| 1 | 1675-02-1 | (3R,4S,5S,6R,7R,9R,11R,12R,13R,14R)-4-[(2S,4R,5S,6S)-4,5-dihydroxy-4,6 -dimethyl-oxan-2-yl]oxy-6-[(2S,3R,4S,6R)-4-dimethylamino-3-hydroxy-6-m ethyl-oxan-2-yl]oxy-14-ethyl-7,12,13-trihydroxy-3,5,7,9,11,13-hexameth yl-1-oxacyclotetradecane-2,10-dione | C36H65NO13 | 719.9 | 121-125 °C | |
| 2 | 1675-05-4 | naphthalene-1,5-disulphonic acid, compound with S-[2-(diethylamino)ethyl] diphenyldithiocarbamate (1:2) | C48H56N4O6S6 | 977.37144 | | |
| 3 | 1675-24-7 | 13-Fluoro-2-tridecenoic acid | C13H23FO2 | 230.32 | | |
| 4 | 1675-46-3 | 10-(3-chloropropyl)-2-(trifluoromethyl)-10H-phenothiazine | C16H13ClF3NS | 343.8 | | |
| 5 | 1675-54-3 | BISPHENOL A DIGLYCIDYL ETHER RESIN | C21H24O4 | 340.41 | 40-44°C | Soluble in 100% ethanol, dimethyl sulfoxide (100 mM), dimethyl formamide, chloroform, methanol, and ethanol (50 mM). Insoluble in water. |
| 6 | 1675-57-6 | Benzene,1,1'-(diethynylsilylene)bis- | C16H12Si | 232.35 | | |
| 7 | 1675-58-7 | DIPHENYLGERMANE | C12H12Ge | 228.86 | | |
| 8 | 1675-59-8 | Germane,diethynyldiphenyl- | C16H12Ge | 276.90648 | | |
| 9 | 1675-60-1 | Silane,diethynyldimethyl- | C6H8Si | 108.21 | | |
| 10 | 1675-66-7 | Adelmidrol | C13H26N2O4 | 274.36 | 132-134℃ | |
| 11 | 1675-69-0 | AZELANITRILE | C9H14N2 | 150.22 | -22.01 °C | |
| 12 | 1675-70-3 | Benzonitrile,4,4'-(1-methylethylidene)bis- | C17H14N2 | 246.30646 | | |
| 13 | 1675-71-4 | 2,3,5,6-Tetramethyl-1,4-benzenediacetonitrile | C14H16N2 | 212.29 | | |
| 14 | 1675-95-2 | 6 beta-acetoxyprogesterone | C23H32O4 | 372.5 | | |
| 15 | 16750-06-4 | D-Arabino-hexopyranose, 2-deoxy-, tetraacetate, alpha- | C14H20O9 | 332.3 | | |
| 16 | 16750-07-5 | 2-Deoxy-β-D-arabino-hexopyranose tetraacetate | C14H20O9 | 332.3 | | |
| 17 | 16750-08-6 | β-D-arabino-Hexopyranose, 2-deoxy-, tetrabenzoate | C34H28O9 | 580.58 | | |
| 18 | 16750-19-9 | Streptamine, O-6-amino-6-deoxy-α-D-glucopyranosyl-(1→4)-O-[3,6-diamino-3,6-dideoxy-α-D-glucopyranosyl-(1→6)]-2-deoxy- | C18H37N5O10 | 483.51 | | |
| 19 | 16750-21-3 | D-Glucose, 6-O-β-D-glucopyranuronosyl- | C12H20O12 | 356.28 | | |
| 20 | 16750-33-7 | Methylium, [1,1'-biphenyl]-4,4'-diylbis[diphenyl- (9CI) | C38H28+2 | 484.64 | | |
| 21 | 16750-37-1 | (23S,25S)-5α-Spirostane-3β,6α,23-triol | C27H44O5 | 448.64 | | |
| 22 | 16750-40-6 | 3-AMino-butyronitrile | C4H8N2 | 84.12 | | |
| 23 | 16750-42-8 | Aminophenylacetonitrile | C8H8N2 | 132.16 | 55 °C | |
| 24 | 16750-55-3 | 2-Propen-1-one, 1-(1-methyl-1H-pyrrol-2-yl)-3-phenyl- | C14H13NO | 211.26 | | |
| 25 | 16750-56-4 | 2-Propen-1-one, 3-(1-methyl-1H-pyrrol-2-yl)-1-phenyl- | C14H13NO | 211.26 | | |
| 26 | 16750-63-3 | 2-methoxyphenylmagnesium bromide | C7H7BrMgO | 211.34 | | |
| 27 | 16750-66-6 | Phenol, 4-amino-2-(1-methylethyl)- (9CI) | C9H13NO | 151.21 | | |
| 28 | 16750-67-7 | 4-AMINO-2-BROMOPHENOL | C6H6BrNO | 188.02 | 165 °C(Solv: benzene (71-43-2)) | |
| 29 | 16750-76-8 | 3-Penten-2-one, 3-methyl-, oxime | C6H11NO | 113.16 | | |
| 30 | 16750-82-6 | (S)-3-Methyl-6β-isopropenyl-2-cyclohexene-1-one | C10H14O | 150.22 | | |
| 31 | 16750-85-9 | Bicyclo[3.1.1]hept-2-en-6-one, 2,4,4-trimethyl-, (1R,5S)- | C10H14O | 150.22 | | |
| 32 | 16750-87-1 | Bicyclo[3.2.0]hept-3-en-6-one, 4,7,7-trimethyl-, (1R,5R)- | C10H14O | 150.22 | | |
