-(methylthio)phenyl]-5-phenyl- | C18H15ClN2S2 | 358.91 | | |
| 322 | 651316-44-8 | Pyrimidine, 2,4-diazido-6-[4-(methylthio)phenyl]-5-phenyl- | C17H12N8S | 360.4 | | |
| 323 | 651316-45-9 | Pyrimidine, 2,4-diazido-5-(4-bromophenyl)-6-[4-(methylthio)phenyl]- | C17H11BrN8S | 439.29184 | | |
| 324 | 651316-46-0 | 2(1H)-Pyrimidinone, 4-chloro-6-[4-(methylsulfonyl)phenyl]-1-phenyl- | C17H13ClN2O3S | 360.81472 | | |
| 325 | 651316-47-1 | 2(1H)-Pyrimidinone, 4-azido-1-(2-fluorophenyl)-6-[4-(methylthio)phenyl]- | C17H12FN5OS | 353.3734832 | | |
| 326 | 651316-60-8 | 1-Naphthalenamine,N,N-dimethyl-,labeledwithdeuterium(9CI) | C12H13N | 171.24 | | |
| 327 | 651317-21-4 | L-Alaninamide, 2,6-dimethyl-L-tyrosyl-D-arginyl-L-phenylalanyl-3-amino- | C29H43N9O5 | 597.71 | | |
| 328 | 651317-92-9 | Cyclohexanol, 2-[[4-(1-methylethyl)phenyl]thio]-, (1S,2S)- | C15H22OS | 250.4 | | |
| 329 | 65132-06-1 | 22,29,30-TRISNORHOP-17(21)-ENE | C27H44 | 368.64 | | |
| 330 | 65132-13-0 | 3H-1,5-Benzodiazepine,2,4,7,8-tetramethyl- | C13H16N2 | 200.28 | | |
| 331 | 65132-20-9 | dipotassium p-[4,5-dihydro-4-[3-[5-hydroxy-3-methyl-1-(4-sulphonatophenyl)-1H-pyrazol-4-yl]allylidene]-3-methyl-5-oxo-1H-pyrazol-1-yl]benzenesulphonate | C23H18K2N4O8S2 | 620.73762 | | |
| 332 | 65132-26-5 | 2-(benzyl)-6,7-dimethoxy-1H-benz[de]isoquinoline-1,3(2H)-dione | C21H17NO4 | 347.36398 | | |
| 333 | 65132-43-6 | P-(TRANS-4-HYDROXYCYCLOHEXYL)PHENOL | C12H16O2 | 192.25 | 222.5-223.5 °C(Solv: ethyl acetate (141-78-6)) | |
| 334 | 65132-49-2 | Pyridinium, 1-hexadecyl-3-hydroxy-, bromide | C21H38BrNO | 400.43652 | | |
| 335 | 65132-51-6 | Quinoline, 8-[(2,2-dihydro-2-phenoxy-1,3,2-benzodioxaphosphol-2-yl)oxy]- (9CI) | C21H16NO4P | 377.33 | | |
| 336 | 65132-59-4 | Difluorobis(pentafluorophenyl)(ethylthio)phosphorane | | | | |
| 337 | 65132-60-7 | Carbidopa hydrochloride | | | | |
| 338 | 65132-67-4 | Acetic acid, [[[(17β)-3-(benzoyloxy)-17-hydroxyestra-1,3,5(10)-trien-6-ylidene]amino]oxy]- (9CI) | C27H29NO6 | 463.52 | | |
| 339 | 65132-74-3 | (S)-4,11-Bis(((butoxycarbonyl)amino)methyl)-10-carboxy-5-oxo-2,4,6,11,13-pentaazatetradecanedioic acid, 1,14-dibutyl ester | C30H57N7O11 | 691.81388 | | |
| 340 | 65132-78-7 | Bicyclo[2.2.1]hept-5-ene-2,2-dicarboxylic acid, ethyl methyl ester | C12H16O4 | 224.25304 | | |
| 341 | 65132-79-8 | Propanedioic acid, methylene-, ethyl methyl ester | C7H10O4 | 158.15 | | |
| 342 | 65132-82-3 | Octadecanamide, N-[(2,3-dihydroxypropoxy)methyl]- | C22H45NO4 | 387.597 | | |
| 343 | 65132-83-4 | Octadecanamide, N-[(hydroxymethoxy)methyl]- | C20H41NO3 | 343.54444 | | |
| 344 | 65132-92-5 | 5-Hepten-3-one, 5-hydroxy-2,4,4,6-tetramethyl- | C11H20O2 | 184.2753 | | |
| 345 | 65132-96-9 | 2-Hexene, 2,4,4,5-tetramethyl- | C10H20 | 140.27 | | |
| 346 | 651321-20-9 | Pyridine, 3,3-difluoro-1,2,3,6-tetrahydro-1-methyl-4-phenyl- | C12H13F2N | 209.2351264 | | |
| 347 | 651321-21-0 | Pyridine, 3-fluoro-1,2,5,6-tetrahydro-1-methyl-4-phenyl- | C12H14FN | 191.2446632 | | |
| 348 | 651321-22-1 | Pyridine, 1,2,3,6-tetrahydro-4-phenyl-1-(2,2,2-trifluoroethyl)- | C13H14F3N | 241.2521696 | | |
| 349 | 651321-24-3 | 2-Piperidinone, 3,3-difluoro-4-hydroxy-1-methyl-4-phenyl- | C12H13F2NO2 | 241.2339264 | | |
| 350 | 651321-25-4 | 4-Piperidinol, 3,3-difluoro-1-methyl-4-phenyl- | C12H15F2NO | 227.2504064 | | |
| 351 | 651321-26-5 | tert-butyl 3-fluoro-4-phenyl-5,6-dihydropyridine-1(2H)-carboxylate | C16H20FNO2 | 277.33 | | |
| 352 | 651321-27-6 | Pyridinium, 3,3-difluoro-2,3-dihydro-1-methyl-4-phenyl- | C12H12F2N+ | 208.2271864 | | |
| 353 | 651321-28-7 | Pyridinium, 5-fluoro-2,3-dihydro-1-methyl-4-phenyl- | C12H13FN+ | 190.2367232 | | |
| 354 | 651321-29-8 | Pyridinium, 2,3-dihydro-4-phenyl-1-(2,2,2-trifluoroethyl)- | C13H13F3N+ | 240.2442296 | | |
| 355 | 651321-55-0 | 1-Piperidinecarboxylic acid, 2-(1E)-1-propenyl-, phenylmethyl ester | C16H21NO2 | 259.34344 | | |
| 356 | 651321-56-1 | Piperidine, 5,5-dimethyl-2-(1E)-1-propenyl- | C10H19N | 153.26456 | | |
| 357 | 651321-57-2 | Piperidine, 2-(1E)-1-propenyl-, (2R)- (9CI) | C8H15N | 125.2114 | | |
| 358 | 651321-58-3 | Pyrrolidine, 2-(1E)-1-butenyl- (9CI) | C8H15N | 125.2114 | | |
| 359 | 651321-59-4 | Pyrrolidine, 2-(2E)-2-butenyl- (9CI) | C8H15N | 125.2114 | | |
| 360 | 651321-92-5 | Glutamic acid, N-(diphenylmethylene)-3-phenyl-, 1,5-dimethyl ester | C26H25NO4 | 415.48 | | |
| 361 | 651321-94-7 | Glutamic acid, N-(diphenylmethylene)-3-phenyl-, 1-ethyl 5-methyl ester | C27H27NO4 | 429.51 | | |
| 362 | 651321-97-0 | Glutamic acid, N-(diphenylmethylene)-3-phenyl-, 5-ethyl 1-methyl ester | C27H27NO4 | 429.50758 | | |
| 363 | 651322-01-9 | Glutamic acid, N-(diphenylmethylene)-3-phenyl-, 1,5-diethyl ester | C28H29NO4 | 443.53 | | |
| 364 | 651322-14-4 | Glycine, glycyl-L-isoleucyl-L-leucyl-L-prolylglycyl-L-seryl- (9CI) | C26H45N7O9 | 599.68 | | |
| 365 | 651322-18-8 | L-Serine, L-arginyl-L-seryl-L-glutaminyl-L-lysyl-L-α-glutamylglycyl-L-leucyl-L-histidyl-L-tyrosyl-L-threonyl-L-cysteinyl- | C58H93N19O20S | 1408.54 | | |
| 366 | 651322-27-9 | 1H-Cycloprop[e]azulene,decahydro-(9CI) | C11H18 | 150.26062 | | |
| 367 | 651322-68-8 | Guanidine, N,N''-dinitro-, [C(E)]- (9CI) | CH3N5O4 | 149.07 | | |
| 368 | 651322-72-4 | Methanone, (2,4,6-trihydroxy-1,3-phenylene)bis[(2-bromophenyl)- (9CI) | C20H12Br2O5 | 492.11 | | |
