| 1 | 1013-00-9 | 1,4-Naphthalenedione,2,3-dichloro-2,3-dihydro- | C10H6Cl2O2 | 229.05944 | | |
| 2 | 1013-01-0 | 1,3-dimethyl-2,4-(1H,3H)-quinazolinedione | C10H10N2O2 | 190.2 | | |
| 3 | 1013-03-2 | Benzene, 1,2-bis(1-methylpropyl)- | C14H22 | 190.32 | | |
| 4 | 1013-04-3 | 4-Chloro-1-naphthoic acid | C11H7ClO2 | 206.63 | 223-224 °C | |
| 5 | 1013-08-7 | PHENANTHRENE,1,2,3,4-TETRA- | C14H14 | 182.26 | 33.5°C | |
| 6 | 1013-11-2 | NSC13574 | C10H12O4 | 196.19988 | | |
| 7 | 1013-14-5 | 4,5,6,7-Hexahydro-benzo[d]isoxazole-3-carboxylicacidethylester | C10H13NO3 | 195.22 | | |
| 8 | 1013-18-9 | 2-Chloro-1-(2-methyl-2,3-dihydro-indol-1-yl)-ethanone | C11H12ClNO | 209.67 | | |
| 9 | 1013-19-0 | 1-Naphthaleneethanamine, β-methyl-, hydrochloride (1:1) | C13H15N.ClH | 221.73 | 268 °C | |
| 10 | 1013-20-3 | neocupferron | C10H11N3O2 | 205.21 | 125-126° with decompn | |
| 11 | 1013-22-5 | 1-(2,3-Dimethylphenyl)piperazine | C12H18N2 | 190.28 | | |
| 12 | 1013-23-6 | Dibenzothiophene-5-oxide | C12H8OS | 200.26 | 188-188.5 °C | |
| 13 | 1013-24-7 | 1-(2-METHYLMERCAPTOPHENYL)PIPERAZINE | C11H16N2S | 208.33 | | |
| 14 | 1013-25-8 | 1-(2,5-Dimethylphenyl)Piperazine | C12H18N2 | 190.28 | 42-47 | |
| 15 | 1013-27-0 | 1-(2,5-DICHLOROPHENYL)PIPERAZINE | C10H12Cl2N2 | 231.12 | | |
| 16 | 1013-37-2 | 1,2-Ethanediamine,N1-4-quinazolinyl- | C10H12N4 | 188.23 | | |
| 17 | 1013-47-4 | 1-METHYL-2-(7-METHYL-1H-INDOL-3-YL)-ETHYLAMINE | C12H16N2 | 188.27 | | |
| 18 | 1013-48-5 | 1H-Indole-3-ethanamine,7-chloro-a-methyl-, hydrochloride (1:1) | C11H14Cl2N2 | 245.14826 | | |
| 19 | 1013-59-8 | Sodium(5S)-3-acetyl-5-[(S)-1-methylpropyl]-4-hydroxy-3-pyrroline-2-olate | C10H16NNaO3 | 221.23 | | |
| 20 | 1013-65-6 | Piperazine,2,2-dimethyl-3-phenyl-, hydrochloride (1:2) | C12H19ClN2 | 226.74566 | | |
| 21 | 1013-66-7 | Morpholine, 3,3-dimethyl-2-phenyl- | C12H17NO | 191.27 | | |
| 22 | 1013-68-9 | 2,4-Thiazolidinedione,3-(3-chlorophenyl)- | C9H6ClNO2S | 227.66744 | | |
| 23 | 1013-69-0 | Noreugenin | C10H8O4 | 192.17 | 279 °C | |
| 24 | 1013-75-8 | N-Ethyl-N-Phenylurethane | C11H15NO2 | 193.24 | | 1.424g/L at 20.1℃ |
| 25 | 1013-76-9 | 1-(2,4-Dimethylphenyl)piperazine | C12H18N2 | 190.28 | | |
| 26 | 1013-77-0 | 1-(2,4-dimethylphenyl)piperazinehydrochloride | C12H19ClN2 | 226.74566 | 236 °C | |
| 27 | 1013-78-1 | 1-(2,4-DICHLOROPHENYL)PIPERAZINE | C10H12Cl2N2 | 231.12 | | |
| 28 | 1013-80-5 | 4-Bromo-2-naphthoic acid | C11H7BrO2 | 251.08 | 245-246 °C | |
| 29 | 1013-81-6 | 2-Naphthalenecarboxylic acid, 4-chloro- | C11H7ClO2 | 206.62508 | | |
| 30 | 1013-83-8 | 5-BROMO-2-NAPHTHOIC ACID | C11H7BrO2 | 251.08 | 270°C | |
| 31 | 1013-86-1 | Pyridinium,3-[(diethylamino)carbonyl]-1-methyl-, iodide (1:1) | C11H17IN2O | 320.16995 | | |
| 32 | 1013-88-3 | Benzhydrylimine | C13 H11 N | 181.23 | -30 °C | 0.3 g/L (25 ºC) |
| 33 | 1013-92-9 | Di(piperidin-1-yl)methanethione | C11H20N2S | 212.3549 | 57.5-58.5 °C | |
| 34 | 1013-93-0 | Dimorpholino thioketone | C9H16N2O2S | 216.3 | | |
| 35 | 1013-97-4 | Benzoic acid,2-[(2-chloro-2-propen-1-yl)amino]- | C10H10ClNO2 | 211.6449 | | |
| 36 | 1013-99-6 | 4H-Pyran-4-one,2-methyl-6-phenyl- | C12H10O2 | 186.21 | | |
| 37 | 10130-23-1 | 2-Phenyl-3-methylquinoxaline | C15H12N2 | 220.27 | | |
| 38 | 10130-26-4 | 2-Ethyl-3-phenylquinoxaline 1-oxide | C16H14N2O | 250.3 | | |
| 39 | 10130-29-7 | direct yellow 8 (C.I. 13920) | C24H21N4NaO5S2 | 532.56 | | |
| 40 | 10130-48-0 | ACID VIOLET 5 | C25H20N4Na2O10S3 | 678.62164 | 240°C (dec.)(lit.) | |
| 41 | 10130-52-6 | Phenazinium, 3-amino-2,8-dimethyl-7-(methylamino)-5-phenyl-, chloride (1:1) | C21H21ClN4 | 364.88 | | |
| 42 | 10130-53-7 | Benzenesulfonic acid, 2,2'-[(4,8-diamino-3,7-dibromo- 9,10-dihydro-9,10-dioxo-1,5-anthracenediyl)diimino ]bis[5-methyl-, disodium salt | C28H22Br2N4O8S2.2Na | 812.42 | | |
| 43 | 10130-66-2 | 2,4-Imidazolidinedione, 1-[[(3-nitro-2-furanyl)methylene]amino]- | C8H6N4O5 | 238.16 | | |
| 44 | 10130-74-2 | 3-Methoxybenzenesulphonyl chloride | C7H7ClO3S | 206.65 | | |
| 45 | 10130-87-7 | 2-Methoxybenzenesulfonyl Chloride | C7H7ClO3S | 206.65 | 50-54°C | |
| 46 | 10130-89-9 | 4-(chlorosulphonyl)benzoic acid | C7H5ClO4S | 220.63 | 230 °C | Reacts with water. |
| 47 | 101300-61-2 | 1,2-Bis(trimethylsilyl)-3-methylcyclohexa-1,4-diene | C13H26Si2 | 238.52 | | |
| 48 | 101300-88-3 | 1H-Benzimidazole, 2-[[(4-methoxy-3-methyl-2-pyridinyl)methyl]sulfinyl]-5,6-dimethyl- | C17H19N3O2S | 329.42 | | |
| 49 | 101300-89-4 | 1H-Benzimidazole, 2-[[(4-methoxy-3-methyl-2-pyridinyl)methyl]thio]-5,6-dimethyl- | C17H19N3OS | 313.42 | | |
| 50 | 1013002-44-2 | 1-(4-(4-(3,4-dichlorobenzoyl)piperazin-1-yl)phenyl)ethan-1-one | C19H18Cl2N2O2 | 377.26 | | |
| 51 | 101301-17-1 | 3,4-Dihydro-2H-isoquinolin-1-one-4-carboxylic acid | C10H9NO3 | 191.18 | | |