| 33 | 16750-88-2 | (Z)-3,7-Dimethyl-3,6-octadienoic acid methyl ester | C11H18O2 | 182.26 | | |
| 34 | 16750-94-0 | isogeraniol,trans-isogeraniol | C10H18O | 154.25 | | |
| 35 | 16750-99-5 | Geranyl monophosphate lithium salt | C10H19O4P | 234.23 | | |
| 36 | 167501-37-3 | 3-AMINO-2-CYANO-N-METHYL-3-MORPHOLINO-2-PROPENETHIOAMIDE | C9H14N4OS | 226.3 | | |
| 37 | 167502-57-0 | 2-Aziridinemethanol, 3-methyl-1-(triphenylmethyl)-, (2S,3S)- | C23H23NO | 329.43 | 112-113 °C | |
| 38 | 167503-64-2 | β-D-Glucopyranoside, 1H-naphtho[2,3-c]pyran-5,10-diyl bis- | C25H30O13 | 538.5 | | |
| 39 | 167504-49-6 | 1,2-Benzenediol,5-(hydroxymethyl)-3-(3-methyl-2-butenyl)-(9CI) | C12H16O3 | 208.25 | | |
| 40 | 167504-53-2 | Cyclohexanamine,2-[[4-(2-benzoxazolyl)phenyl]methoxy]-, monohydrochloride, (1R,2R)-rel- (9CI) | C20H23ClN2O2 | 358.87 | | |
| 41 | 167504-55-4 | 2-Propenamide,N-methyl-3-(methylsulfinyl)-, (2E)- | C5H9NO2S | 147.19546 | | |
| 42 | 167504-56-5 | 2-Propenamide, N-methyl-3-(methylsulfinyl)-, (2Z)- | C5H9NO2S | 147.2 | | |
| 43 | 167504-57-6 | 4,7,8-trimethoxy-2-oxo-1H-quinoline-3-carbaldehyde | C13H13NO5 | 263.25 | | |
| 44 | 16751-02-3 | Neryl Diphosphate | C10H20O7P2 | 314.21 | | |
| 45 | 16751-28-3 | TETRAPOLYPHOSPHATE HEXAAMMONIUM) | | | | |
| 46 | 16751-37-4 | 2,3,5-Tri-O-acetyl-D-arabinonic acid, gamma-lactone, Min. 98% | | | | |
| 47 | 16751-42-1 | 2,4(1H,3H)-Pyrimidinedione,silver(1+) salt (1:1) | C4H4AgN2O2 | 219.95496 | | |
| 48 | 16751-55-6 | Phenylmercuric thiocyanate | C7H5HgNS | 335.7763 | | |
| 49 | 16751-58-9 | 3-AMINOHEXANE | C6H15N | 101.19 | -40.7°C (estimate) | |
| 50 | 16751-59-0 | 4-HEPTYLAMINE | C7H17N | 115.22 | -19°C (estimate) | |
| 51 | 1675109-67-7 | 2-Pyridinamine, N-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)- | C12H19BN2O2 | 234.1 | | |
| 52 | 1675178-56-9 | 5-Naphthyl-beta-MethylaMinocarbony-2'-O-Methyl-uridine | C22H23N3O7 | 441.43 | | |
| 53 | 1675199-95-7 | 4-Chloro-6-fluoro-5-methoxy-nicotinic acid | C7H5ClFNO3 | 205.57 | | |
| 54 | 16752-16-2 | 4-amino-2,6-dimethylbenzoic acid | C9H11NO2 | 165.18914 | 196-198 °C | |
| 55 | 16752-19-5 | 4-Amino-2,6-dibromobenzoic acid | C7H5Br2NO2 | 294.93 | | |
| 56 | 16752-54-8 | CP 88440 | C4H8N2 | 84.12 | | |
| 57 | 16752-60-6 | Phosphorus pentoxide (dimer) | O10P4 | | | |
| 58 | 16752-60-6 | TETRAPHOSPHORUSDECAOXIDE | O10P4 | 283.89 | | |
| 59 | 16752-71-9 | Thymidine 5'-(trihydrogen diphosphate) P'-(6-deoxy-alpha-D-xylo-hexopyranos-4-ulos-1-yl) ester | C16H24N2O15P2 | 546.31 | | |
| 60 | 16752-77-5 | Methomyl | C5H10N2O2S | 162.21 | 78°C | Soluble. 5.8 g/100 mL |
| 61 | 16752-89-9 | 1H-Benzimidazol-5-amine, 2,2'-(1,3-phenylene)bis- | C20H16N6 | 340.38 | | |
| 62 | 16752-90-2 | 5-(1H-benzimidazol-2-yl)benzene-1,3-diamine | C13H12N4 | 224.26118 | | |
| 63 | 1675201-13-4 | Sitagliptin impurity C | C16H12F6N4O | 390.28 | | |
| 64 | 1675201-14-5 | Sitagliptin IMpurity | C16H12F6N4O | 390.28 | 113-115°C | |
| 65 | 1675201-16-7 | 3-Desamino Acetoxy Sitagliptin | C18H16F6N4O3 | 450.34 | | |
| 66 | 1675201-83-8 | PD1-PDL1 inhibitor 1 | C29H33NO5 | 475.576 | | |
| 67 | 1675201-90-7 | BMS-8 | C27H28BrNO3 | 494.42 | | |
| 68 | 1675201-97-4 | (Rac)-BMS-1 | | | | |
| 69 | 1675202-20-6 | Acetamide, N-[2-[[[2,6-dimethoxy-4-[(2-methyl[1,1'-biphenyl]-3-yl)methoxy]phenyl]methyl]amino]ethyl]- | C27H32N2O4 | 448.55 | | |