| 369 | 651322-74-6 | 1,3,5-Benzenetriol, 2,4-bis[(2-bromophenyl)hydroxymethyl]- | C20H16Br2O5 | 496.14604 | | |
| 370 | 651322-76-8 | 2H-Pyrrol-2-one, 4-ethoxy-1,5-dihydro-3-iodo-1-methyl- | C7H10INO2 | 267.06427 | | |
| 371 | 651322-77-9 | 2H-Pyrrol-2-one,4-ethoxy-1,5-dihydro-3-(1-methoxyethenyl)-1-methyl-(9CI) | C10H15NO3 | 197.23 | | |
| 372 | 651322-89-3 | 1,3-Dithiolane, 2-[3,6-dimethoxy-2-[(phenylmethoxy)methyl]phenyl]- | C19H22O3S2 | 362.50618 | | |
| 373 | 651323-51-2 | Butanoic acid, 4-amino-2-[[(4-methylphenyl)methyl]amino]-, methyl ester | C13H20N2O2 | 236.3101 | | |
| 374 | 651324-04-8 | Oseltamivir Impurity 48 | C18H33NO4 | 327.46 | | |
| 375 | 651324-05-9 | 7-Azabicyclo[4.1.0]hept-3-ene-3-carboxylic acid, 7-(1,1-dimethylethyl)-5-(1-ethylpropoxy)-, ethyl ester, (1R,5R,6S)- | C18H31NO3 | 309.44 | | |
| 376 | 651324-06-0 | Oseltamivir Impurity 50 | C24H42N2O3 | 406.6 | | |
| 377 | 651324-07-1 | Oseltamivir | C26H44N2O4 | 448.64 | | |
| 378 | 651324-08-2 | Ethyl(3R,4R,5S)-4-N-Acetyamino-N-tBu-5-N,N-diallylamino-3-(1-ethylpropoxy)-1-cyclohexene-1-carboxylate monohydrochloride | C26H45ClN2O4 | 485.11 | | |
| 379 | 651324-09-3 | (3R,4R,5S)-ethyl 4-acetamido-5-(diallylamino)-3-(pentan-3-yloxy)cyclohex-1-enecarboxylate | C22H36N2O4 | 392.53 | | |
| 380 | 651325-30-3 | 3-Hexyn-2-ol, 1-chloro-6-[(tetrahydro-2H-pyran-2-yl)oxy]- | C11H17ClO3 | 232.70388 | | |
| 381 | 651325-33-6 | 3-Hexen-1-ol, 6-chloro-5-[[tris(1-methylethyl)silyl]oxy]-, (3Z)- | C15H31ClO2Si | 306.94394 | | |
| 382 | 651325-70-1 | Hibiscus Rosa-Sinensis Flower Extract | | | | |
| 383 | 651326-24-8 | Phenol, 3-fluoro-5-[tetrahydro-4-(phenylmethoxy)-2H-pyran-4-yl]- | C18H19FO3 | 302.3400632 | | |
| 384 | 651326-25-9 | Benzoic acid, 4-(4,5-dihydro-1-methyl-1H-imidazol-2-yl)-, methyl ester | C12H14N2O2 | 218.25176 | | |
| 385 | 651326-27-1 | Benzonitrile, 4-(2-iodo-1H-imidazol-1-yl)- | C10H6IN3 | 295.07921 | | |
| 386 | 651326-28-2 | Benzonitrile, 4-[2-(trifluoromethyl)-1H-imidazol-1-yl]- | C11H6F3N3 | 237.1806496 | | |
| 387 | 651326-32-8 | 2,16-Octadecadiyne | C18H30 | 246.43 | | |
| 388 | 651326-33-9 | 2,15-Heptadecadiyne | C17H28 | 232.40422 | | |
| 389 | 651326-34-0 | 2,14-Hexadecadiyne | C16H26 | 218.37764 | | |
| 390 | 651326-35-1 | 2,13-Pentadecadiyne | C15H24 | 204.35106 | | |
| 391 | 651326-66-8 | Benzene, 1-bromo-2-[(1-ethoxyethoxy)methyl]-4-methoxy- | C12H17BrO3 | 289.16558 | | |
| 392 | 651326-68-0 | Benzene, 1-bromo-2-[(1-ethoxyethoxy)methyl]-4-fluoro- | C11H14BrFO2 | 277.13 | | |
| 393 | 651326-71-5 | 6-broMo-2,4-difluoro-3-(triMethylsilyl)benzaldehyde | C10H11BrF2OSi | 293.18 | | |
| 394 | 651326-72-6 | 6-BROMO-2,3-DIFLUOROBENZENEMETHANOL | C7H5BrF2O | 223.01 | | |
| 395 | 651326-73-7 | Benzenemethanol, 6-bromo-2,3,4-trifluoro- | C7H4BrF3O | 241.01 | | |
| 396 | 651326-74-8 | Benzenemethanol, 6-bromo-2,4-difluoro-3-(trimethylsilyl)- | C10H13BrF2OSi | 295.1959264 | | |
| 397 | 651326-75-9 | Benzene, 1-bromo-2-[(1-ethoxyethoxy)methyl]-3,4-difluoro- | C11H13BrF2O2 | 295.1205264 | | |
| 398 | 651326-76-0 | Benzene, 1-bromo-2-[(1-ethoxyethoxy)methyl]-3,4,5-trifluoro- | C11H12BrF3O2 | 313.1109896 | | |
| 399 | 651326-78-2 | 2,1-Benzoxaborole, 4,5-difluoro-1,3-dihydro-1-hydroxy- | C7H5BF2O2 | 169.92 | | |
| 400 | 651326-79-3 | 2,1-Benzoxaborole, 4,5,6-trifluoro-1,3-dihydro-1-hydroxy- | C7H4BF3O2 | 187.9116696 | | |
| 401 | 651326-80-6 | 2,1-Benzoxaborole, 4,6-difluoro-1,3-dihydro-1-hydroxy-5-(trimethylsilyl)- | C10H13BF2O2Si | 242.1 | | |
| 402 | 651326-85-1 | Benzene, 1-bromo-2-[(1-ethoxyethoxy)methyl]-3-fluoro- | C11H14BrFO2 | 277.1300632 | | |
| 403 | 651327-18-3 | Methanaminium, N-(2-aminoethylidyne)-1-carboxy- | C4H7N2O2+ | 115.11 | | |
| 404 | 651327-20-7 | L-Asparagine, L-leucyl-L-seryl-L-alanyl-L-seryl-L-alanyl- (9CI) | C22H39N7O10 | 561.59 | | |
| 405 | 651327-23-0 | Glycine, glycyl-L-valyl-L-phenylalanyl-L-tyrosyl-L-cysteinyl- (9CI) | C30H40N6O8S | 644.74 | | |
| 406 | 651327-48-9 | L-Valine, L-alanyl-L-alanyl-L-prolylglycyl-L-alanyl-L-prolyl-L-alanyl-L-alanyl- (9CI) | C32H53N9O10 | 723.82 | | |
| 407 | 651327-49-0 | L-Valine, glycyl-L-alanyl-L-prolyl-L-alanyl-L-alanyl-L-valyl-L-alanyl-L-leucyl- (9CI) | C35H61N9O10 | 767.91 | | |
| 408 | 651327-71-8 | Butanedioic acid, hydroxy-, 4-butyl ester | C8H14O5 | 190.19376 | | |
| 409 | 651328-01-7 | 4-Isothiazolecarboxamide, 3,5-dichloro-N-[(phenylamino)carbonyl]- | C11H7Cl2N3O2S | 316.16318 | | |
| 410 | 651328-26-6 | Benzoic acid, 2-[methyl(phenylmethyl)amino]- | C15H15NO2 | 241.2851 | | |
| 411 | 651328-32-4 | Acetamide, N-[4-[methyl(1-phenylethyl)amino]phenyl]- | C17H20N2O | 268.3535 | | |
| 412 | 651328-35-7 | Benzoic acid, 4-[methyl(1-methylpropyl)amino]-, methyl ester | C13H19NO2 | 221.29546 | | |
| 413 | 651328-37-9 | Benzenemethanol, 4-[methyl(1-methylpropyl)amino]- | C12H19NO | 193.28536 | | |
| 414 | 651328-38-0 | Benzenamine, N,4-dimethyl-N-(1-methylpropyl)- | C12H19N | 177.28596 | | |
| 415 | 651328-39-1 | Butanoic acid, 3-[methyl(4-methylphenyl)amino]-, ethyl ester | C14H21NO2 | 235.32204 | | |
| 416 | 651328-41-5 | Phenol, 4-[[methyl(4-methylphenyl)amino]methyl]- | C15H17NO | 227.30158 | | |
| 417 | 651328-42-6 | Acetamide, N-[4-[[(4-bromophenyl)methyl]methylamino]phenyl]- | C16H17BrN2O | 333.22298 | | |
| 418 | 651328-51-7 | Ketone, benzyl 5-ethyl-2-thienyl (5CI) | C14H14OS | 230.33 | | |