| 52 | 101301-18-2 | 2(1H)-Isoquinolineacetic acid, 3,4-dihydro-1-oxo- | C11H11NO3 | 205.21 | | |
| 53 | 101302-84-5 | [1,3,4]Thiadiazolo[3,2-a]-1,2,3-triazolo[4,5-d]pyrimidin-9(3H)-one, 6-[2-(3-chlorophenyl)ethyl]- | C13H9ClN6OS | 332.77 | | |
| 54 | 1013025-04-1 | (2R)-2-[(S)-[(4-Fluorophenyl)aMino][4-(phenylMethoxy)phenyl]Methyl]pentanedioic Acid | C25H24FNO5 | 437.46 | | |
| 55 | 1013026-68-0 | 2-hydroxy-4-Pentynoic acid | C5H6O3 | 114.1 | | |
| 56 | 1013027-15-0 | 1-[3-(Hydroxymethyl)phenyl]ethanol | C9H12O2 | 152.19 | | |
| 57 | 1013027-27-4 | 1-Vinylimidazolium Bis(trifluoromethanesulfonyl)imide | C7H7F6N3O4S2 | | 35.0 to 39.0 °C | |
| 58 | 1013028-26-6 | 3-tert-Butyl 4-Methyl (4R,5S)-2,2,5-Trimethyloxazolidine-3,4-dicarboxylate | C13H23NO5 | 273.32542 | | |
| 59 | 1013028-27-7 | tert-Butyl (4S,5S)-4-(Hydroxymethyl)-2,2,5-trimethyloxazolidine-3-carboxylate | C12H23NO4 | 245.31532 | | |
| 60 | 101303-89-3 | Benzenemethanamine, N-methyl-N-nitro-α-phenyl- | C14H14N2O2 | 242.27 | | |
| 61 | 101303-91-7 | Benzenemethanamine, N-methyl-N-nitro-α,α-diphenyl- | C20H18N2O2 | 318.37 | | |
| 62 | 101303-98-4 | Zacopride hydrochloride | C15H21Cl2N3O2 | 346.25 | 158-160 °C | |
| 63 | 101303-99-5 | Benzamide, N-1-azabicyclo[2.2.2]oct-3-yl-2-methoxy-, (2E)-2-butenedioate (1:1) | C19H24N2O6 | 376.41 | | |
| 64 | 1013030-97-1 | 3,6-dibromo-9-(3-bromopropyl)-9H-carbazole | C15H12Br3N | 445.98 | | |
| 65 | 1013031-65-6 | 2,6-Dibromobenzyl alcohol | C7H6Br2O | 265.93 | | |
| 66 | 1013033-83-4 | 7-Boc-1-oxo-3-phenyl-2,7-diaza-spiro[3.5]nonane | C18H24N2O3 | 316.39476 | | |
| 67 | 1013037-01-8 | 1-(4-Methoxy-2-(trifluoromethyl)-1H-benzo[d]imidazol-7-yl)propan-1-one | | | | |
| 68 | 1013038-78-2 | 1-(tert-Butyl)2-methyl-2-methyloxazolidinetetraone-1,2-dicarboxylate | C14H17NO4 | 263.29 | | |
| 69 | 101305-29-7 | alpha-threo-Pentopyranoside, methyl 2-amino-2,3,4-trideoxy-3-fluoro- (9CI) | C6H12FNO2 | 149.16 | | |
| 70 | 101305-33-3 | beta-threo-Pentopyranoside, methyl 2-amino-2,3,4-trideoxy-3-fluoro- (9CI) | C6H12FNO2 | 149.16 | | |
| 71 | 101306-11-0 | 3,4-Dithiophen-2-ylthiophene | C12H8S3 | 248.39 | | |
| 72 | 101306-50-7 | 1,3-Cyclohexanediol,4-(dimethylamino)-2-ethoxy-,(1alpha,2bta,3alpha,4bta)-(9CI) | C10H21NO3 | 203.28 | | |
| 73 | 101306-51-8 | 1,3-Cyclohexanediol,2-ethoxy-4-[(1-methylethyl)amino]-,(1alpha,2bta,3alpha,4bta)-(9CI) | C11H23NO3 | 217.30522 | | |
| 74 | 101306-98-3 | Herbicide | C26H28N10O12S3 | 768.75 | | |
| 75 | 1013061-60-3 | 2-(4-CHLOROPHENYL)-3-(METHOXYIMINO)PROPANENITRILE | C10H9ClN2O | 208.64 | | |
| 76 | 1013071-74-3 | 1-(3-(Hydroxymethyl)-4-morpholinophenyl)pyrrolidin-2-one | C15H20N2O3 | 276.33 | | |
| 77 | 1013074-93-5 | Chloramphenicol 1-O-β-D-Glucuronide | C17H20Cl2N2O11 | 499.25 | | |
| 78 | 1013083-57-2 | 1,3-Benzenedicarboxamide, N1,N3-bis[3-(diethylamino)propyl]-5-[[4-[(1E)-2-[1-[[(2,3-dihydro-2-oxo-1H-benzimidazol-5-yl)amino]carbonyl]-2-oxopropyl]diazenyl]benzoyl]amino]- | C40H52N10O6 | 768.9 | | |
| 79 | 101309-07-3 | 1,5-Naphthalenedisulfonic acid, 3-[2-(4-amino-3-sulfophenyl)diazenyl]- | C16H13N3O9S3 | 487.48 | | |
| 80 | 101309-22-2 | (3E)-4-(1-benzothiophen-3-yl)but-3-en-2-one | C12H10OS | 202.2722 | | |
| 81 | 101309-61-9 | 1H-Pyrazole-4-carbothioamide, 5-amino-1-(2-chlorophenyl)-3-methyl- | C11H11ClN4S | 266.75 | | |
| 82 | 101309-64-2 | 1H-Pyrazole-4-carbothioamide, 5-amino-1-(2,4-dichlorophenyl)-3-methyl- | C11H10Cl2N4S | 301.19 | | |
| 83 | 101309-66-4 | 1H-Pyrazole-4-carbothioamide, 5-amino-1-(2,5-dichlorophenyl)-3-methyl- | C11H10Cl2N4S | 301.19 | | |
| 84 | 101309-71-1 | 1H-Pyrazole-4-carbothioamide, 5-amino-1,3-dimethyl- | C6H10N4S | 170.24 | | |
| 85 | 101309-92-6 | Benzoic acid, 2-(dodecyldithio)-, methyl ester | C20H32O2S2 | 368.6 | | |
| 86 | 1013096-03-1 | 1-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-4-methylcyclohexane-1-carboxylic acid | C23H27NO4S2 | 445.59 | | |
| 87 | 1013098-03-7 | 6-(3,4-Dichlorophenyl)-1-(methoxymethyl)-3-azabicyclo[4.1.0]heptane hydrochloride | C14H18Cl3NO | 322.65782 | | |
| 88 | 1013098-04-8 | 3-Azabicyclo[4.1.0]heptane, 6-(3,4-dichlorophenyl)-1-(methoxymethyl)-, (1S,6R)- | C14H17Cl2NO | 286.2 | | |
| 89 | 1013098-90-2 | Pyrido[2,3-d]pyrimidin-7(8H)-one, 2-amino-8-cyclopentyl-4-methyl-6-(1H-pyrazol-4-yl)- | C16H18N6O | 310.35372 | | |
| 90 | 1013099-42-7 | 2-amino-8-((1r,4r)-4-hydroxycyclohexyl)-6-(6-methoxypyridin-3-yl)-4-methylpyrido[2,3-d]pyrimidin-7(8H)-one | C20H23N5O3 | 381.43 | | |
| 91 | 1013099-50-7 | PYRIMIDINE, 5-BROMO-4-CHLORO-2-(2,5-DIMETHYL-1H-PYRROL-1-YL)-6-METHYL- | C11H11BrClN3 | 300.58214 | | |
| 92 | 10131-46-1 | 6-benzyl-2-methylpyridine | C13H13N | 183.24902 | | |
| 93 | 10131-48-3 | 3-Pyridinecarboxamide,2,6-dimethyl-(9CI) | C8H10N2O | 150.18 | | |