| 70 | 1675202-86-4 | 2-[[[2,6-Dimethoxy-4-[(2-methyl[1,1′-biphenyl]-3-yl)methoxy]phenyl]methyl]amino]ethanol | C25H29NO4 | 407.5 | | |
| 71 | 1675203-24-3 | BMS-142 | | | | |
| 72 | 1675203-56-1 | 4-(((2,6-dimethoxy-4-((2-methyl-[1,1'-biphenyl]-3-yl)methoxy)benzyl)amino)methyl)azetidin-2-one | C27H30N2O4 | 446.54 | | |
| 73 | 1675203-82-3 | BMS-200 | C27H27F2NO6 | 499.5 | | |
| 74 | 1675203-84-5 | BMS-202 | C25H29N3O3 | 419.52 | | |
| 75 | 1675204-51-9 | BMS-242 | C28H35NO4 | 449.58 | | |
| 76 | 1675205-18-1 | (3-(2,3-dihydrobenzo[b][1,4]dioxin-6-yl)-2-methylphenyl)methanol(WXC05522) | C16H16O3 | 256.3 | | |
| 77 | 1675205-30-7 | 3-Pyridinecarboxaldehyde, 2-methoxy-6-[(2-methyl[1,1'-biphenyl]-3-yl)methoxy]- | C21H19NO3 | 333.38 | | |
| 78 | 1675206-11-7 | 1H-Inden-1-one, 2,3-dihydro-6-methoxy-5-(4-morpholinyl)-2-[[3-(trifluoromethyl)-2-pyridinyl]methyl]- | C21H21F3N2O3 | 406.4 | | |
| 79 | 1675207-05-2 | 5-Bromo-6-methoxy-2-(3-trifluoromethyl-pyridin-2-ylmethylene)-indan-1-one | | | | |
| 80 | 1675207-10-9 | 2-Fluoro-5-(2-methoxyethoxy)phenylboronic acid | C9H12BFO4 | 214 | | |
| 81 | 1675212-57-3 | 1,5-dimethyl-7-nitro-2,3-dihydro-1H-pyrrolo[1,2-a]imidazol-6(5H)-one | | | | |
| 82 | 1675213-48-5 | 1-(1-aminocyclopropyl)ethan-1-one hydrochloride | C5H10ClNO | 135.59 | | |
| 83 | 1675214-76-2 | Niobium metaphosphate oxide (Nb0.67(PO3)1.33O1.01) | H2NbO4P- | 189.89 | | |
| 84 | 1675217-38-5 | [1,1':4',1''-Terphenyl]-4,4''-dicarboxylic acid,2',5'-dimercapto- | C20H14O4S2 | 382.45 | | |
| 85 | 1675217-42-1 | 2-[2-[(5-carboxypentyl)amino]-2-oxoethyl]-2-hydroxybutanedioic Acid | C12H19NO8 | 305.28 | >127°C (dec.) | |
| 86 | 1675221-59-6 | Azilsartan Impurity | C25H22N2O5 | 430.45 | | |
| 87 | 1675225-21-4 | tert-butyl (3R,5R)-3-((tert-butyldimethylsilyl)oxy)-5-hydroxypiperidine-1-carboxylate | C16H33NO4Si | 331.52302 | | |
| 88 | 1675225-85-0 | Crizotinib Impurity 35 | | | | |
| 89 | 1675225-95-2 | 3-((R)-1-(2,5-dichlorophenyl)ethoxy)-5-bromopyridin-2-amine | C13H11BrCl2N2O | 362.04924 | | |
| 90 | 1675230-47-3 | 1-Propanol, 3-[4-(phenylmethoxy)butoxy]- | C14H22O3 | 238.32 | | |
| 91 | 1675238-75-1 | 1675238-75-1 | | | | |
| 92 | 1675239-01-6 | ((Benzyloxy)methyl)boronic acid | C8H11BO3 | 165.98 | | |
| 93 | 1675240-80-8 | Imidazo[1,2-a]pyrazine, 6-bromo-8-(4-fluorophenyl)- | C12H7BrFN3 | 292.11 | | |
| 94 | 1675244-99-1 | Cefazolin Impurity 20 | | | | |
| 95 | 1675245-00-7 | Cefazolin impurity 7/Cefazolin EP Impurity J/2-((2-(1H-tetrazol-1-yl)acetamido)(carboxy)methyl)-5-methylene-5,6-dihydro-2H-1,3-thiazine-4-carboxylic acid | C11H12N6O5S | 340.31 | | |
| 96 | 1675245-06-3 | (Z)-N-[(3S)-2-oxooxolan-3-yl]tetradec-9-enamide | C18H31NO3 | 309.44 | | |
| 97 | 1675245-09-6 | 2(1H)-Pyridinone, 6-[4-(dimethylamino)phenyl]-4-methyl- | C14H16N2O | 228.29 | | |
| 98 | 1675245-47-2 | Cefazolin Impurity 8 | C5H9N5O3 | 187.16 | | |
| 99 | 1675248-18-6 | 1-Piperidinepropanoic acid, 4-methyl-3-(methyl-7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)-β-oxo-, ethyl ester, (3R,4R)- | C18H25N5O3 | 359.43 | | |
| 100 | 1675248-19-7 | 3-((3R,4R)-4-methyl-3-(methyl(7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino)piperidin-1-yl)-3-oxopropanamide | C16H22N6O2 | 330.39 | | |