| 419 | 651328-62-0 | L-Aspartic acid, L-lysylglycyl-L-tyrosyl-L-isoleucyl- (9CI) | C27H42N6O9 | 594.66 | | |
| 420 | 651328-63-1 | L-Aspartic acid, L-lysylglycyl-L-tyrosyl-L-valyl- (9CI) | C26H40N6O9 | 580.63 | | |
| 421 | 651328-78-8 | AMINOPEPTIDASE N LIGAND (CD13) | C20H36N10O8S2 | 608.69 | | |
| 422 | 651328-99-3 | 2-Propenoic acid, 3-(1,6-dihydro-3-hydroxy-6-oxo-2-pyridinyl)- | C8H7NO4 | 181.14548 | | |
| 423 | 651329-25-8 | 2(1H)-Quinolinone, 6,8-diamino-3,4-dihydro- | C9H11N3O | 177.20314 | | |
| 424 | 651329-27-0 | 2(1H)-Quinolinone, 3,4-dihydro-6-hydroxy-8-nitro- | C9H8N2O4 | 208.17082 | | |
| 425 | 651329-37-2 | 2,2'-Bithiophene, 5-(3,5-dibromophenyl)- | C14H8Br2S2 | 400.15132 | | |
| 426 | 651329-38-3 | 1,3-Benzenediamine, 5-[2,2'-bithiophen]-5-yl-N,N,N',N'-tetraphenyl- | C40H32N2S2 | 604.82548 | | |
| 427 | 651329-39-4 | Boronic acid, [5'-[3,5-bis(diphenylamino)phenyl][2,2'-bithiophen]-5-yl]- | C42H33BN2O2S2 | 672.66462 | | |
| 428 | 651329-41-8 | Thiophene, 2,2'-[5-(2-thienyl)-1,3-phenylene]bis[5-bromo- | C18H10Br2S3 | 482.275 | | |
| 429 | 651329-42-9 | Thiophene, 2-(3,5-dichlorophenyl)- | C10H6Cl2S | 229.12564 | | |
| 430 | 651329-43-0 | 1,3-Benzenediamine, N,N,N',N'-tetraphenyl-5-(2-thienyl)- | C34H26N2S | 494.64864 | | |
| 431 | 651329-44-1 | Boronic acid, [5-[3,5-bis(diphenylamino)phenyl]-2-thienyl]- | C34H27BN2O2S | 538.46638 | | |
| 432 | 651329-80-5 | Phosphine, diphenyl[3-(triphenylsilyl)phenyl]- | C36H29PSi | 520.674721 | | |
| 433 | 651329-81-6 | Phosphine, diphenyl[4-(triphenylsilyl)phenyl]- | C36H29PSi | 520.674721 | | |
| 434 | 651329-82-7 | Phosphine, bis(1-methylethyl)[3-(triphenylsilyl)phenyl]- | C30H33PSi | 452.642281 | | |
| 435 | 651329-83-8 | Phosphine, bis(1-methylethyl)[4-(triphenylsilyl)phenyl]- | C30H33PSi | 452.642281 | | |
| 436 | 65133-02-0 | Acetylenic Cypermethrin | C22H18ClNO3 | 379.84 | | |
| 437 | 65133-47-3 | 2(1H)-Pyrimidinone, 4,5,6-trimethyl- (9CI) | C7H10N2O | 138.17 | | |
| 438 | 65133-63-3 | 1,3,5,7-Tetrazocine-2,6(1H,3H)-dione, 1,3,5,7-tetraethyltetrahydro- | C12H24N4O2 | 256.34456 | | |
| 439 | 65133-65-5 | Benzenamine, N-butyl-N-hexyl- | C16H27N | 233.39228 | | |
| 440 | 65133-68-8 | Benzenemethanol, 3-hydroxy-α-[(1S)-1-(methylamino)ethyl]-, (αR)- | C10H15NO2 | 181.23 | | |
| 441 | 65133-69-9 | 1,4-Benzenedicarboxylic acid, 1-(2-hydroxyethyl) 4-[2-(2-hydroxyethoxy)ethyl] ester | C14H18O7 | 298.29 | | |
| 442 | 65133-71-3 | Methanone, (2-hydroxy-4-morpholinyl)(3,4,5-trimethoxyphenyl)- | C14H19NO6 | 297.3 | | |
| 443 | 65133-72-4 | Morpholine, 4-(3-hydroxy-4,5-dimethoxybenzoyl)- | C13H17NO5 | 267.27778 | | |
| 444 | 65133-73-5 | Benzamide, N-(2-hydroxyethyl)-3,4,5-trimethoxy- | C12H17NO5 | 255.27 | | |
| 445 | 65133-74-6 | Acetic acid, [2-[(3,4,5-trimethoxybenzoyl)amino]ethoxy]- | C14H19NO7 | 313.30316 | | |
| 446 | 65133-93-9 | Benzoic acid, 2-(4-hydroxybenzoyl)-, ethyl ester | C16H14O4 | 270.27996 | | |
| 447 | 65133-97-3 | Benzoic acid, 2-(2,4-dihydroxybenzoyl)-, 2-ethylhexyl ester | C22H26O5 | 370.43884 | | |
| 448 | 65133-98-4 | Silane, trichloro(2,6-dimethylphenoxy)- | C8H9Cl3OSi | 255.60096 | | |
| 449 | 651330-02-8 | Phosphine, (3-bromophenyl)bis(1-methylethyl)- | C12H18BrP | 273.15 | | |
| 450 | 651330-03-9 | Phosphine, (4-bromophenyl)bis(1-methylethyl)- | C12H18BrP | 273.149081 | | |
| 451 | 651330-32-4 | Pyribencarb Impurity 50 | | | | |
| 452 | 651330-33-5 | Ketone, 5-chloro-5-m-dioxanyl methyl (5CI) | C6H10ClO3 | 165.5948 | | |
| 453 | 651330-69-7 | 2-Propanone, 1-(4-iodo-2-methylphenoxy)- | C10H11IO2 | 290.09761 | | |
| 454 | 651330-70-0 | 2-Propanone, 1-[4-[(4-chlorophenyl)ethynyl]-2-methylphenoxy]- | C18H15ClO2 | 298.7635 | | |
| 455 | 651330-71-1 | 1H-Isoindole-1,3(2H)-dione, 2-[2-(4-iodophenoxy)ethyl]- | C16H12INO3 | 393.17585 | | |
| 456 | 651330-72-2 | Ethanamine, 2-[4-[(4-chlorophenyl)ethynyl]phenoxy]- | C16H14ClNO | 271.74146 | | |
| 457 | 651330-73-3 | Benzenemethanamine, N-[2-[4-[2-(4-chlorophenyl)ethynyl]phenoxy]ethyl]-4-(diethoxymethyl)- | C28H30ClNO3 | 464 | | |
| 458 | 651330-74-4 | Benzaldehyde, 4-[[[2-[4-[2-(4-chlorophenyl)ethynyl]phenoxy]ethyl]amino]methyl]- | C24H20ClNO2 | 389.87 | | |
| 459 | 651330-75-5 | Benzene, 1-(2-bromoethoxy)-4-iodo-2-methyl- | C9H10BrIO | 340.98357 | | |
| 460 | 651330-76-6 | Benzene, 1-(2-bromoethoxy)-4-[(4-chlorophenyl)ethynyl]-2-methyl- | C17H14BrClO | 349.65 | | |
| 461 | 651330-77-7 | 2-Piperidinecarboxylic acid, 3-aminopropyl ester | C9H18N2O2 | 186.25142 | | |
| 462 | 651330-95-9 | 1,3-Propanediol, 2,2-bis(2-pyridinylmethyl)- | C15H18N2O2 | 258.31562 | | |
| 463 | 651330-97-1 | Propanedioic acid, bis(2-quinolinylmethyl)-, diethyl ester | C27H26N2O4 | 442.50634 | | |
| 464 | 651330-98-2 | 1,3-Propanediol, 2,2-bis(2-quinolinylmethyl)- | C23H22N2O2 | 358.43298 | | |
| 465 | 651331-00-9 | 1-Propanethiol, compd. with N-propyl-1,2-ethanediamine (1:1) | C8H22N2S | 178.33868 | | |
| 466 | 651331-01-0 | 1-Propanethiol, compd. with 1-propanamine (1:1) | C6H17NS | 135.27088 | | |
| 467 | 651331-02-1 | 1-Propanethiol, compd. with N-methyl-1-propanamine (1:1) | C7H19NS | 149.29746 | | |
| 468 | 651331-06-5 | 3-acetyl-7-chloroquinolin-4(1H)-one | C11H8ClNO2 | 221.64 | | |
| 469 | 651331-26-9 | 1H-Indole-3-decanol, 5-methoxy- | C19H29NO2 | 303.43906 | | |