| 94 | 10131-61-0 | 6-Benzyl-2-Methylnicotinonitrile | C14H12N2 | 208.26 | | |
| 95 | 101310-86-5 | 2-oxabicyclo[4.1.0]heptane-7-carboxylic acid | C7H10O3 | 142.1525 | | |
| 96 | 101310-92-3 | Card-20(22)-enolide,3-[(2,6-dideoxy-3-O-methyl-D-ribo-hexopyranosyl)oxy]-14,16-dihydroxy-, (3b,5b,16b)- (9CI) | C30H46O8 | 534.68144 | | |
| 97 | 1013101-36-4 | PF-04691502 | C22H27N5O4 | 425.48 | 219-221°C | |
| 98 | 1013101-73-9 | 1-(2-(methoxymethoxy)ethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole | C13H23BN2O4 | 282 | | |
| 99 | 1013106-04-1 | methyl 6-chlorothieno[2,3-b]quinoline-2-carboxylate | C13H8ClNO2S | 277.72 | | |
| 100 | 101311-04-0 | duartin | C18H20O6 | 332.35 | | |
| 101 | 101311-12-0 | (1S,2S,4S,5S)-2-((R)-Hydroxy(Quinolin-4-Yl)Methyl)-1-(4-(Trifluoromethyl)Benzyl)-5-Vinylquinuclidin-1-Ium Bromide(WXC02411) | C27H28BrF3N2O | 533.43 | | |
| 102 | 101311-63-1 | (1R,3S,4R,6R,7R)-1,4,6-Trimethyl-3-[(1R,2E,4E,6E)-1-hydroxy-1-methyl-7-(4-methoxy-5-methyl-2-oxo-2H-pyran-6-yl)-2,4,6-heptatrien-1-yl]-2,5-dioxabicyclo[2.2.1]heptan-7-ol | | | | |
| 103 | 1013110-01-4 | 2,4-dichloro-6-cyclohexylpyrimidine | C10H12Cl2N2 | 231.12 | | |
| 104 | 1013110-15-0 | 2,4-dichloro-6-cyclopentyl-pyrimidine | C9H10Cl2N2 | 217.1 | | |
| 105 | 1013111-55-1 | 1-PHENYLPIPERIDIN-4-AMINE | C11H16N2 | 176.26 | | |
| 106 | 1013112-48-5 | 2-Formyl-4,5-dimethoxybenzonitrile | C10H9NO3 | 191.18336 | 142-144 °C | |
| 107 | 1013116-55-6 | ethyl 3-iodo-2,2-dimethylpropanoate | C7H13IO2 | 256.08 | | |
| 108 | 1013116-83-0 | Benzamide, N-(3-bromo-2-methylphenyl)-4-(1,1-dimethylethyl)- | C18H20BrNO | 346.26 | | |
| 109 | 1013117-29-7 | 6-amino-7-methoxyisoquinolin-1(2H)-one | C10H10N2O2 | 190.2 | | |
| 110 | 1013117-40-2 | 3-Pyrrolidinecarboxamide, N-(7-chloro-1,2-dihydro-1-oxo-6-isoquinolinyl)-4-(4-chlorophenyl)-, (3R,4S)-rel- | C20H17Cl2N3O2 | 402.27 | | |
| 111 | 1013117-42-4 | Trans-1-benzyl-4-(4-chlorophenyl)pyrrolidine-3-carboxylic acid-HCl | C18H19Cl2NO2 | 352.26 | | |
| 112 | 101312-07-6 | 1H-Indole-3-propanoicacid,-alpha--hydroxy-,(-alpha-R)-(9CI) | C11H11NO3 | 205.21 | 100-103℃ | |
| 113 | 101312-79-2 | (1S,3aR)-1β,7-Dimethoxy-4β-(3-methoxy-4-hydroxyphenyl)-1,3,3aβ,4,9,9aα-hexahydronaphtho[2,3-c]furan-6-ol | C21H24O6 | 372.41 | | |
| 114 | 101312-82-7 | β-D-Gal-(1→4)-α-D-Man | C12H22O11 | 342.3 | | |
| 115 | 101312-92-9 | VALNEMULIN | C31H52N2O5S | 564.82 | 140-143°C | |
| 116 | 1013121-54-4 | 1,3-Propanediol, 2-(hydroxymethyl)-, 1-(4-methylbenzenesulfonate) | C11H16O5S | 260.31 | | |
| 117 | 101314-73-2 | 5'-iodoacetamido-5'-deoxythymidine | C12H16IN3O5 | 409.18 | | |
| 118 | 101314-84-5 | 3-Bromopropionic Acid N-Hydroxysuccinimide | C7H8BrNO4 | 250.05 | | |
| 119 | 101314-97-0 | Simvastatin Hydroxy Acid Sodium Salt | C25H41NaO6 | 460.59 | >122°C (dec.) | |
| 120 | 101316-43-2 | Benzene, (1-methylethyl)-, oxidized, cumene residues, methylstyrene fraction | | | | |
| 121 | 101316-44-3 | Benzene, (1-methylethyl)-, oxidized, cumene residues, acetophenone fraction | | | | |
| 122 | 101316-45-4 | Absorption oils, bicyclo arom. and heterocylic hydrocarbon fraction | | | | |
| 123 | 101316-46-5 | Petroleum ether, boiling range 60 - 90 ℃ | | | | |
| 124 | 101316-46-5 | Petroleum ether, boiling range 60 - 90 ℃ | | | | |
| 125 | 101316-48-7 | Castor oil, sulfonated | | | | |
| 126 | 101316-49-8 | Distillates (coal tar), pitch | | | | |
| 127 | 101316-50-1 | Distillates (petroleum), alkene-alkyne manuf. pyrolysis oil, condensed arom. ring-contg. | | | | |
| 128 | 101316-51-2 | Distillates (petroleum), alkene-alkyne manuf. pyrolysis oil, heavy fraction | | | | |
| 129 | 101316-52-3 | Distillates (petroleum), alkene-alkyne manuf. pyrolysis oil, methylnaphthalene fraction | | | | |
| 130 | 101316-53-4 | Distillates (petroleum), alkene-alkyne manuf. pyrolysis oil, naphthalene fraction | | | | |
| 131 | 101316-54-5 | Distillates (petroleum), C12-14-alkylbenzene hydrotreated middle | | | | |
| 132 | 101316-56-7 | Distillates (petroleum), C7-9, C8-rich, hydrodesulfurized dearomatized | | | | |
| 133 | 101316-57-8 | Distillates (petroleum), hydrodesulfurized full-range middle | | | | |
| 134 | 101316-58-9 | Distillates (petroleum), hydrodesulfurized full-range middle coker | | | | |
| 135 | 101316-59-0 | Distillates (petroleum), hydrodesulfurized middle coker | | | | |
| 136 | 101316-61-4 | Distillates (petroleum), thermal-cracked, alkylarom. hydrocarbon-rich | | | | |
| 137 | 101316-62-5 | Extract residues (coal), light oil alk., acid ext., indene fraction | | | | |
| 138 | 101316-63-6 | Extract residues (coal tar), benzole fraction alk., acid ext. | | | | |
| 139 | 101316-64-7 | Gases (petroleum), acid, steam cracker diethanolamine scrubber | | | | |