| 101 | 16753-07-4 | 3-acrylamidopropanoic acid | C6H9NO3 | 143.14 | | |
| 102 | 16753-26-7 | Tris(i-propoxy)dimethylaminotitanium, 97% | C11H27NO3Ti | 269.20398 | | |
| 103 | 16753-33-6 | METHYL PERFLUOROOCTADECANOATE | C19H3F35O2 | 928.17 | 135-138 | |
| 104 | 16753-43-8 | Nsc220305 | C23H35Cl2N3O4 | 488.45 | | |
| 105 | 16753-62-1 | Dimethoxymethylvinylsilane | C5H12O2Si | 132.23 | | 3g/L at 20℃ |
| 106 | 167538-01-4 | N-(4-FLUOROPHENYL)-3,5-DIMETHYL-4-ISOXAZOLECARBOXAMIDE | C12H11FN2O2 | 234.23 | | |
| 107 | 167538-15-0 | 4-Isoxazolecarboxamide,N-ethyl-5-methyl-(9CI) | C7H10N2O2 | 154.17 | | |
| 108 | 167538-17-2 | 4-Isoxazolecarboxamide,5-methyl-N-2-propenyl-(9CI) | C8H10N2O2 | 166.18 | | |
| 109 | 167538-18-3 | 4-Isoxazolecarboxamide,5-methyl-N-2-propynyl-(9CI) | C8H8N2O2 | 164.16 | | |
| 110 | 167538-19-4 | 4-Isoxazolecarboxamide,N-(cyanomethyl)-5-methyl-(9CI) | C7H7N3O2 | 165.15 | | |
| 111 | 167538-23-0 | 4-Isoxazolecarboxamide,N-(2-hydroxyethyl)-5-methyl-(9CI) | C7H10N2O3 | 170.17 | | |
| 112 | 167538-50-3 | 4-Isoxazolecarboxamide,N-1-aziridinyl-5-methyl-(9CI) | C7H9N3O2 | 167.17 | | |
| 113 | 16754-39-5 | Carbamic acid 2-propynyl ester | C4H5NO2 | 99.09 | | |
| 114 | 16754-48-6 | 2-[Di(sec-butoxy)methoxy]butane | C13H28O3 | 232.36 | | |
| 115 | 16754-49-7 | Orthoformic acid triisobutyl ester | | | | |
| 116 | 16754-50-0 | ALLYL ORTHOFORMATE | C10H16O3 | 184.23 | | |
| 117 | 16754-56-6 | 2,2,2-Triethoxyethylbenzene | C14H22O3 | 238.33 | | |
| 118 | 16754-59-9 | Tris(isopropylthio)methane | C10H22S3 | 238.48 | | |
| 119 | 16754-60-2 | 1,1',1''-[Methylidynetris(thio)]trisbutane | C13H28S3 | 280.56 | | |
| 120 | 16754-68-0 | Zinc Glycerolate | C6H14O6Zn | 247.56176 | | |
| 121 | 16754-73-7 | tert-butyl 3-bromo-2-oxopropanoate | C7H11BrO3 | 223.065 | | |
| 122 | 16754-74-8 | (triphenylphosphoranylidene) Methyl pyruvate | C22H19O3P | 362.358221 | | |
| 123 | 16754-78-2 | [3,4-diacetyloxy-5-(5-oxo-2,4,9-triazabicyclo[4.3.0]nona-3,7,10-trien-9-yl)oxolan-2-yl]methyl acetate | C17H19N3O8 | 393.35 | | |
| 124 | 16754-79-3 | 6-CHLORO-7-DEAZA-9-(2',3',5'-TRI-O-ACETYL-BETA-D-RIBOFURANOSYL)PURINE | C17H18ClN3O7 | 411.79 | | |
| 125 | 16754-80-6 | 6-Chloro-7-deazapurine-b-D-riboside | C11H12ClN3O4 | 285.68 | 160-162°C | |
| 126 | 16754-81-7 | 7H-Pyrrolo[2,3-d]pyrimidine,4-methoxy-7-b-D-ribofuranosyl- | C12H15N3O5 | 281.2646 | | |
| 127 | 16754-82-8 | 7H-Pyrrolo[2,3-d]pyrimidine, 4-(1-piperidinyl)-7-β-D-ribofuranosyl- | C16H22N4O4 | 334.37 | | |
| 128 | 16754-83-9 | 7-deazanebularin | C11H13N3O4 | 251.24 | | |
| 129 | 16754-85-1 | 2-(5-benzylsulfanyl-2,4,9-triazabicyclo[4.3.0]nona-2,4,7,10-tetraen-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol | C18H19N3O4S | 373.43 | | |
| 130 | 16754-86-2 | (2R,4R,5R)-2-(hydroxymethyl)-5-(5-methylsulfanyl-2,4,9-triazabicyclo[4.3.0]nona-2,4,7,10-tetraen-9-yl)oxolane-3,4-diol | C12H15N3O4S | 297.33 | | |
| 131 | 16754-88-4 | 7H-Pyrrolo[2,3-d]pyrimidine-5-carbonitrile,4-chloro-6-(methylthio)- | C8H5ClN4S | 224.6701 | | |
| 132 | 16754-97-5 | 1H-Pyrrole-3,4-dicarbonitrile,2-amino-5-mercapto- | C6H4N4S | 164.18776 | | |
| 133 | 167542-64-5 | 7H-Furo[3,2-g][1]benzopyran-7-one, 6,6'-[(2-chlorophenyl)methylene]bis[5-hydroxy-4-methoxy- | C31H19ClO10 | 586.93 | | |