| 470 | 651331-27-0 | 1H-Indole-3-decanol, 4-methoxy- | C19H29NO2 | 303.43906 | | |
| 471 | 651331-28-1 | 1H-Indole-3-tetradecanol, 4-methoxy- | C23H37NO2 | 359.54538 | | |
| 472 | 651331-30-5 | 1H-Indole-3-decanol, 6-methoxy- | C19H29NO2 | 303.43906 | | |
| 473 | 651331-31-6 | 1H-Indole-3-dodecanol, 5-methoxy- | C21H33NO2 | 331.49222 | | |
| 474 | 651331-32-7 | 1H-Indole-3-tetradecanol, 5-methoxy- | C23H37NO2 | 359.54538 | | |
| 475 | 651331-33-8 | 1H-Indole-3-hexadecanol, 5-methoxy- | C25H41NO2 | 387.59854 | | |
| 476 | 651331-34-9 | 1H-Indole-3-octadecanol, 5-methoxy- | C27H45NO2 | 415.6517 | | |
| 477 | 651331-35-0 | 1H-Indole-3-dodecanol, 4-methoxy- | C21H33NO2 | 331.49222 | | |
| 478 | 651331-36-1 | 1H-Indole-3-hexadecanol, 4-methoxy- | C25H41NO2 | 387.59854 | | |
| 479 | 651331-37-2 | 1H-Indole-3-octadecanol, 4-methoxy- | C27H45NO2 | 415.6517 | | |
| 480 | 651331-38-3 | 1H-Indole-3-dodecanol, 6-methoxy- | C21H33NO2 | 331.49222 | | |
| 481 | 651331-39-4 | 1H-Indole-3-tetradecanol, 6-methoxy- | C23H37NO2 | 359.54538 | | |
| 482 | 651331-40-7 | 1H-Indole-3-hexadecanol, 6-methoxy- | C25H41NO2 | 387.59854 | | |
| 483 | 651331-41-8 | 1H-Indole-2-tetradecanol, 5-methoxy- | C23H37NO2 | 359.54538 | | |
| 484 | 651331-42-9 | 1H-Indole-2-hexadecanol, 5-methoxy- | C25H41NO2 | 387.59854 | | |
| 485 | 651331-43-0 | 1H-Indole-2-tetradecanol, 4-methoxy- | C23H37NO2 | 359.54538 | | |
| 486 | 651331-44-1 | 1H-Indole-2-hexadecanol, 4-methoxy- | C25H41NO2 | 387.59854 | | |
| 487 | 651331-45-2 | 1H-Indole-2-tetradecanol, 7-methoxy- | C23H37NO2 | 359.54538 | | |
| 488 | 651331-46-3 | 1H-Indole-2-hexadecanol, 7-methoxy- | C25H41NO2 | 387.59854 | | |
| 489 | 651331-47-4 | 2-Propenoic acid, 2-azido-3-(3-methoxyphenyl)-, methyl ester | C11H11N3O3 | 233.22334 | | |
| 490 | 651331-49-6 | 1H-Indole-3-carboxaldehyde, 4-methoxy-1-[(4-methoxyphenyl)sulfonyl]- | C17H15NO5S | 345.3697 | | |
| 491 | 651331-50-9 | 1H-Indole-3-carboxaldehyde, 5-methoxy-1-[(4-methoxyphenyl)sulfonyl]- | C17H15NO5S | 345.37 | | |
| 492 | 651331-51-0 | 1H-Indole-3-carboxaldehyde, 6-methoxy-1-[(4-methoxyphenyl)sulfonyl]- | C17H15NO5S | 345.3697 | | |
| 493 | 651331-65-6 | 1H-Indole-3-decanol, 4-methoxy-1-[(4-methoxyphenyl)sulfonyl]- | C26H35NO5S | 473.6248 | | |
| 494 | 651331-66-7 | 1H-Indole-3-decanol, 5-methoxy-1-[(4-methoxyphenyl)sulfonyl]- | C26H35NO5S | 473.6248 | | |
| 495 | 651331-67-8 | 1H-Indole-3-decanol, 6-methoxy-1-[(4-methoxyphenyl)sulfonyl]- | C26H35NO5S | 473.6248 | | |
| 496 | 651331-68-9 | 1H-Indole-3-dodecanol, 4-methoxy-1-[(4-methoxyphenyl)sulfonyl]- | C28H39NO5S | 501.67796 | | |
| 497 | 651331-69-0 | 1H-Indole-3-tetradecanol, 4-methoxy-1-[(4-methoxyphenyl)sulfonyl]- | C30H43NO5S | 529.73112 | | |
| 498 | 651331-70-3 | 1H-Indole-3-hexadecanol, 4-methoxy-1-[(4-methoxyphenyl)sulfonyl]- | C32H47NO5S | 557.78428 | | |
| 499 | 651331-71-4 | 1H-Indole-3-octadecanol, 4-methoxy-1-[(4-methoxyphenyl)sulfonyl]- | C34H51NO5S | 585.83744 | | |
| 500 | 651331-72-5 | 1H-Indole-3-dodecanol, 5-methoxy-1-[(4-methoxyphenyl)sulfonyl]- | C28H39NO5S | 501.67796 | | |
| 501 | 651331-73-6 | 1H-Indole-3-tetradecanol, 5-methoxy-1-[(4-methoxyphenyl)sulfonyl]- | C30H43NO5S | 529.73112 | | |
| 502 | 651331-74-7 | 1H-Indole-3-hexadecanol, 5-methoxy-1-[(4-methoxyphenyl)sulfonyl]- | C32H47NO5S | 557.78428 | | |
| 503 | 651331-75-8 | 1H-Indole-3-octadecanol, 5-methoxy-1-[(4-methoxyphenyl)sulfonyl]- | C34H51NO5S | 585.83744 | | |
| 504 | 651331-76-9 | 1H-Indole-3-dodecanol, 6-methoxy-1-[(4-methoxyphenyl)sulfonyl]- | C28H39NO5S | 501.67796 | | |
| 505 | 651331-83-8 | Phosphonium, triphenyl[9-(phenylmethoxy)nonyl]-, bromide | C34H40BrOP | 575.558561 | | |
| 506 | 651331-87-2 | Benzoic acid, 2-hydroxy-4-(2,2,3,3,3-pentafluoropropoxy)-, methyl ester | C11H9F5O4 | 300.18 | | |
| 507 | 651331-88-3 | Benzoic acid, 2-hydroxy-4-(2,2,2-trifluoroethoxy)-, methyl ester | C10H9F3O4 | 250.1712696 | | |
| 508 | 651331-89-4 | Benzoic acid, 2-hydroxy-4-(2,2,3,3-tetrafluoropropoxy)-, methyl ester | C11H10F4O4 | 282.19 | | |
| 509 | 651331-90-7 | Benzoic acid, 4-(2-fluoroethoxy)-2-hydroxy-, methyl ester | C10H11FO4 | 214.1903432 | | |
| 510 | 651331-91-8 | Benzoic acid, 4-(2,2-difluoroethoxy)-2-hydroxy-, methyl ester | C10H10F2O4 | 232.1808064 | | |
| 511 | 651331-92-9 | Benzoic acid, 2-hydroxy-4-(2,2,3,3,3-pentafluoropropoxy)- | C10H7F5O4 | 286.152196 | | |
| 512 | 651331-93-0 | Benzoic acid, 2-hydroxy-4-(2,2,2-trifluoroethoxy)- | C9H7F3O4 | 236.1446896 | | |
| 513 | 651331-94-1 | Benzoic acid, 2-hydroxy-4-(2,2,3,3-tetrafluoropropoxy)- | C10H8F4O4 | 268.1617328 | | |
| 514 | 651331-95-2 | Benzoic acid, 4-(2-fluoroethoxy)-2-hydroxy- (9CI) | C9H9FO4 | 200.1637632 | | |
| 515 | 651331-96-3 | Benzoic acid, 4-(2,2-difluoroethoxy)-2-hydroxy- | C9H8F2O4 | 218.1542264 | | |
| 516 | 651331-97-4 | Benzoic acid, 2-(acetyloxy)-4-(2,2,3,3,3-pentafluoropropoxy)- | C12H9F5O5 | 328.188876 | | |
| 517 | 651331-98-5 | Benzoic acid, 2-(acetyloxy)-4-(2-fluoroethoxy)- | C11H11FO5 | 242.2004432 | | |
| 518 | 651332-01-3 | 4-Heptenal, 7-methoxy-4-methyl- | C9H16O2 | 156.22214 | | |
| 519 | 651332-02-4 | Benzene, (1-chloro-7-methoxy-4-methyl-4-heptenyl)- | C15H21ClO | 252.77964 | | |
| 520 | 651332-03-5 | 4-Hepten-1-ol, 7-methoxy-4-methyl- | C9H18O2 | 158.23802 | | |