| 140 | 101316-66-9 | Hydrocarbons, C6-8, hydrogenated sorption-dearomatized, toluene raffination | | | | |
| 141 | 101316-67-0 | Hydrocarbons, C6-rich, hydrotreated light naphtha distillates, solvent-refined | | | | |
| 142 | 101316-68-1 | Kerosine (petroleum), catalytic reformed, C8-15-alkylbenzene fraction | | | | |
| 143 | 101316-69-2 | Lubricating oils (petroleum), C>25, solvent-extd., deasphalted, dewaxed, hydrogenated | | | | |
| 144 | 101316-70-5 | Lubricating oils (petroleum), C17-32, solvent-extd., dewaxed, hydrogenated | | | | |
| 145 | 101316-71-6 | Lubricating oils (petroleum), C20-35, solvent-extd., dewaxed, hydrogenated | | | | |
| 146 | 101316-72-7 | Lubricating oils (petroleum), C24-50, solvent-extd., dewaxed, hydrogenated | | | | |
| 147 | 101316-73-8 | Lubricating oils (petroleum), used, noncatalytically refined | | | | |
| 148 | 101316-76-1 | Naphtha (petroleum), hydrodesulfurized full-range coker | | | | |
| 149 | 101316-78-3 | Pitch, phenol manuf. cumene hydroperoxide oxidn. | | | | |
| 150 | 101316-80-7 | Solvent naphtha (petroleum), hydrocracked heavy arom. | | | | |
| 151 | 101316-81-8 | Solvent naphtha (petroleum), hydrodesulfurized heavy arom. | | | | |
| 152 | 101316-82-9 | Solvent naphtha (petroleum), hydrodesulfurized medium | | | | |
| 153 | 101316-83-0 | Tar, brown-coal | | | | |
| 154 | 101316-84-1 | Tar, brown-coal, low-temp. | | | | |
| 155 | 101316-85-2 | Tar, coal, low-temp., distn. residues | | | | |
| 156 | 101316-86-3 | Tar acids, brown-coal, crude | | | | |
| 157 | 101316-87-4 | Tar oils, coal, low-temp. | | | | |
| 158 | 101317-77-5 | Ethanaminium, 2-[[2-cyclohexyl-2-(1-hydroxycyclooctyl)acetyl]oxy]-N,N-diethyl-N-methyl-, bromide (1:1) | C23H44BrNO3 | 462.51 | | |
| 159 | 101317-78-6 | Ethanaminium,2-(2,3-dicyclohexyl-3-hydroxy-1-oxobutoxy)-N,N-diethyl-N-methyl-, bromide (1:1) | C23H44BrNO3 | 462.50436 | | |
| 160 | 101317-80-0 | 1,1'-Heptamethylenebis[3-methylquinuclidiniumiodide] (7CI) | C23H44I2N2 | 602.4178 | | |
| 161 | 101317-85-5 | Benzothiazolium, 3-methyl-2-[(3-methyl-2(3H)-benzothiazolylidene)amino]-, 4-methylbenzenesulfonate (1:1) | C23H21N3O3S3 | 483.62 | | |
| 162 | 10132-01-1 | 1-Chloro-4-Phenyl-Phthalazine | C14H9ClN2 | 240.69 | 158-159℃ | |
| 163 | 10132-05-5 | 1,4-DIPHENYLPHTHALAZINE | C20H14N2 | | | |
| 164 | 10132-07-7 | 4-Amino-2,6-dichloropyrimidine | C4H3Cl2N3 | 163.99 | 258-267 °C | Slightly soluble in water. |
| 165 | 10132-15-7 | Pyrimidine, 4-(ethylthio)- (7CI,8CI,9CI) | C6H8N2S | 140.20612 | | |
| 166 | 10132-25-9 | Pyrimidine, 2-(ethylthio)- (7CI,8CI,9CI) | C6H8N2S | 140.20612 | | |
| 167 | 10132-28-2 | 2-(butylamino)pyrimidine | C8H13N3 | 151.21 | | |
| 168 | 10132-38-4 | 2,5-Dimethyl-3-(1-methyl)-butylpyrazine | C11H18N2 | 178.27402 | | |
| 169 | 10132-43-1 | Pyrazine, trimethyl(3-methylbutyl)- | C12H20N2 | 192.3 | | |
| 170 | 10132-50-0 | Sulfonium,(carboxymethyl)dimethyl-, chloride (1:1) | C4H9ClO2S | 156.63106 | | |
| 171 | 10132-71-5 | Ethylfluorodimethylsilane | | | | |
| 172 | 10132-80-6 | sodium 2''-(p-aminophenyl)-6-methyl[2,6':2',6''-terbenzothiazole]-7-sulphonate | C28H17N4NaO3S4 | 608.70935 | | |
| 173 | 10132-98-6 | sodium 6-[(3-chloro-2-hydroxy-5-nitrophenyl)azo]-5-hydroxynaphthalene-1-sulphonate | C16H9ClN3NaO7S | 445.76633 | | |
| 174 | 10132-99-7 | sodium 4-[4-[(3-chloro-2-hydroxy-5-nitrophenyl)azo]-4,5-dihydro-3-methyl-5-oxo-1H-pyrazol-1-yl]benzenesulphonate | C16H11ClN5NaO7S | 475.79561 | | |
| 175 | 101320-77-8 | Hydrogenated bisphenol A pentaerythritol phosphite polymer | C38H55O9P | 686.82 | | |
| 176 | 101320-87-0 | 2,5-Dichloro-4-methyl-nicotinonitrile | C7H4Cl2N2 | 187.03 | | |
| 177 | 101321-01-1 | CPZN | C25H19F17O7 | 754.39 | | |
| 178 | 101321-62-4 | 2,1,3-Benzoxadiazole, 4-(2-methyl-1-piperidinyl)-7-nitro- | C12H14N4O3 | 262.26 | | |
| 179 | 1013210-85-9 | 4,5,6,7-TETRAHYDROTHIENO[3,2-C]PYRIDINE-2-CARBONITRILE | C8H8N2S | 164.23 | | |
| 180 | 1013210-86-0 | 4,5,6,7-TETRAHYDROTHIENO[3,2-C]PYRIDINE-2-CARBOXAMIDE | C8H10N2OS | 182.24 | | |
| 181 | 1013211-64-7 | 9H-Fluorene-2,7-diamine, 9,9-dibutyl- | C21H28N2 | 308.46 | | |
| 182 | 1013213-84-7 | 2-(3,4-dimethoxyphenyl)-N-[2-(4-sulfamoylphenyl)ethyl]quinoline-4-carboxamide | C26H25N3O5S | 491.56 | | |
| 183 | 101324-10-1 | 2-Heptenenitrile, 7-bromo-2-methoxy-, (Z)- (9CI) | C8H12BrNO | 218.09 | | |
| 184 | 101324-36-1 | Benzamide, N-[[(6-chloro-2-pyridinyl)amino]thioxomethyl]- | C13H10ClN3OS | 291.76 | | |
| 185 | 101324-39-4 | [1,3,4]Thiadiazolo[3,2-a]-1,2,3-triazolo[4,5-d]pyrimidin-9(3H)-one, 6-(2-phenylethyl)- | C13H10N6OS | 298.32 | | |
| 186 | 101325-00-2 | Diethyl ester carbonic acid polymer with 1,6-hexanediol | C9H20O5 | 208.2521 | | |
| 187 | 101325-14-8 | (S)-α-(4-tert-butylphenyl)ethanol | C12H18O | 178.27072 | | |