| 134 | 167542-69-0 | 7H-Furo[3,2-g][1]benzopyran-7-one, 6,6'-[(2-bromophenyl)methylene]bis[5-hydroxy-4,9-dimethoxy- | C33H23BrO12 | 691.43 | | |
| 135 | 167545-04-2 | 1(2H)-Phthalazinone, 7-(dimethylamino)-4-(phosphonooxy)- | C10H12N3O5P | 285.19 | | |
| 136 | 167545-33-7 | 3,5-Heptanedione, 4-ethyl-2,2,6,6-tetramethyl- | C13H24O2 | 212.33 | | |
| 137 | 167545-47-3 | Cyclohexanecarboxaldehyde, 4-ethyl-, trans- (9CI) | C9H16O | 140.22 | | |
| 138 | 167545-91-7 | Ethyl 4,5,6,7-tetrahydro-1H-benzo[d]iMidazole-6-carboxylate | C10H14N2O2 | 194.23 | 145-150 °C | |
| 139 | 167545-99-5 | Ethyl 4,5,6,7-tetrahydro-1H-benzo[d]iMidazole-6-carboxylate hydrochloride | C10H15ClN2O2 | 230.6913 | | |
| 140 | 167546-89-6 | [2-(2-METHOXYPHENYL)ETHYL](PROPAN-2-YL)AMINE | C12H19NO | 193.29 | | |
| 141 | 167548-65-4 | S-Bu-McN-5652 tartrate | C22H25NOS | 351.51 | | |
| 142 | 167548-89-2 | 4-(Trifluoromethyl)Thiazole-5-Carboxylic Acid | C5H2F3NO2S | 197.1350896 | | |
| 143 | 167549-33-9 | 2H-Pyrrol-5-amine,3,4-dihydro-3,3-dimethyl-,1-oxide(9CI) | C6H12N2O | 128.17 | | |
| 144 | 167549-71-5 | (S)-3-(2-Amino-2-carboxy-ethyl)-benzoic acid methyl ester | C11H13NO4 | 223.23 | | |
| 145 | 16755-00-3 | 3'-[[(S)-2-(Dimethylamino)-3-(p-methoxyphenyl)propionyl]amino]-3'-deoxy-N,N-dimethyladenosine | C24H33N7O5 | 499.56 | | |
| 146 | 16755-01-4 | 9H-Purine,2,6-dichloro-9-(2,3,4-tri-O-acetyl-b-D-ribopyranosyl)- (9CI) | C16H16Cl2N4O7 | 447.22684 | | |
| 147 | 16755-02-5 | Adenine, 2-chloro-9-b-D-ribopyranosyl- (8CI) | C10H12ClN5O4 | 301.68638 | | |
| 148 | 16755-03-6 | Adenine,2-chloro-N,N-dimethyl-9-b-D-ribopyranosyl- (8CI) | C12H16ClN5O4 | 329.73954 | | |
| 149 | 16755-04-7 | Adenine,N,N-dimethyl-9-b-D-ribopyranosyl-(8CI) | C12H17N5O4 | 295.3 | | |
| 150 | 16755-05-8 | 9H-Purine,2-chloro-6-piperidino-9-b-D-ribopyranosyl-, 2',3',4'-triacetate (8CI) | C21H26ClN5O7 | 495.91344 | | |
| 151 | 16755-07-0 | 3-BETA-D-RIBOFURANOSYLPYRROLE-2,5-DIONE | C9H11NO6 | 229.19 | 153-154° | |
| 152 | 16755-15-0 | Diphosphoric acid, mono[(2E)-3,7-dimethyl-2-octenyl] ester (9CI) | C10H22O7P2 | 316.23 | | |
| 153 | 16755-54-7 | 11-Hydroxy-12-methoxyabietatriene | C21H32O2 | 316.48 | | |
| 154 | 16755-66-1 | 2,3-DIPHENYL-5-(P-TOLYL)TETRAZOLIUM CHLORIDE | C20H17ClN4 | 348.83 | | |
| 155 | 16755-92-3 | VANADIUM IV OXIDE BIS(HEXAFLUOROPENTANEDIONATE), MONOHYDRATE | C10H4F12O6V | 499.06 | >80OC dec°C | |
| 156 | 16755-93-4 | magnesium mesoporphyrin | C34H36MgN4O4 | 588.97904 | | |
| 157 | 167551-27-1 | L-Phenylalanine, 3-(1,1-dimethylethyl)-, hydrochloride | C13H19NO2.ClH | 257.76 | | |
| 158 | 167552-54-7 | 4,5-dihydro-1,2,3,4-tetramethyl-1H-Imidazolium-1,2-benzenedicarboxylate(1:1) | C15H22N2O4 | 294.34618 | | |
| 159 | 167552-67-2 | 2-Propenamide, N-[3-(1H-imidazol-1-yl)propyl]-2-methyl- | C10H15N3O | 193.25 | | |
| 160 | 167555-66-0 | 1,2,3-Selenadiazole,5-(1-methylethyl)-(9CI) | C5H8N2Se | 175.09 | | |
| 161 | 167555-79-5 | Titanium, (2-cyclohexyl-1,3-propanediyl)bis[(1,2,3,4,5-η)-1,2,3,4,5-pentamethyl-2,4-cyclopentadien-1-yl]- | C29H46Ti | 442.54 | | |
| 162 | 167555-80-8 | Titanium, bis[(1,2,3,4,5-η)-1,2,3,4,5-pentamethyl-2,4-cyclopentadien-1-yl](2-propyl-1,3-propanediyl)- | C26H42Ti | 402.48 | | |
| 163 | 167556-63-0 | 3-Methyl-5-(tributylstannyl)pyridine | C18H33NSn | 382.171 | | |
| 164 | 167556-64-1 | 2-Methyl-5-(Tributylstannyl)Pyridine | C18H33NSn | 382.176 | | |