| 521 | 651332-04-6 | 4-Heptenoic acid, 7-methoxy-4-methyl-, ethyl ester | C11H20O3 | 200.2747 | | |
| 522 | 651332-13-7 | Benzene, (1-chloro-4-methyl-4-hexenyl)- | C13H17Cl | 208.72708 | | |
| 523 | 651332-14-8 | Benzene, 1-(1-chloro-7-methoxy-4-methyl-4-heptenyl)-4-methoxy- | C16H23ClO2 | 282.80562 | | |
| 524 | 651332-15-9 | Benzene, 1-(1-chloro-7-methoxy-4-methyl-4-heptenyl)-4-methyl- | C16H23ClO | 266.80622 | | |
| 525 | 651332-16-0 | Benzene, 1-bromo-3-(1-chloro-7-methoxy-4-methyl-4-heptenyl)- | C15H20BrClO | 331.6757 | | |
| 526 | 651332-17-1 | Benzene, 1-(1-chloro-4-methyl-4-hexenyl)-4-methoxy- | C14H19ClO | 238.75306 | | |
| 527 | 651332-18-2 | Benzene, 1-(1-chloro-4-methyl-4-hexenyl)-4-methyl- | C14H19Cl | 222.75366 | | |
| 528 | 651332-19-3 | Benzene, 1-bromo-3-(1-chloro-4-methyl-4-hexenyl)- | C13H16BrCl | 287.62314 | | |
| 529 | 651332-39-7 | Phosphonium, tetrabutyl-, 1,1,2,2,3,3,4,4-octafluorohexanedioate (2:1) | C22H36F8O4P- | 547.49 | | |
| 530 | 651332-47-7 | 4-(((5-Acetoxy-4-(acetoxymethyl)-2-methylpentan-2-yl)diphenylsilyl)oxy)-4-oxobutanoic acid | C27H34O8Si | 514.64 | | |
| 531 | 651334-60-0 | 1H-Indole, 6-chloro-3-(phenylsulfonyl)-1-(4-piperidinylmethyl)- | C20H21ClN2O2S | 388.91094 | | |
| 532 | 651334-62-2 | 1H-Indole, 6-fluoro-3-(phenylsulfonyl)-1-(4-piperidinylmethyl)- | C20H21FN2O2S | 372.4563432 | | |
| 533 | 651334-64-4 | 1H-Indole, 5-chloro-3-(phenylsulfonyl)-1-(4-piperidinylmethyl)- | C20H21ClN2O2S | 388.91094 | | |
| 534 | 651334-66-6 | 1H-Indole, 6-methoxy-3-(phenylsulfonyl)-1-(4-piperidinylmethyl)- | C21H24N2O3S | 384.49186 | | |
| 535 | 651334-68-8 | 1H-Indole, 6-methyl-3-(phenylsulfonyl)-1-(4-piperidinylmethyl)- | C21H24N2O2S | 368.49246 | | |
| 536 | 651334-70-2 | 1H-Indole, 3-[(4-methylphenyl)sulfonyl]-1-(4-piperidinylmethyl)- | C21H24N2O2S | 368.49246 | | |
| 537 | 651334-72-4 | 1H-Indole, 6-bromo-3-(phenylsulfonyl)-1-(4-piperidinylmethyl)- | C20H21BrN2O2S | 433.36194 | | |
| 538 | 651334-74-6 | 1H-Indole, 4-chloro-3-(phenylsulfonyl)-1-(4-piperidinylmethyl)- | C20H21ClN2O2S | 388.91094 | | |
| 539 | 651334-76-8 | 1H-Indole, 7-methoxy-3-(phenylsulfonyl)-1-(4-piperidinylmethyl)- | C21H24N2O3S | 384.49186 | | |
| 540 | 651334-78-0 | 1H-Indol-6-ol, 3-(phenylsulfonyl)-1-(4-piperidinylmethyl)- | C20H22N2O3S | 370.46528 | | |
| 541 | 651334-80-4 | 1H-Indole, 6-chloro-3-[(4-fluorophenyl)sulfonyl]-1-(4-piperidinylmethyl)- | C20H20ClFN2O2S | 406.9014032 | | |
| 542 | 651334-82-6 | 1H-Indole, 6-fluoro-3-[(3-fluorophenyl)sulfonyl]-1-(4-piperidinylmethyl)- | C20H20F2N2O2S | 390.4468064 | | |
| 543 | 651334-84-8 | 1H-Indole, 5-chloro-3-[(3-chlorophenyl)sulfonyl]-1-(4-piperidinylmethyl)- | C20H20Cl2N2O2S | 423.356 | | |
| 544 | 651334-86-0 | 1H-Indole, 3-[(2-chlorophenyl)sulfonyl]-6-fluoro-1-(4-piperidinylmethyl)- | C20H20ClFN2O2S | 406.9014032 | | |
| 545 | 651334-90-6 | 1H-Indole, 3-[(4-methylphenyl)sulfonyl]-1-(3-piperidinylmethyl)- | C21H24N2O2S | 368.49246 | | |
| 546 | 651334-92-8 | 1H-Indole, 6-bromo-3-(phenylsulfonyl)-1-(3-piperidinylmethyl)- | C20H21BrN2O2S | 433.36 | | |
| 547 | 651334-94-0 | 1H-Indole, 4-chloro-3-(phenylsulfonyl)-1-(3-piperidinylmethyl)- | C20H21ClN2O2S | 388.91094 | | |
| 548 | 651334-96-2 | 1H-Indole, 7-methoxy-3-(phenylsulfonyl)-1-(3-piperidinylmethyl)- | C21H24N2O3S | 384.49186 | | |
| 549 | 651334-98-4 | 1H-Indol-6-ol, 3-(phenylsulfonyl)-1-(3-piperidinylmethyl)- | C20H22N2O3S | 370.46528 | | |
| 550 | 651335-00-1 | 1H-Indole, 6-chloro-3-[(4-fluorophenyl)sulfonyl]-1-(2-piperidinylmethyl)- | C20H20ClFN2O2S | 406.9014032 | | |
| 551 | 651335-02-3 | 1H-Indole, 6-fluoro-3-[(3-fluorophenyl)sulfonyl]-1-(2-piperidinylmethyl)- | C20H20F2N2O2S | 390.4468064 | | |
| 552 | 651335-04-5 | 1H-Indole, 5-chloro-3-[(3-chlorophenyl)sulfonyl]-1-(2-piperidinylmethyl)- | C20H20Cl2N2O2S | 423.356 | | |
| 553 | 651335-06-7 | 1H-Indole, 3-[(2-chlorophenyl)sulfonyl]-6-fluoro-1-(2-piperidinylmethyl)- | C20H20ClFN2O2S | 406.9014032 | | |
| 554 | 651335-10-3 | 1H-Indole, 3-(phenylsulfonyl)-1-(4-piperidinylmethyl)- | C20H22N2O2S | 354.46588 | | |
| 555 | 651335-12-5 | 1H-Indole, 3-(phenylsulfonyl)-1-(3-piperidinylmethyl)- | C20H22N2O2S | 354.46588 | | |
| 556 | 651335-14-7 | 1H-Indole, 3-(phenylsulfonyl)-1-(2-piperidinylmethyl)- | C20H22N2O2S | 354.46588 | | |
| 557 | 651335-16-9 | 1H-Indole, 3-(phenylsulfonyl)-1-(3-pyrrolidinylmethyl)- | C19H20N2O2S | 340.4393 | | |
| 558 | 651335-18-1 | 1H-Indole, 3-(phenylsulfonyl)-1-(2-pyrrolidinylmethyl)- | C19H20N2O2S | 340.4393 | | |
| 559 | 651335-21-6 | 1H-Indole, 6-methyl-3-(phenylsulfonyl)-1-(3-pyrrolidinylmethyl)- | C20H22N2O2S | 354.46588 | | |
| 560 | 651335-23-8 | 1H-Indole, 3-[(4-methylphenyl)sulfonyl]-1-(3-pyrrolidinylmethyl)- | C20H22N2O2S | 354.46588 | | |
| 561 | 651335-24-9 | 1H-Indole, 6-bromo-3-(phenylsulfonyl)-1-(3-pyrrolidinylmethyl)- | C19H19BrN2O2S | 419.33536 | | |
| 562 | 651335-26-1 | 1H-Indole, 4-chloro-2-methyl-3-(phenylsulfonyl)-1-(2-pyrrolidinylmethyl)- | C20H21ClN2O2S | 388.91094 | | |
| 563 | 651335-28-3 | 1H-Indole, 7-methoxy-3-(phenylsulfonyl)-1-(2-pyrrolidinylmethyl)- | C20H22N2O3S | 370.46528 | | |
| 564 | 651335-30-7 | 1H-Indol-6-ol, 3-(phenylsulfonyl)-1-(2-pyrrolidinylmethyl)- | C19H20N2O3S | 356.4387 | | |
| 565 | 651335-32-9 | 1H-Indole, 1-(2-piperidinylmethyl)-3-(2-pyridinylsulfonyl)- | C19H21N3O2S | 355.45394 | | |