| 188 | 101325-37-5 | 9H-Pyrrolo[2,3-f]quinoxaline | C10H7N3 | | | |
| 189 | 101325-82-0 | 4-(1,3-dioxooctahydro-2H-isoindol-2-yl)benzoic acid | C15H15NO4 | 273.28 | | |
| 190 | 1013252-85-1 | 2-(2,2-DIMETHYLPROPANOYL)-3-(3-METHOXY-4-((4-NITROPHENYL)METHOXY)PHENYL)PROP-2-ENENITRILE | C22H22N2O5 | 394.42 | | |
| 191 | 101327-84-8 | 1-Nitro-2-Naphthaldehyde | C11H7NO3 | 201.18 | 109-110 °C(lit.) | |
| 192 | 101327-85-9 | 5-NITROQUINOLINE-6-CARBALDEHYDE | C10H6N2O3 | 202.17 | | |
| 193 | 101327-87-1 | 7-Formyl-8-Nitroquinoline | C10H6N2O3 | 202.17 | 180℃ | |
| 194 | 101327-89-3 | 5-Nonanone, 4-fluoro- | C9H17FO | | | |
| 195 | 101327-98-4 | Methyl 1-Methyl-2-oxopiperidine-3-carboxylate | C8H13NO3 | 171.19372 | | |
| 196 | 101328-12-5 | Cyclohexanone, 2,6-dimethyl-4-nitro-3-phenyl-, (2R,3S,4S,6R)-rel- | C14H17NO3 | 247.29 | | |
| 197 | 101328-75-0 | Ergoline, 8,9-didehydro-6,8-dimethyl-1-pentyl- (9CI) | C21H28N2 | 308.46 | | |
| 198 | 101328-84-1 | (S)-3(2h)-Pyridazinone, 6-(4-Aminophenyl)-4,5-Dihydro-5-Methyl- | C11H13N3O | 203.24 | | |
| 199 | 101328-85-2 | 6-(4-Aminophenyl)-4,5-dihydro-5-mehtyl-3(2H)-pyridazinone | C11H13N3O | 203.24 | 206-208°C | |
| 200 | 101328-96-5 | 4-Cyclopentene-1,3-dione, 2,2-dichloro- | C5H2Cl2O2 | | | |
| 201 | 101328-98-7 | 2,4-Dichlorobenzene-1,3,5-triol | C6H4Cl2O3 | 195 | | |
| 202 | 101329-30-0 | 2,6-Dibromo-4-isopropylphenyl(2,3-epoxypropan-1-yl) ether | C12H14Br2O2 | | | |
| 203 | 101329-50-4 | bryotoxin A | C32H42O12 | 618.67 | | |
| 204 | 101329-54-8 | 2,2'-(3,3'-dimethoxybiphenyl-4,4'-diyl)bis(3,5-diphenyl-2,3-dihydro-1H-tetrazole) dihydrochloride | C40H36Cl2N8O2 | 731.672 | | |
| 205 | 101329-81-1 | (2-Chloro-4-fluoro-5-nitro-phenyl)-methanol | C7H5ClFNO3 | 205.57 | | |
| 206 | 101329-82-2 | Benzenemethanol, 5-amino-2-chloro-4-fluoro- | C7H7ClFNO | 175.59 | | |
| 207 | 101329-87-7 | Cyclopentanecarboxamide, 1-(phenylthio)- | C12H15NOS | 221.32 | | |
| 208 | 101329-89-9 | Cyclopentanecarboxamide, N,N-diethyl-1-(phenylthio)- | C16H23NOS | 277.42 | | |
| 209 | 101329-90-2 | Methanone, [1-(phenylthio)cyclopentyl]-1-pyrrolidinyl- | C16H21NOS | 275.41 | | |
| 210 | 101329-93-5 | 1-(Phenylthio)cyclopentanecarboxylic acid 2-(dimethylamino)ethyl ester oxalate | C18H25NO6S | | | |
| 211 | 10133-06-9 | Methyl Epoxycrotonate | C5H8O3 | 116.12 | | |
| 212 | 10133-19-4 | 4-(Bromomethyl)benzo[b]thiophene | C9H7BrS | 227.12088 | | |
| 213 | 10133-20-7 | Benzo[b]thiophene, 2-(broMoMethyl)- | C9H7BrS | 227.12 | | |
| 214 | 10133-22-9 | 5-(Bromomethyl)benzo[b]thiophene | C9H7BrS | 227.12 | | |
| 215 | 10133-24-1 | 7-BROMOMETHYL-BENZO[B]THIOPHENE | C9H7BrS | 227.12 | 44 °C | |
| 216 | 10133-25-2 | Benzo[b]thiophene-4-carbaldehyde | C9H6OS | 162.21 | 34 °C | |
| 217 | 10133-30-9 | 1-BENZOTHIOPHENE-5-CARBALDEHYDE | C9H6OS | 162.21 | 53 °C | |
| 218 | 10133-34-3 | 4-Nitro-1-benzothiophene | C8H5NO2S | 179.2 | | |
| 219 | 10133-35-4 | Benzo[b]thiophene-3-ol,2-nitro- | C8H5NO3S | 195.1952 | | |
| 220 | 10133-36-5 | 2-NITRO-BENZO[B]THIOPHEN-3-YLAMINE | C8H6N2O2S | 194.21 | | |
| 221 | 10133-37-6 | Benzo[b]thiophen-3-amine,2-nitro-N-phenyl- | C14H10N2O2S | 270.31 | | |
| 222 | 10133-41-2 | Benzo[b]thiophene, 2-chloro-, 1,1-dioxide | C8H5ClO2S | 200.64 | | |
| 223 | 10133-50-3 | 4-(prop-1-en-2-yl)benzaldehyde | C10H10O | 146.19 | | |
| 224 | 10133-62-7 | 2-Propenoic acid, 3,3'-(1,3-phenylene)bis-, dimethyl ester (9CI) | C14H14O4 | 246.26 | | |
| 225 | 10133-74-1 | Benzeneethanamine, 3,4-dimethoxy-N-(phenylmethylene)- | C17H19NO2 | 269.34 | | |
| 226 | 10133-81-0 | 9H-Thioxanthene 10-oxide | C13H10OS | 214.28 | | |
| 227 | 10133-83-2 | 3-Isoquinolinecarboxylic acid, 1,2-dihydro-4-hydroxy-7-nitro-1-oxo-, methyl ester | C11H8N2O6 | 264.19 | | |
| 228 | 10133-85-4 | 2-(5-Amino-1,3-dioxoisoindolin-2-yl)acetic acid | C10H8N2O4 | 220.18 | | |
| 229 | 10133-86-5 | (4-AMINO-1,3-DIOXO-1,3-DIHYDRO-ISOINDOL-2-YL)-ACETIC ACID | C10H8N2O4 | 220.18 | | |
| 230 | 10133-88-7 | (5-NITRO-1,3-DIOXO-1,3-DIHYDRO-2H-ISOINDOL-2-YL)ACETIC ACID | C10H6N2O6 | 250.16 | | |
| 231 | 101330-04-5 | Benzenepropanoic acid, α-(phenylthio)-, 2-(dimethylamino)ethyl ester, (2R,3R)-2,3-dihydroxybutanedioate (1:1) (9CI) | C23H29NO8S | 479.54 | | |
| 232 | 101330-07-8 | Cyclopentanecarboxamide, N-[2-(dimethylamino)ethyl]-1-(phenylthio)-, hydrochloride (1:1) | C16H25ClN2OS | 328.9 | | |
| 233 | 101330-08-9 | Cyclopentanecarboxylicacid, 1-(phenylthio)-, 2-(diethylamino)ethyl ester, hydrochloride (1:1) | C18H28ClNO2S | 357.937 | | |
| 234 | 101330-09-0 | Cyclohexanecarboxylicacid, 1-(phenylthio)-, 2-(dimethylamino)ethyl ester, hydrochloride (1:1) | C17H26ClNO2S | 343.91 | | |
| 235 | 101330-11-4 | (2-Iodoquinolin-3-yl)-methanol | C10H8INO | 285.08 | | |