| 165 | 167558-32-9 | 1-{[6-(2-bromophenyl)[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-3-yl]methyl}-1H-1,2,3-benzotriazole | C16H10BrN7S | 412.2665 | | |
| 166 | 167558-34-1 | 1-{[6-(3-fluorophenyl)[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-3-yl]methyl}-1H-1,2,3-benzotriazole | C16H10FN7S | 351.36 | | |
| 167 | 167558-40-9 | 4-[3-(1H-1,2,3-benzotriazol-1-ylmethyl)[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]phenyl methyl ether | C17H13N7OS | 363.4 | | |
| 168 | 167558-64-7 | 3-methyl-1-(4-methylphenyl)-1H-indole | C16H15N | 221.3 | 42-44 °C | |
| 169 | 167561-54-8 | 1-Penten-3-one, 1-(2,4,6-trimethylphenyl)-4-(triphenylphosphoranylidene)-, (E)- (9CI) | C32H31OP | 462.56 | | |
| 170 | 167561-56-0 | 1-Hexen-3-one, 5-methyl-1-(2,4,6-trimethylphenyl)-4-(triphenylphosphoranylidene)-, (E)- | C34H35OP | 490.62 | | |
| 171 | 167561-57-1 | 3-Buten-2-one, 1-phenyl-4-(2,4,6-trimethylphenyl)-1-(triphenylphosphoranylidene)-, (E)- | C37H33OP | 524.63 | | |
| 172 | 167561-58-2 | 1-Hexen-3-one, 1-[2-(methyl-d3)phenyl]-4-(triphenylphosphoranylidene)-, (E)- (9CI) | C31H29OP | 448.55 | | |
| 173 | 167563-42-0 | 1-Acetoxy-3-(methoxymethoxy)butane | C8H16O4 | 176.21 | | |
| 174 | 167563-55-5 | 1H-Imidazo[4,5-g]quinoxaline-6,7-dione, 5,8-diethyl-5,8-dihydro- | C13H14N4O2 | 258.28 | | |
| 175 | 167564-83-2 | Pimethixene Impurity 40 | | | | |
| 176 | 167565-14-2 | 4-hydroxy-2-oxo-N-(thiazol-2-yl)-1,2-dihydroquinoline-3-carboxamide | C13H9N3O3S | 287.29 | | |
| 177 | 167565-75-5 | 3-chloro-N-(3-fluorophenyl)benzamide | C13H9ClFNO | 249.67 | | |
| 178 | 167565-79-9 | N-(3-FLUOROPHENYL)-4-METHOXYBENZAMIDE | C14H12FNO2 | 245.25 | | |
| 179 | 167565-80-2 | 4-(dimethylamino)-N-(3-fluorophenyl)benzamide | C15H15FN2O | 258.2908032 | | |
| 180 | 167565-85-7 | 4-Bromo-2-nitro-1-nitrosobenzene | C6H3BrN2O3 | 231 | | |
| 181 | 167566-34-9 | 1-benzyl-3-(trifluoromethyl)piperazine | C12H15F3N2 | 244.26 | | |
| 182 | 167568-21-0 | Carbamic acid, N,N-bis(3-aminopropyl)-, 1,1-dimethylethyl ester | C11H25N3O2 | 231.34 | | |
| 183 | 167568-51-6 | Propanoic acid,2-methyl-,1,3,4,4a,5,7,12,12b-octahydro-8,10-dihydroxy-9-[1-(hydroxymethyl)-1-methyl-2-propenyl]-2,5,5-trimethyl-7,12-dioxo-2H-benzo[d]naphtho[2,3-b]pyran-3-ylester (9CI) | C29H36O8 | 512.59134 | | |
| 184 | 167568-99-2 | Cobaltate(1-), bis[(7,8,9,10,11-η)-undecahydro-7,8-dicarbaundecaborato(2-)]-, lithium (9CI) | C4B18CoLi | 308.5 | | |
| 185 | 16757-14-5 | Xenon fluoride (XeF) (7CI,9CI) | FHXe | 151.3 | | |
| 186 | 16757-19-0 | 1,3,5-Triazine-2,4-diamine,1-(3,4-dichlorophenyl)-1,6-dihydro-6,6-dimethyl- | C11H13Cl2N5 | 286.16 | | |
| 187 | 16757-45-2 | Phenol,2-[1,3-bis[[4-[bis(2-chloroethyl)amino]phenyl]methyl]hexahydro-2-pyrimidinyl]-6-methoxy- | C33H42Cl4N4O2 | 668.52418 | | |
| 188 | 16757-47-4 | 2-[1,3-bis[[4-[bis(2-chloroethyl)amino]phenyl]methyl]-1,3-diazinan-2-yl]-4-nitro-phenol | C32H39Cl4N5O3 | 683.5 | | |
| 189 | 16757-48-5 | Benzenamine, 4,4'-[[dihydro-2-(4-methoxyphenyl)-1,3(2H,4H)-pyrimidinediyl]bis(methylene)]bis[N,N-bis(2-chloroethyl)- (9CI) | C33H42Cl4N4O | 652.52 | | |
| 190 | 16757-49-6 | Benzenamine,4,4'-[[2-(3-fluorophenyl)dihydro-1,3(2H,4H)-pyrimidinediyl]bis(methylene)]bis[N,N-bis(2-chloroethyl)-(9CI) | C32H39Cl4FN4 | 640.4892632 | | |