| 566 | 651335-34-1 | 1H-Indole, 1-(3-piperidinylmethyl)-3-(2-pyridinylsulfonyl)- | C19H21N3O2S | 355.45394 | | |
| 567 | 651335-36-3 | 1H-Indole, 3-(2-pyridinylsulfonyl)-1-(3-pyrrolidinylmethyl)- | C18H19N3O2S | 341.42736 | | |
| 568 | 651335-38-5 | 1H-Indole, 3-(2-pyridinylsulfonyl)-1-(2-pyrrolidinylmethyl)- | C18H19N3O2S | 341.42736 | | |
| 569 | 651335-40-9 | 1H-Indole, 1-(4-piperidinylmethyl)-3-(2-thienylsulfonyl)- | C18H20N2O2S2 | 360.4936 | | |
| 570 | 651335-42-1 | 1H-Indole, 1-(3-piperidinylmethyl)-3-(2-thienylsulfonyl)- | C18H20N2O2S2 | 360.4936 | | |
| 571 | 651335-44-3 | 1H-Indole, 1-(2-piperidinylmethyl)-3-(2-thienylsulfonyl)- | C18H20N2O2S2 | 360.4936 | | |
| 572 | 651335-46-5 | 1H-Indole, 1-(3-pyrrolidinylmethyl)-3-(3-thienylsulfonyl)- | C17H18N2O2S2 | 346.46702 | | |
| 573 | 651335-48-7 | 1H-Indole, 1-(2-pyrrolidinylmethyl)-3-(3-thienylsulfonyl)- | C17H18N2O2S2 | 346.46702 | | |
| 574 | 651335-50-1 | 1H-Indole, 3-(phenylsulfonyl)-1-(4-piperidinyl)- | C19H20N2O2S | 340.4393 | | |
| 575 | 651335-52-3 | 1H-Indole, 3-(phenylsulfonyl)-1-(3-piperidinyl)- | C19H20N2O2S | 340.4393 | | |
| 576 | 651335-54-5 | 1H-Indole, 3-(phenylsulfonyl)-1-(3-pyrrolidinyl)- | C18H18N2O2S | 326.41272 | | |
| 577 | 651335-56-7 | 1H-Indole, 1-[1-(phenylmethyl)-4-piperidinyl]-3-(phenylsulfonyl)- | C26H26N2O2S | 430.56184 | | |
| 578 | 651335-58-9 | 1H-Indole, 1-[1-(phenylmethyl)-3-piperidinyl]-3-(phenylsulfonyl)- | C26H26N2O2S | 430.56184 | | |
| 579 | 651335-60-3 | 1H-Indole, 1-[1-(phenylmethyl)-3-pyrrolidinyl]-3-(phenylsulfonyl)- | C25H24N2O2S | 416.53526 | | |
| 580 | 651335-62-5 | 1H-Indole, 3-[(3-chlorophenyl)sulfonyl]-1-(4-piperidinyl)- | C19H19ClN2O2S | 374.88436 | | |
| 581 | 651335-64-7 | 1H-Indole, 3-[(4-fluorophenyl)sulfonyl]-1-(3-piperidinyl)- | C19H19FN2O2S | 358.4297632 | | |
| 582 | 651335-66-9 | 1H-Indole, 3-[(2-fluorophenyl)sulfonyl]-1-(3-pyrrolidinyl)- | C18H17FN2O2S | 344.4031832 | | |
| 583 | 651335-68-1 | 1H-Indole, 1-(1-methyl-4-piperidinyl)-3-(phenylsulfonyl)- | C20H22N2O2S | 354.46588 | | |
| 584 | 651335-70-5 | 1H-Indole, 1-(1-ethyl-3-piperidinyl)-3-(phenylsulfonyl)- | C21H24N2O2S | 368.49246 | | |
| 585 | 651335-72-7 | 1H-Indole, 1-[1-(2-phenylethyl)-3-pyrrolidinyl]-3-(phenylsulfonyl)- | C26H26N2O2S | 430.56184 | | |
| 586 | 651335-74-9 | 1H-Indole, 1-(4-piperidinyl)-3-(2-pyridinylsulfonyl)- | C18H19N3O2S | 341.42736 | | |
| 587 | 651335-76-1 | 1H-Indole, 1-(3-piperidinyl)-3-(2-thienylsulfonyl)- | C17H18N2O2S2 | 346.46702 | | |
| 588 | 651335-78-3 | 1H-Indole, 1-(3-pyrrolidinyl)-3-(3-thienylsulfonyl)- | C16H16N2O2S2 | 332.44044 | | |
| 589 | 651335-82-9 | 1H-Indazole, 3-(phenylsulfonyl)-1-[(2S)-2-pyrrolidinylmethyl]- | C18H19N3O2S | 341.43 | | |
| 590 | 651335-84-1 | 1H-Indazole, 6-chloro-3-(phenylsulfonyl)-1-(4-piperidinylmethyl)- | C19H20ClN3O2S | 389.899 | | |
| 591 | 651335-88-5 | 1H-Indazole, 5-chloro-3-(phenylsulfonyl)-1-(4-piperidinylmethyl)- | C19H20ClN3O2S | 389.899 | | |
| 592 | 651335-91-0 | 1H-Indazole, 6-methoxy-3-(phenylsulfonyl)-1-(4-piperidinylmethyl)- | C20H23N3O3S | 385.47992 | | |
| 593 | 651335-93-2 | 1H-Indazole, 6-methyl-3-(phenylsulfonyl)-1-(4-piperidinylmethyl)- | C20H23N3O2S | 369.48052 | | |
| 594 | 651335-95-4 | 1H-Indazole, 3-[(4-methylphenyl)sulfonyl]-1-(3-piperidinylmethyl)- | C20H23N3O2S | 369.48052 | | |
| 595 | 651335-97-6 | 1H-Indazole, 6-bromo-3-(phenylsulfonyl)-1-(3-piperidinylmethyl)- | C19H20BrN3O2S | 434.35 | | |
| 596 | 651335-99-8 | 1H-Indazole, 6-methyl-3-(phenylsulfonyl)-1-(3-pyrrolidinylmethyl)- | C19H21N3O2S | 355.45394 | | |
| 597 | 651336-01-5 | 1H-Indazole, 3-[(4-methylphenyl)sulfonyl]-1-(3-pyrrolidinylmethyl)- | C19H21N3O2S | 355.45394 | | |
| 598 | 651336-03-7 | 1H-Indazole, 3-(2-pyridinylsulfonyl)-1-(2-pyrrolidinylmethyl)- | C17H18N4O2S | 342.41542 | | |
| 599 | 651336-05-9 | 1H-Indazole, 1-(4-piperidinylmethyl)-3-(2-thienylsulfonyl)- | C17H19N3O2S2 | 361.48166 | | |
| 600 | 651336-07-1 | 1H-Indazole, 1-(3-pyrrolidinylmethyl)-3-(3-thienylsulfonyl)- | C16H17N3O2S2 | 347.45508 | | |
| 601 | 651336-08-2 | 1H-Indazole, 1-(2-pyrrolidinylmethyl)-3-(3-thienylsulfonyl)- | C16H17N3O2S2 | 347.46 | | |
| 602 | 651336-09-3 | 1H-Indazole, 3-(phenylsulfonyl)-1-(4-piperidinyl)- | C18H19N3O2S | 341.42736 | | |
| 603 | 651336-11-7 | 1H-Indazole, 3-(phenylsulfonyl)-1-(3-pyrrolidinyl)- | C17H17N3O2S | 327.40078 | | |
| 604 | 651336-13-9 | 1H-Indazole, 1-[1-(phenylmethyl)-4-piperidinyl]-3-(phenylsulfonyl)- | C25H25N3O2S | 431.5499 | | |
| 605 | 651336-15-1 | 1H-Indazole, 1-[1-(phenylmethyl)-3-piperidinyl]-3-(phenylsulfonyl)- | C25H25N3O2S | 431.5499 | | |
| 606 | 651336-17-3 | 1H-Indazole, 1-[1-(phenylmethyl)-3-pyrrolidinyl]-3-(phenylsulfonyl)- | C24H23N3O2S | 417.52332 | | |
| 607 | 651336-19-5 | 1H-Indazole, 3-[(3-chlorophenyl)sulfonyl]-1-(4-piperidinyl)- | C18H18ClN3O2S | 375.87242 | | |
| 608 | 651336-21-9 | 1H-Indazole, 3-[(4-fluorophenyl)sulfonyl]-1-(3-piperidinyl)- | C18H18FN3O2S | 359.4178232 | | |
| 609 | 651336-28-6 | 3-Piperidinamine, 1-(phenylmethyl)-N-[2-[(phenylsulfonyl)methyl]phenyl]- | C25H29N2O2S | 421.57496 | | |
| 610 | 65134-00-1 | (S)-1-[4-(2-Methylbutyl)phenyl]ethanone | C13H18O | 190.28 | | |
| 611 | 65134-38-5 | 2-Propenenitrile, 3-methoxy-3-phenyl-, (Z)- | C10H9NO | 159.18456 | | |
| 612 | 65134-53-4 | 9H-Purine-6-carboxamide,9-b-D-ribofuranosyl- | C11H13N5O5 | 295.25142 | | |