| 236 | 101330-34-1 | amiloride caproate | C12H18ClN7O3 | 343.76942 | | |
| 237 | 101330-69-2 | 3'-O-Methylbatatasin III | C16H18O3 | 258.31 | | |
| 238 | 101330-77-2 | 4H-1-Benzopyran-4-one, 3-((2-O-(6-deoxy-alpha-L-mannopyranosyl)-beta-D -glucopyranosyl)oxy)-2-(3,4-dihydroxyphenyl)-5-hydroxy-7-methoxy- | C28H32O16 | 624.54408 | | |
| 239 | 101331-92-4 | 1,3-Dioxolane-4-carboxaldehyde, 5-[[[(1,1-dimethylethyl)diphenylsilyl]oxy]methyl]-2,2-dimethyl-, (4R,5S)- | C23H30O4Si | 398.57 | | |
| 240 | 101332-77-8 | D-Gluconic acid, compd. with N,N''-bis(4-chlorophenyl)-3,12-diimino-2,4,11,13-tetraazatetradecanediimidamide (2:1), mixt. with 13-methyl[1,3]benzodioxolo[5,6-c]-1,3-dioxolo[4,5-i]phenanthridinium chloride (9CI) | C48H56Cl3N11O11 | 1069.39 | | |
| 241 | 1013326-59-4 | (2S,3S,4S,5R,6R)-3,4,5-tris(Benzyloxy)-6-((benzyloxy)methyl)tetrahydro-2H-pyran-2-amine | | | | |
| 242 | 101333-27-1 | 1H-Pyrrolehomopolymerion(1+)salt with | | | | |
| 243 | 101333-98-6 | BENZO[D]OXAZOL-2-YLMETHANAMINE | C8H8N2O | 148.16 | 120-122 °C | |
| 244 | 1013330-27-2 | 1-Benzyl-4-phenyl-4-piperidinecarboxylic Acid Hydrochloride | C19H22ClNO2 | 331.84 | | |
| 245 | 1013330-69-2 | N-[[4-[[[4-[[tert-Butyloxycarbonyl]aMino][1,1'-biphenyl]-3-yl]aMino]carbonyl]phenyl]Methyl]carbaMic Acid Methyl Ester | C27H29N3O5 | 475.53626 | | |
| 246 | 1013330-79-4 | CarbaMic acid, N-[[4-[[(4-aMino[1,1'-biphenyl]-3-yl)aMino]carbonyl]phenyl]Methyl]-, Methyl ester | C22H21N3O3 | 375.42044 | | |
| 247 | 1013330-84-1 | methyl 4-((2-amino-5-(thiophen-2-yl)phenyl)carbamoyl)benzylcarbamate | C20H19N3O3S | 381.45 | | |
| 248 | 1013333-20-4 | 4-Piperidinecarbonitrile, 3-hydroxy-1-(phenylMethyl)-, (3R,4R)-rel- | C13H16N2O | 216.29 | | |
| 249 | 1013333-23-7 | trans-4-(aminomethyl)piperidin-3-ol dihydrochloride | C6H16Cl2N2O | 203.11004 | | |
| 250 | 1013333-61-3 | tert-butyl 6,7-diMethyl-4- oxo-3,4-dihydro-1η-spiro[chroMene-2,4'-piperidine]-1'-carboxylate | C20H27NO4 | 345.43268 | | |
| 251 | 1013334-96-7 | tert-butyl 4-oxo-3,4-dihydrospiro[1-benzopyran-2,3'-pyrrolidine]-1'-carboxylate | C17H21NO4 | 303.35 | | |
| 252 | 1013335-78-8 | 5-Bromopyrimidine-2-carbonyl chloride | C5H2BrClN2O | 221.44 | | |
| 253 | 101335-11-9 | 2-CHLORO-4-FLUOROIODOBENZENE | C6H3ClFI | 256.44 | | |
| 254 | 101335-24-4 | 1-(benzyloxy)piperidin-2-one | C12H15NO2 | 205.25 | | |
| 255 | 101335-99-3 | Eprovafen | C18H22O2S | 302.436 | | |
| 256 | 1013353-70-2 | BETA-OXO-1-CBZ-4-PIPERIDINEPROPANOIC ACID METHYL ESTER | C17H21NO5 | 319.35 | | |
| 257 | 1013353-73-5 | BETA-OXO-1-CBZ-2-PYRROLIDINEPROPANOIC ACID METHYL ESTER | C16H19NO5 | 305.33 | | |
| 258 | 101336-14-5 | Benzoic acid, 2-amino-3-fluoro-5-nitro- (9CI) | C7H5FN2O4 | 200.1240032 | | |
| 259 | 101336-15-6 | (2-Chloro-3-fluoro-5-nitro-phenyl)-methanol | C7H3ClFNO4 | 219.55 | | |
| 260 | 101336-61-2 | Phosphonium, (6-ethoxy-6-oxohexyl)triphenyl-, bromide (1:1) | C26H30BrO2P | 485.4 | | |
| 261 | 101336-63-4 | 2-chloro-5-[[(2Z)-2-(nitromethylidene)imidazolidin-1-yl]methyl]pyridine | C10H11ClN4O2 | 254.67 | | |
| 262 | 101336-64-5 | Pyrimidine,1-[(6-chloro-3-pyridinyl)methyl]hexahydro-2-(nitromethylene)- | C11H13ClN4O2 | 268.70 | 114-116 °C | |
| 263 | 101337-87-5 | N-desmethylrufloxacin | C16H16FN3O3S | 349.3799432 | | |
| 264 | 101337-92-2 | 6-CHLORO-5-FLUOROBENZIMIDAZOLE-2-THIOL | C7H4ClFN2S | 202.64 | 298~301℃ | |
| 265 | 101337-93-3 | 2-Benzothiazolamine,7-chloro-6-fluoro-(9CI) | C7H4ClFN2S | 202.64 | | |
| 266 | 101338-14-1 | 1,3,5-Triazin-2-amine,4-methoxy-6-(2,2,2-trifluoroethoxy)- | C6H7F3N4O2 | 224.1405896 | | |
| 267 | 101339-26-8 | irisoquin | C25H42O4 | 406.59858 | | |
| 268 | 101339-27-9 | 2,5-Cyclohexadiene-1,4-dione, 2-methoxy-6-octadecyl- | C25H42O3 | 390.6 | | |
| 269 | 101339-37-1 | [4,8'-Bi-2H-1-benzopyran]-3,3',5,5',7,7'-hexol,3,3',4,4'-tetrahydro-2,2'-bis(4-hydroxyphenyl)-, (2R,2'R,3S,3'S,4S)- | C30H26O10 | 546.52144 | | |
| 270 | 101339-66-6 | 4-CHLOROBENZAMIDRAZONE HYDROIODIDE | | | | |
| 271 | 1013398-14-5 | N-[(1-BENZYL-1H-BENZIMIDAZOL-2-YL)CARBONYL]GLYCINE | C17H15N3O3 | 309.32 | | |
| 272 | 1013398-17-8 | METHYL N-(1H-BENZIMIDAZOL-2-YLCARBONYL)GLYCINATE | C11H11N3O3 | 233.22 | | |
| 273 | 1013398-57-6 | 5-Fluoro-2,3-dihydro-1H-indole hydrochloride | C8H9ClFN | 173.6151632 | | |
| 274 | 1013398-58-7 | 5-Chloro-2,3-dihydro-1H-indolehydrochloride | C8H9Cl2N | 190.06976 | | |
| 275 | 1013398-82-7 | SAPINDUS MUKUROSSI | | | | |
| 276 | 10134-01-7 | Methanone,(3-bromo-4-methoxyphenyl)-1-isoquinolinyl- | C17H12BrNO2 | 342.18668 | | |
| 277 | 10134-33-5 | trisodium 8-[(7-amino-1-hydroxy-3-sulphonato-2-naphthyl)azo]-5-[[4-(phenylazo)-7-sulphonatonaphthyl]azo]naphthalene-2-sulphonate | C36H22N7Na3O10S3 | 877.76509 | | |