| 191 | 16757-51-0 | Phenol,2-[1,3-bis[[4-[bis(2-chloroethyl)amino]phenyl]methyl]hexahydro-2-pyrimidinyl]- | C32H40Cl4N4O | 638.4982 | | |
| 192 | 16757-53-2 | Phenol,2-[1,3-bis[[4-[bis(2-chloroethyl)amino]phenyl]methyl]hexahydro-2-pyrimidinyl]-4-bromo- | C32H39BrCl4N4O | 717.39426 | | |
| 193 | 16757-54-3 | Benzenamine,4,4'-[[2-[4-(dimethylamino)phenyl]dihydro-1,3(2H,4H)-pyrimidinediyl]bis(methylene)]bis[N,N-bis(2-chloroethyl)-(9CI) | C34H45Cl4N5 | 665.5666 | | |
| 194 | 16757-55-4 | 7-Oxa-2,4,6-triaza-3-phosphaoctanoicacid, 3-[(ethoxycarbonyl)amino]-5-oxo-, ethyl ester, 3-oxide | C8H17N4O7P | 312.216941 | | |
| 195 | 16757-57-6 | 7-Oxa-2,4,6-triaza-3-phosphaoctanoicacid, 3-[[[2-chloro-1-(chloromethyl)ethoxy]carbonyl]amino]-5-oxo-, ethyl ester,3-oxide | C9H17Cl2N4O7P | 395.133641 | | |
| 196 | 16757-60-1 | Urea, N,N'',N''''-phosphinidynetris[N'-methoxy- (9CI) | C6H15N6O6P | 298.19 | | |
| 197 | 16757-61-2 | 7-Oxa-2,4,6-triaza-3-phosphaoctanoicacid, 3-[(ethoxycarbonyl)amino]-5-oxo-, ethyl ester | C8H17N4O6P | 296.22 | | |
| 198 | 16757-62-3 | Phosphoramidic acid,hydroxy-, diphenyl ester (8CI,9CI) | C12H12NO4P | 265.201741 | | |
| 199 | 16757-63-4 | 1H-Pyrazole-3-propanoicacid, a-amino- | C6H9N3O2 | 155.15456 | | |
| 200 | 16757-80-5 | 11-Methylbenzo[a]pyrene | C21H14 | 266.34 | 155.75°C | |
| 201 | 16757-81-6 | 3-Methylbenzo[a]pyrene | C21H14 | 266.34 | 147.4°C | |
| 202 | 16757-82-7 | 2-Methylbenzo[a]pyrene | C21H14 | 266.34 | 138.5°C | |
| 203 | 16757-83-8 | 4-Methylbenzo[a]pyrene | C21H14 | 266.34 | 217.75°C | |
| 204 | 16757-84-9 | 3,12-dimethylbenzo(a)pyrene | C22H16 | 280.36 | | |
| 205 | 16757-85-0 | 1,2-Dimethylbenzo[a]pyrene | C22H16 | 280.36 | | |
| 206 | 16757-86-1 | 1,3-Dimethylbenzo[a]pyrene | C22H16 | 280.36 | | |
| 207 | 16757-87-2 | 2,3-Dimethylbenzo[a]pyrene | C22H16 | 280.36 | | |
| 208 | 16757-88-3 | 1,4-Dimethylbenzo[a]pyrene | C22H16 | 280.36 | | |
| 209 | 16757-89-4 | 4,5-Dimethylbenzo[a]pyrene | C22H16 | 280.36 | | |
| 210 | 16757-90-7 | 1,6-dimethylbenzo(a)pyrene | C22H16 | 280.36244 | | |
| 211 | 16757-91-8 | 3,6-Dimethylbenzo[a]pyrene | C22H16 | 280.36 | | |
| 212 | 16757-92-9 | 1,3,6-Trimethylbenzo[a]pyrene | C23H18 | 294.39 | 290-292 °C(Solv: benzene (71-43-2)) | |
| 213 | 1675732-80-5 | Bis(2-ethylhexyl) Phthalate-13C6 | C24H38O4 | 396.61012 | | |
| 214 | 1675732-94-1 | Benzenemethanesulfonyl fluoride, 2-nitro- | C7H6FNO4S | 219.19 | | |
| 215 | 1675790-91-6 | Methanesulfonamide, N-ethynyl-N-methyl- | C4H7NO2S | 133.17 | | |
| 216 | 16758-26-2 | DIPHENYLAMINECHLOROARSINE | C12H11AsClN | 279.6 | | |
| 217 | 16758-28-4 | Quinolinium, 1-ethyl-6-[[4-[[4-[[(1-ethylquinolinium-6-yl)amino]carbonyl]benzoyl]amino]benzoyl]amino]-, salt with 4-methylbenzenesulfonic acid (1:2) (9CI) | C44H40N5O6S+ | 766.89 | | |
| 218 | 16758-33-1 | Pyridinium, 3,3'-[terephthaloylbis(imino-p-phenylenecarbonylimino)]bis[1-ethyl-, di-p-toluenesulfonate | C50H48N6O10S2 | 957.08032 | | |
| 219 | 16758-34-2 | Phenyl 1-thio-?-D-galactopyranoside | C12H16O5S | 272.32 | 93-98 °C | |
| 220 | 16758-47-7 | α-Cyclohexyl-4,5α-epoxy-3-hydroxy-6-methoxy-α,17-dimethyl-6,14-ethenomorphinan-7-methanol | C28H37NO4 | 451.61 | | |
| 221 | 16758-87-5 | 4H-3,1-Benzoxazin-2-amine, 6-chloro-N-ethyl-4-phenyl- | C16H15ClN2O | 286.76 | | |