| 613 | 65134-64-7 | L-Phenylalanine, N-(3-mercapto-1-oxopropyl)- | C12H15NO3S | 253.32 | | |
| 614 | 65134-65-8 | L-Leucine, N-(3-mercapto-1-oxopropyl)- | C9H17NO3S | 219.3 | | |
| 615 | 65134-66-9 | L-Alanine, N-(3-mercapto-1-oxopropyl)- | C6H11NO3S | 177.22 | | |
| 616 | 65134-67-0 | L-Aspartic acid, N-(3-mercapto-1-oxopropyl)- | C7H11NO5S | 221.23 | | |
| 617 | 65134-74-9 | [S-(R*,R*)]-3,3'-Dithiobis[2-methylpropanoic acid] | C8H14O4S2 | 238.32 | | |
| 618 | 651340-03-3 | Benzene, 5-(bromomethyl)-1-methoxy-2,3-bis(phenylmethoxy)- | C22H21BrO3 | 413.30434 | | |
| 619 | 651340-08-8 | Benzene, 5-(bromomethyl)-1,2-dimethoxy-3-(phenylmethoxy)- | C16H17BrO3 | 337.21 | | |
| 620 | 651340-95-3 | Morpholine, 2,6-diiodo-4-(phenylsulfonyl)- | C10H11I2NO3S | 479.07 | | |
| 621 | 651341-51-4 | Pyrrolidine, 3-ethoxy-, (3R)- | C6H13NO | 115.17 | | |
| 622 | 651341-54-7 | (R)-3-Methoxy-piperidine | C6H13NO | 115.17352 | | |
| 623 | 651341-56-9 | Pyrrolidine, 3-[(triethylsilyl)oxy]-, (3R)- | C10H23NOSi | 201.38 | | |
| 624 | 651341-62-7 | Pyridine, 2-fluoro-4-(triethylstannyl)- | C11H18FNSn | 301.9757232 | | |
| 625 | 651341-64-9 | Pyridine, 2-fluoro-3-(triethylstannyl)- | C11H18FNSn | 301.9757232 | | |
| 626 | 651341-66-1 | Isoxazole, 5-cyclopropyl-4-(triethylstannyl)- | C12H21NOSn | 314.01124 | | |
| 627 | 651341-68-3 | Benzoic acid, 2-broMo-4-fluoro-, ethyl ester | C9H8BrFO2 | 247.062 | | |
| 628 | 651348-84-4 | Benzo[b]thiophene, 2-(5'-hexyl[2,2'-bithiophen]-5-yl)- | C22H22S3 | 382.60508 | | |
| 629 | 651349-93-8 | 1H-Imidazolium, 1,3-dihexadecyl-, iodide | C35H69IN2 | 644.84023 | | |
| 630 | 65135-24-2 | Haloperidol Lauroate | C33H45ClFNO3 | 558.17 | | |
| 631 | 65135-27-5 | (R)-N-(2,4-dihydroxy-3,3-dimethylbutyryl)-beta-alanine, magnesium salt | C18H32MgN2O10 | 460.75908 | | |
| 632 | 651351-89-2 | 1,2,6-Piperidinetricarboxylic acid, 2,6-diethyl-, 1-(1,1-dimethylethyl) 2,6-dimethyl ester, (2R,6S)-rel- | C18H31NO6 | 357.44 | | |
| 633 | 651353-38-7 | Magnesium, (methanol)- (9CI) | CH4MgO | 56.35 | | |
| 634 | 651354-28-8 | 1H-Imidazole, 2-(2-cyclohexylethyl)-4-(3-nitrophenyl)- | C17H21N3O2 | 299.36754 | | |
| 635 | 651354-29-9 | Benzenamine, 3-[2-(2-cyclohexylethyl)-1H-imidazol-4-yl]- | C17H23N3 | 269.38462 | | |
| 636 | 651354-47-1 | 2-Thiophenecarboximidamide, N-[3-(2-hexyl-1H-imidazol-4-yl)phenyl]- | C20H24N4S | 352.49636 | | |
| 637 | 651354-48-2 | Guanidine, N-[4-[2-(2-cyclohexylethyl)-1H-imidazol-4-yl]phenyl]-N'-nitro- | C18H24N6O2 | 356.42216 | | |
| 638 | 651354-52-8 | L-Glutamine, L-arginyl-L-valyl- | C16H31N7O5 | 401.46 | | |
| 639 | 651354-53-9 | L-Asparagine, L-methionyl-L-leucyl- | C15H28N4O5S | 376.47 | | |
| 640 | 651354-56-2 | Pyrimidine, 5-(diethoxymethyl)-2-[(trimethylsilyl)ethynyl]- | C14H22N2O2Si | 278.42218 | | |
| 641 | 651354-58-4 | 5-Pyrimidinemethanol, 2-[(trimethylsilyl)ethynyl]- | C10H14N2OSi | 206.31646 | | |
| 642 | 651354-67-5 | 9,13-Dioxa-2,5,17,20-tetraazaheneicosanedioic acid, 11-(12,12-dimethyl-5,10-dioxo-2,11-dioxa-6,9-diazatridec-1-yl)-6,16-dioxo-11-[[(phenylmethoxy)carbonyl]amino]-, 1,21-bis(1,1-dimethylethyl) ester | C42H71N7O14 | 898.05164 | | |
| 643 | 651354-72-2 | 11-Oxa-2,6,9-triazatridecanoic acid, 12,12-dimethyl-5,10-dioxo-, phenylmethyl ester (9CI) | C18H27N3O5 | 365.42 | | |
| 644 | 651354-84-6 | Propanenitrile, 3,3'-[(2-amino-1,3-propanediyl)bis(oxy)]bis- | C9H15N3O2 | 197.2343 | | |
| 645 | 651355-06-5 | Ketone, 4-chloro-3-methyl-5-isoxazolyl methyl (5CI) | C6H6ClNO2 | 159.57034 | | |
| 646 | 651355-11-2 | Ketone, 4-chloro-5-methyl-3-isoxazolyl methyl (5CI) | C6H6ClNO2 | 159.57034 | | |
| 647 | 651355-19-0 | L-Phenylalanine, L-phenylalanyl-L-alanyl-L-alanyl-L-threonyl- (9CI) | C28H37N5O7 | 555.62 | | |
| 648 | 651356-10-4 | L-Proline, glycyl-L-valyl-L-arginylglycyl- (9CI) | C20H36N8O6 | 484.55 | | |
| 649 | 651356-13-7 | L-Arginine, N-[(hexahydro-3-pyridazinyl)acetyl]glycyl-L-valyl- (9CI) | C19H36N8O5 | 456.54 | | |
| 650 | 651356-93-3 | Aluminum calcium hydroxide sulfate | Al3Ca3H5O25S5 | 766.528314 | | |
| 651 | 651357-03-8 | L-Arginine, L-glutaminyl-L-seryl-L-leucyl-L-phenylalanyl- (9CI) | C29H47N9O8 | 649.74 | | |
| 652 | 651357-12-9 | L-Arginine, L-alanyl-L-isoleucyl-L-prolyl-L-valyl-L-seryl- (9CI) | C28H51N9O8 | 641.76 | | |
| 653 | 651358-16-6 | Ketone, chloromethyl 6-methoxy-8-quinolyl (5CI) | C12H10ClNO2 | 235.6663 | | |
| 654 | 651358-38-2 | 2-Propanone, 1-bromo-3-(2-methylphenyl)- | C10H11BrO | 227.09774 | | |
| 655 | 651358-39-3 | 1-bromo-3-(2-chlorophenyl)propan-2-one | C9H8BrClO | 247.52 | | |
| 656 | 651358-40-6 | 1-bromo-3-(2,4-dichlorophenyl)propan-2-one | C9H7BrCl2O | 281.96 | | |
| 657 | 651358-41-7 | 1-broMo-3-(3,4-dichlorophenyl)propan-2-one | C9H7BrCl2O | 281.96 | | |
| 658 | 651358-42-8 | 2-Propanone, 1-bromo-3-(3,4,5-trimethoxyphenyl)- | C12H15BrO4 | 303.1491 | | |
| 659 | 651358-59-7 | Propanamide, N-[4-chloro-6-[(2,5-dimethoxyphenyl)methyl]-7H-pyrrolo[2,3-d]pyrimidin-2-yl]-2,2-dimethyl- | C20H23ClN4O3 | 402.87 | | |
| 660 | 651358-63-3 | 1H-Pyrrolo[2,3-d]pyrimidin-2-amine, 4-chloro-6-(phenylmethyl)- | C13H11ClN4 | 258.70624 | | |
| 661 | 651358-67-7 | 1H-Pyrrolo[2,3-d]pyrimidin-2-amine, 4-chloro-6-(1-naphthalenylmethyl)- | C17H13ClN4 | 308.76492 | | |
| 662 | 651358-83-7 | 6-Bromopyridine-2-boronic acid pinacol ester | C11H15BBrNO2 | 283.96 | 125-127℃ | |