| 278 | 10134-35-7 | disodium 5-bromo-2-[9-chloro-3-(sulphonatooxy)naphtho[1,2-b]thien-2-yl]-1H-indol-3-yl sulphate | C20H9BrClNNa2O8S3 | 648.8189 | | |
| 279 | 10134-52-8 | 6H-Benzo[g]-1,3-benzodioxolo[5,6-a]quinolizin-8-ol, 5,8-dihydro-9,10-dimethoxy- | C20H19NO5 | 353.37 | | |
| 280 | 10134-59-5 | Arlindone Yellow HCG | C18H12Cl2N2Na2O8S2 | 565.31202 | | |
| 281 | 10134-60-8 | 3-Acridinamine, 9-(4-aminophenyl)-7-methyl-, nitrate (1:1) | C20H18N4O3 | 362.39 | | |
| 282 | 10134-62-0 | N-[4-[(3-Carboxylato-4-hydroxyphenyl)[4-(dimethylamino)phenyl]methylene]-2,5-cyclohexadien-1-ylidene]-N-methylmethanaminium | C24H25N2O3+ | 389.4669 | | |
| 283 | 10134-91-5 | BENZO[B]THIOPHENE-7-CARBALDEHYDE | C9H6OS | 162.21 | 42 °C | |
| 284 | 10134-95-9 | BENZOTHIOPHENE-4-CARBOXYLIC ACID | C9H6O2S | 178.21 | 188-189℃ | |
| 285 | 10134-98-2 | 1-benzothiophene-7-carboxylic acid | C9H6O2S | 178.21 | 176.5 °C | |
| 286 | 101340-84-5 | 2(1H)-Quinolinone, 7-(dimethylamino)- | C11H12N2O | 188.23 | | |
| 287 | 1013405-24-7 | 2,6-bis(3-(9H-carbazol-9-yl)phenyl)pyridine | C41H27N3 | 561.67 | 228.0 to 232.0 °C | |
| 288 | 1013405-25-8 | 3,5-bis(3-(9H-carbazol-9-yl)phenyl)pyridine | C41H27N3 | 561.67 | 237 °C | |
| 289 | 1013405-26-9 | Furost-25-en-6-one, 27-(β-D-glucopyranosyloxy)-1,2,3,4,5,7,22-heptahydroxy-, (1β,2β,3β,4β,5β,7α,22α)- | C33H52O15 | 688.76 | | |
| 290 | 1013405-79-2 | 3-[3-(Benzyloxy)phenyl]phenylacetic acid | C21H18O3 | 318.37 | | |
| 291 | 101341-45-1 | 3-(4-Cyano-phenyl)-3-oxo-propionic acid methyl ester | C11H9NO3 | 203.19 | 98-99°C | |
| 292 | 101342-45-4 | 4-Epichlortetracycline Hydrochloride | C22H23ClN2O8.ClH | 515.344 | >250°C | |
| 293 | 101342-46-5 | Acetamide, N-(10-butoxy-5,6,7,9-tetrahydro-1,2,3-trimethoxy-9-oxobenzo[a]heptalen-7-yl)-, (S)- (9CI) | C25H31NO6 | 441.52 | | |
| 294 | 101342-76-1 | BIS(1-BUTYLPENTYL) DECANE-1,10-DIYL DIGLUTARATE | C38H70O8 | 654.96 | | |
| 295 | 101342-80-7 | PN 202-791 | C17H18N4O5 | 358.34862 | | |
| 296 | 101342-90-9 | azinothricin | C49H80N8O15 | 1021.21 | | |
| 297 | 101342-93-2 | 4-hydroxycibenzoline | C18H18N2O | 278.35 | | |
| 298 | 101342-94-3 | lactoquinomycin B | C24H27NO9 | 473.47 | | |
| 299 | 1013420-86-4 | (2,5-dioxopyrrolidine-1-yl)-oxy 4,6-di-O-acetyl-2,3-dideoxy-α-D-erythro-hex-2-enopyranoside | | | | |
| 300 | 1013427-04-7 | Pyrazolo[1,5-a]pyrimidine, 7-(1-ethylpropyl)-3-iodo-2,5-dimethyl- | C13H18IN3 | 343.21 | | |
| 301 | 1013427-48-9 | Cyclopent[f]isoindol-1(2H)-one, 3,5,6,7-tetrahydro-3-[2-(4-methyl-1-piperazinyl)-2-oxoethyl]-2-phenyl-, (3R)- | C24H27N3O2 | 389.49 | | |
| 302 | 101343-69-5 | Ocfentanil | C22H27FN2O2 | 370.46 | | |
| 303 | 101345-66-8 | N-(1-Phenethylpiperidin-4-yl)-N-phenylfuran-2-carboxamide | | | | |
| 304 | 101345-66-8 | N-(1-Phenethylpiperidin-4-yl)-N-phenylfuran-2-carboxamide | | | | |
| 305 | 101345-66-8 | Furanylfentanyl | | | | |
| 306 | 101345-67-9 | 2-Methoxy-N-(1-phenethylpiperidin-4-yl)-N-phenylacetamide | C22H28N2O2 | 352.47 | | |
| 307 | 101345-71-5 | Brifentanil | C20H29FN6O3 | 420.486 | | |
| 308 | 101345-75-9 | para-chloro Methoxyacetyl fentanyl (hydrochloride) | C22H28Cl2N2O2 | 423.37592 | | |
| 309 | 101346-02-5 | Pyrimidine, 5-(chloromethyl) | C5H5ClN2 | 128.56 | | |
| 310 | 101347-05-1 | JM 1596 | H2KO70P2W18Zn4(-9) | 4793.64 | | |
| 311 | 101347-44-8 | 1,4,7,10-Tetraoxa-13-azacyclopentadecane, 13-[bis(1-aziridinyl)phosphinyl]- | C14H28N3O5P | 349.36 | | |
| 312 | 101347-71-1 | Pyrrolidine, 1-acetyl-4-ethyl-2-methyl-, cis- (9CI) | C9H17NO | 155.24 | | |
| 313 | 101347-72-2 | Pyrrolidine, 1-acetyl-4-ethyl-2-methyl-, trans- (9CI) | C9H17NO | 155.24 | | |
| 314 | 101347-86-8 | 5-(3-buten-1-yl)-2-Pyrrolidinone | C8H13NO | 139.19492 | | |
| 315 | 101347-89-1 | 2-Azetidinone,4-(3-butenyl)-3-(1-methylethyl)-(9CI) | C10H17NO | 167.25 | | |
| 316 | 1013470-68-2 | 3',5'-Bis-O-benzoyl-2'-deoxy-2'-fluoro--D-arabino-6-azidouridine | C22H18FN3O7 | 455.4 | | |
| 317 | 101349-12-6 | 2-(5-FLUORO-1H-INDOL-3-YL)ETHANOL | C10H10FNO | 179.19 | 89-91℃ | |
| 318 | 101349-15-9 | 2H-Indol-2-one, 1,3-dihydro-3,5-diMethyl- | C10H11NO | 161.2 | | |
| 319 | 101349-30-8 | (4-Amino-3-chloro-phenyl)-acetic acid methyl ester | C9H10ClNO2 | 199.63 | | |
| 320 | 101349-37-5 | Benzeneacetic acid, 2-amino-3-chloro-, methyl ester | C9H10ClNO2 | 199.63 | | |
| 321 | 101349-59-1 | 1-Naphthaleneacetic acid, α-methyl-, ethyl ester | C15H16O2 | 228.29 | | |
| 322 | 101349-60-4 | 2-(1-Naphthyl)-1-propanol | C13H14O | 186.25 | | |
| 323 | 101349-71-7 | 4-Chloro-3-Methylbenzaldehyde | C8H7ClO | 154.59 | 27-28°C | |
| 324 | 101349-72-8 | 1,4,4-Trichloro-1-butene | C4H5Cl3 | 159.44 | | |
| 325 | 101349-74-0 | Butanedioic acid, 2,2-dibromo- | C4H4Br2O4 | 275.88 | | |
| 326 | 101349-82-0 | Benzonitrile, 5-hydroxy-2-Methyl- | C8H7NO | 133.15 | | |