| 222 | 1675821-32-5 | EML 425 | C27H24N2O4 | 440.49 | | |
| 223 | 1675874-01-7 | 1675874-01-7 | | | | |
| 224 | 1675895-48-3 | 1675895-48-3 | | | | |
| 225 | 16759-05-0 | 4-Quinolineacetonitrile,1,4-dihydro-1-methyl-a-phenyl- | C18H16N2 | 260.33304 | | |
| 226 | 16759-13-0 | 5a-Androst-7-ene-3b,17b-diol, diacetate (6CI,7CI,8CI) | C23H34O4 | 374.51366 | | |
| 227 | 16759-33-4 | Hydrazinecarboxamide,2-[1-methyl-3-(4-methylphenyl)-2-propen-1-ylidene]- | C12H15N3O | 217.267 | | |
| 228 | 16759-45-8 | 3,4,5-TRIMETHYL-4H-1,2,4-TRIAZOLE | C5H9N3 | 111.15 | | |
| 229 | 16759-47-0 | 1-(4-NITROPHENYL)-1H-TETRAZOLE | C8H6N4O2 | 190.16 | 318 °C | |
| 230 | 16759-59-4 | (5,7-dichlorobenzooxazol-2-yl)methylsulfanyl-diethoxy-sulfanylidene-ph osphorane | C12H14Cl2NO3PS2 | 386.25 | | |
| 231 | 1675910-85-6 | tert-Butyl 3-(pyridin-2-ylthio)azetidine-1-carboxylate | | | | |
| 232 | 1675968-65-6 | Benzenemethanol, 2,6-dibromo-α-methyl- | C8H8Br2O | 279.96 | | |
| 233 | 1675969-69-3 | 5-Bromo-[1,1'-biphenyl]-2-carbaldehyde | C13H9BrO | 261.11 | | |
| 234 | 1675970-12-3 | 2,8-Diazaspiro[4.5]decane-2,3,8-tricarboxylic acid, 8-(1,1-dimethylethyl) 3-ethyl 2-(phenylmethyl) ester, (3S)- | C24H34N2O6 | 446.54 | | |
| 235 | 1675970-16-7 | 2-(tert-butyl) 3-ethyl (S)-2,8-diazaspiro[4.5]decane-2,3-dicarboxylate | C16H28N2O4 | 312.4 | | |
| 236 | 1675973-74-6 | Poly{[N,N'-bis(2-hexylldecyl)naphthalene- 1,4,5,8-bis(dicarboximide)-2,6-diyl]-alt-2,5-thiophene} | (C50H70N2O4S)n | | | |
| 237 | 1675974-45-4 | 1-tert-butyl 3-ethyl 2-phenylpiperidine-1,3-dicarboxylate | C19H27NO4 | 333.42 | | |
| 238 | 1675974-83-0 | 2-Methyl-piperidine-1,3-dicarboxylic acid 1-tert-butyl ester 3-ethyl ester | C14H25NO4 | 271.35 | | |
| 239 | 1675976-32-5 | 1-butyl-2-((E)-3-((E)-1-butyl-3，3-dimethylindolin-2-ylidene)prop-1-en-1-yl)-3，3-dimethyl-3H-indol-1-ium，bromide (1:1) | | | | |
| 240 | 1675984-44-7 | 5-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)benzofuran-2-carboxylic acid | | | | |
| 241 | 1675985-30-4 | 4-allyl-2-(1H-benzo[d]imidazol-2-yl)-6-methoxyphenol | C17H16N2O2 | 280.32 | | |
| 242 | 1675985-33-7 | 2-Pyrimidinamine, 4-[(1R)-1-(2-bromo-4-chlorophenyl)-2,2,2-trifluoroethoxy]-6-chloro- | C12H7BrCl2F3N3O | 417.01 | | |
| 243 | 1675985-38-2 | 1675985-38-2 | C31H32BrClF3N5O5 | 726.97 | | |
| 244 | 1675985-43-9 | 1675985-43-9 | C37H37ClF3N5O5 | 724.17 | | |
| 245 | 1675985-67-7 | Rodatristat Impurity 191 | | | | |
| 246 | 1675985-86-0 | Rodatristat Impurity 70 | | | | |
| 247 | 1675986-02-3 | Rodatristat Impurity 62 | | | | |
| 248 | 1675986-18-1 | Rodatristat Impurity 64 | | | | |
| 249 | 1675986-43-2 | Rodatristat Impurity 211 | | | | |
| 250 | 1675988-73-4 | Rodatristat Impurity 110 | | | | |
| 251 | 1675989-28-2 | Rodatristat Impurity 190 | | | | |
| 252 | 1675989-46-4 | Rodatristat Impurity 189 | | | | |
| 253 | 1675989-85-1 | Rodatristat Impurity 61 | | | | |
| 254 | 1675990-55-2 | Rodatristat Impurity 38 | | | | |
| 255 | 1675990-90-5 | Rodatristat Impurity 188 | | | | |
| 256 | 1675990-98-3 | Rodatristat Impurity 92 | | | | |
| 257 | 1675991-21-5 | Rodatristat Impurity 187 | | | | |
| 258 | 1675991-40-8 | Rodatristat Impurity 185 | | | | |
| 259 | 1675994-74-7 | 1,1'-Biphenyl]-2-carboxaldehyde, 5-(methylsulfonyl)- | C14H12O3S | 260.31 | | |