| 663 | 651358-93-9 | 1-(4-BroMocyclohex-3-en-1-yl)ethanone | C8H11BrO | 203.07634 | | |
| 664 | 651359-34-1 | 2,4-Pyrimidinediamine, 5-[(2-chlorophenyl)methoxy]- | C11H11ClN4O | 250.68424 | | |
| 665 | 651359-35-2 | 2,4-Pyrimidinediamine, 5-[(4-methoxyphenyl)methoxy]- | C12H14N4O2 | 246.26516 | | |
| 666 | 651359-36-3 | 2,4-Pyrimidinediamine, 5-[(4-bromo-1-naphthalenyl)methoxy]- | C15H13BrN4O | 345.19392 | | |
| 667 | 651359-37-4 | 2,4-Pyrimidinediamine, 5-[[4-(1,1-dimethylethyl)phenyl]methoxy]- | C15H20N4O | 272.3455 | | |
| 668 | 651359-42-1 | 2,4-Pyrimidinediamine, 6-methyl-5-(phenylmethoxy)- | C12H14N4O | 230.26576 | | |
| 669 | 651359-43-2 | 2,4-Pyrimidinediamine, 5-[(3,4-dichlorophenyl)methoxy]-6-methyl- | C12H12Cl2N4O | 299.15588 | | |
| 670 | 651359-44-3 | 2,4-Pyrimidinediamine, 5-[(phenylamino)methyl]- | C11H13N5 | 215.25442 | | |
| 671 | 651359-45-4 | 2,4-Pyrimidinediamine, 5-[(2-naphthalenylthio)methyl]- | C15H14N4S | 282.36346 | | |
| 672 | 651359-51-2 | Benzene, 4-(bromomethyl)-2-methoxy-1-(3-phenylpropoxy)- | C17H19BrO2 | 335.23556 | | |
| 673 | 651359-52-3 | 1H-Isoindole-1,3(2H)-dione, 2-[3-[4-(bromomethyl)phenoxy]propyl]- | C18H16BrNO3 | 374.22854 | | |
| 674 | 651359-53-4 | 1H-Isoindole-1,3(2H)-dione, 2-[3-(4-methylphenoxy)propyl]- | C18H17NO3 | 295.33248 | | |
| 675 | 651359-54-5 | Benzenesulfonamide, N-[3-[4-(bromomethyl)phenoxy]propyl]-4-methyl- | C17H20BrNO3S | 398.3146 | | |
| 676 | 651359-60-3 | 2-Pyrimidinamine, 4-chloro-6-methyl-5-(2-phenylethyl)- | C13H14ClN3 | 247.72336 | | |
| 677 | 651359-62-5 | 5-Pyrimidinol,2,4-diamino-6-methyl-,monohydrochloride(9CI) | C5H8N4O.ClH | | | |
| 678 | 65136-45-0 | N-methyl-2-ethylindole | C11H13N | 159.23 | | |
| 679 | 65136-46-1 | 1H-Indole,1-methyl-2-(1-methylethyl)-(9CI) | C12H15N | 173.2542 | | |
| 680 | 65136-51-8 | Benzoic acid, 4-(2-chloroethoxy)- | C9H9ClO3 | 200.61896 | | |
| 681 | 65136-52-9 | 4-Chloro-3-propoxybenzoic acid | C10H11ClO3 | 214.64554 | | |
| 682 | 65136-84-7 | Spiro[bicyclo[2.2.1]heptane-2,2'-[1,3]dioxolane], 4'-(chloromethyl)-1,7,7-trimethyl- | C13H21ClO2 | 244.76 | | |
| 683 | 65136-85-8 | 1,3-Dioxolane, 2,4-bis(chloromethyl)-2-phenyl- | C11H12Cl2O2 | 247.11778 | | |
| 684 | 65136-87-0 | N-(2-aminoethyl)-4-methoxybenzamide | C10H14N2O2 | 194.23 | | |
| 685 | 65136-96-1 | Hopane-6α,7β,22-triol | C30H52O3 | 460.73208 | | |
| 686 | 65137-03-3 | tetrakis(pentane-2,4-dionato-O,O')uranium | C20H28O8U | 634.46 | | |
| 687 | 65137-06-6 | Tetrakis(pentane-2,4-dionato)thorium | C20H28O8Th | 628.46962 | | |
| 688 | 65137-45-3 | Phenol, 2-methyl-5-(1,2,2-trimethylcyclopentyl)- | C15H22O | 218.33 | | |
| 689 | 65137-60-2 | [(2R)-5-oxo-2-pyrrolidinyl]acetic acid | C6H9NO3 | 143.14 | | |
| 690 | 65137-72-6 | Titanium, trihydroxy(octadecanoato-O)-, (T-4)-, homopolymer | (C18H38O5Ti)x | | | |
| 691 | 65137-78-2 | NSC523247 | C21H32O3 | 332.47698 | | |
| 692 | 65138-05-8 | (S)-benzyl 2-hydroxy-3-methylbutanoate | C12H16O3 | 208.25 | | |
| 693 | 65138-24-1 | Benzo[h]quinoline, 4,4'-(2,4-diphenyl-1,3-cyclobutanediyl)bis-, (1α,2β,3α,4β)- (9CI) | C42H30N2 | 562.7 | | |
| 694 | 65138-25-2 | Benzo[h]quinoline, 4,4'-(3,4-diphenyl-1,2-cyclobutanediyl)bis-, (1α,2α,3β,4β)- (9CI) | C42H30N2 | 562.7 | | |
| 695 | 65138-27-4 | Benzo[h]quinoline, 4,4'-(3,4-diphenyl-1,2-cyclobutanediyl)bis-, (1α,2β,3β,4α)- (9CI) | C42H30N2 | 562.7 | | |
| 696 | 65138-33-2 | [1-13C]-Cyanoacetic acid | | | | |
| 697 | 65138-34-3 | β-ALANINE 13C | | | | |
| 698 | 65138-44-5 | 2λ5-5H-1,2-Azaphosphole-3,4-dicarboxylic acid, 2,2,5,5-tetraphenyl-, 3,4-dimethyl ester | C31H26NO4P | 507.52 | | |
| 699 | 65138-64-9 | Acetic acid, [[[(5α)-4,5-epoxy-3-methoxy-17-methylmorphinan-6-ylidene]amino]oxy]-, monohydrate | | | | |
| 700 | 65138-66-1 | 9-[2-(ethoxycarbonyl)phenyl]-3,6-bis(ethylamino)-2,7-dimethylxanthylium, salt with 4,5-dihydro-5-oxo-1-(4-sulphophenyl)-4-[(4-sulphophenyl)azo]-1H-pyrazole-3-carboxylic acid (3:1) | C100H102N10O18S2 | 1796.06608 | | |
| 701 | 65138-69-4 | bis[[4-[bis[4-(dimethylamino)phenyl]methylene]cyclohexa-2,5-dien-1-ylidene]dimethylammonium] tetrachlorozincate(2-) | C50H68Cl8N8Zn2 | 1195.53252 | | |
| 702 | 65138-72-9 | N,N,N'-tris(1-methylethyl)benzenediamine | C15H26N2 | 234.38034 | | |
| 703 | 65138-73-0 | ammonium decyl hydrogen phosphate | C10H26NO4P | 255.291501 | | |
| 704 | 65138-74-1 | diammonium decyl phosphate | C10H29N2O4P | 272.322021 | | |
| 705 | 65138-75-2 | diammonium dodecyl phosphate | C12H33N2O4P | 300.375181 | | |
| 706 | 65138-76-3 | ammonium dodecyl hydrogen phosphate | C12H30NO4P | 283.344661 | | |
| 707 | 65138-80-9 | hydrogen [2-(29H,31H-phthalocyaninylcarbonyl)benzoato(3-)-N29,N30,N31,N32]cuprate(1-) | C40H19CuN8O3.H | 724.2 | | |
| 708 | 65138-81-0 | tetrasodium [decachloro-29H,31H-phthalocyaninetetrasulphonato(6-)-N29,N30,N31,N32]cuprate(4-) | C32H2Cl10CuN8O12S4.4Na | | | |
| 709 | 65138-82-1 | tetrasodium [dodecachloro-29H,31H-phthalocyaninetetrasulphonato(6-)-N29,N30,N31,N32]cuprate(4-) | C32Cl12CuN8O12S4.4Na | | | |
| 710 | 65138-83-2 | tetrasodium [undecachloro-29H,31H-phthalocyaninetetrasulphonato(6-)-N29,N30,N31,N32]cuprate(4-) | C32HCl11CuN8O12S4.4Na | | | |
| 711 | 65138-84-3 | bis[bis(2-hydroxyethyl)ammonium] hexadecyl phosphate | C24H57N2O8P | 532.691741 | | |