| 327 | 101349-84-2 | Benzoic acid, 4-[(chloromethyl)sulfonyl]- | C8H7ClO4S | 234.66 | | |
| 328 | 101349-85-3 | 1,3-Dichloro-5-ethoxy-2-iodobenzene | | | | |
| 329 | 101349-88-6 | 4(1H)-Pyridinone, 1-hydroxy- | C5H5NO2 | 111.1 | | |
| 330 | 101349-95-5 | 2-CHLORO-4-(METHYLSULFONYL)BENZALDEHYDE | C8H7ClO3S | 218.657 | 137-138°C | |
| 331 | 10135-00-9 | 3-Bromobenzothiophene-2-carboxaldehyde | C9H5BrOS | 241.104 | | |
| 332 | 10135-17-8 | 3-phenethyloxazolidin-2-one | C11H13NO2 | | | |
| 333 | 10135-23-6 | 1-PHENETHYL-PYRROLIDIN-2-ONE | C12H15NO | 189.25 | | |
| 334 | 10135-38-3 | 3,3,5,5-Tetramethyl-1-Pyrroline N-Oxide | C8H15NO | 141.21 | 58-61°C(lit.) | |
| 335 | 10135-84-9 | Ammonium biborate tetrahydrate | B4H16N2O11 | 263.38 | | soluble H2O [HAW93] |
| 336 | 101350-43-0 | N-(2-Oxazolin-2-yl)fluoren-9-amine | C16H14N2O | 250.29516 | | |
| 337 | 101350-46-3 | Methanone, (4,5-dihydro-5-phenyl-1H-pyrazol-1-yl)phenyl- | C16H14N2O | 250.3 | | |
| 338 | 101350-63-4 | (1E,1'E)-1-(6-((E)-1-(hydroxyiMino)ethyl)biphenylen-2-yl)ethanone oxiMe | C16H14N2O2 | 266.29 | | |
| 339 | 101350-81-6 | 4(3H)-Quinazolinone, 3-benzyl-8-hydroxy-2-methyl- (6CI) | C16H14N2O2 | 266.29 | | |
| 340 | 101350-83-8 | 4(3H)-Quinazolinone, 8-methoxy-2-methyl-3-phenyl- | C16H14N2O2 | 266.29 | | |
| 341 | 101350-88-3 | 2-(3-oxo-3,4-dihydro-2H-1,4-benzothiazin-2-yl)-N-phenylacetamide | C16H14N2O2S | 298.36 | | |
| 342 | 101351-09-1 | 2-[2-(4-aminophenoxy)ethyl]isoindole-1,3-dione | C16H14N2O3 | 282.29 | | |
| 343 | 101351-11-5 | 1H-Pyrazole-3-carboxylic acid, 5-(2-furanyl)-1-phenyl-, ethyl ester | C16H14N2O3 | 282.29 | | |
| 344 | 101351-18-2 | Benzeneacetic acid, 4,4'-(1,2-diazenediyl)bis- | C16H14N2O4 | 298.29 | | |
| 345 | 1013528-93-2 | (E)-4-(((4,6-dimethylpyrimidin-2-yl)thio)methyl)-N'-(1-(4-methyl-3-nitrophenyl)ethylidene)benzohydrazide | C23H23N5O3S | 449.52542 | | |
| 346 | 101353-28-0 | Benzene, 1-chloro-4-[[1-methyl-1-(phenylthio)ethyl]thio]- | C15H15ClS2 | 294.86 | | |
| 347 | 101353-61-1 | endo-N-Benzyl-endo-3-aminotropane | C15H22N2 | 230.35 | | |
| 348 | 101355-49-1 | 1-Naphthaleneethanamine, 1,2,3,4-tetrahydro-N,N,1-trimethyl- | C15H23N | 217.35 | | |
| 349 | 101355-67-3 | Benzenemethanamine, 4-(cyclohexyloxy)-α,3-dimethyl- | C15H23NO | 233.35 | | |
| 350 | 101356-02-9 | Piperidine,1-[3-(2-methoxyphenyl)propyl]-, hydrochloride (1:1) | C15H24ClNO | 269.81 | | |
| 351 | 101356-13-2 | 1-ethyl-2,5-dimethyl-4-phenyl-4-piperidinol | C15H23NO | 233.34922 | | |
| 352 | 101356-61-0 | Morpholine,4-[2-(2-methoxy-5-methylphenyl)-1-methylethyl]-, hydrochloride (1:1) | C15H24ClNO2 | 285.812 | | |
| 353 | 101356-69-8 | Benzeneethanol, β-[(dimethylamino)methyl]-β-ethyl-, 1-acetate, hydrochloride (1:1) | C15H24ClNO2 | 285.81 | | |
| 354 | 101356-75-6 | 1-(BENZYLOXY)-3-PIPERIDIN-1-YLPROPAN-2-OL HYDROCHLORIDE | C15H24ClNO2 | 285.81 | | |
| 355 | 101356-94-9 | Barium oxide (BaO), solid soln. with calcium oxide, magnesium oxide, phosphorus oxide (P2O5), strontium oxide and zinc oxide, cerium and manganese-doped | | | | |
| 356 | 101356-95-0 | Barium oxide (BaO), solid soln. with calcium oxide, magnesium oxide, phosphorus oxide (P2O5), strontium oxide and zinc oxide, cerium and terbium-doped | | | | |
| 357 | 101356-96-1 | Barium oxide (BaO), solid soln. with calcium oxide, magnesium oxide, phosphorus oxide (P2O5), strontium oxide and zinc oxide, copper-doped | | | | |
| 358 | 101356-97-2 | Barium oxide (BaO), solid soln. with calcium oxide, magnesium oxide, phosphorus oxide (P2O5), strontium oxide and zinc oxide, europium-doped | | | | |
| 359 | 101356-98-3 | Barium oxide (BaO), solid soln. with calcium oxide, magnesium oxide, phosphorus oxide (P2O5), strontium oxide and zinc oxide, tin-doped | | | | |
| 360 | 101356-99-4 | Cadmium oxide (CdO), solid soln. with calcium oxide and titanium oxide (TiO2), praseodymium-doped | | | | |
| 361 | 1013566-44-3 | 1-(4-CHLOROPHENYL)-3-(2-MORPHOLIN-4-YL-5-(TRIFLUOROMETHYL)PHENYL)THIOUREA | C18H17ClF3N3OS | 415.86 | | |
| 362 | 101357-00-0 | Cadmium selenide (CdSe), solid soln. with cadmium sulfide, zinc selenide and zinc sulfide, aluminum and copper-doped | | | | |
| 363 | 101357-01-1 | Cadmium selenide (CdSe), solid soln. with cadmium sulfide, zinc selenide and zinc sulfide, copper and manganese-doped | | | | |
| 364 | 101357-02-2 | Cadmium selenide (CdSe), solid soln. with cadmium sulfide, zinc selenide and zinc sulfide, europium-doped | | | | |
| 365 | 101357-03-3 | Cadmium selenide (CdSe), solid soln. with cadmium sulfide, zinc selenide and zinc sulfide, gold and manganese-doped | | | | |
| 366 | 101357-04-4 | Cadmium selenide (CdSe), solid soln. with cadmium sulfide, zinc selenide and zinc sulfide, manganese and silver-doped | | | | |
| 367 | 101357-05-5 | Calcium oxide (CaO), solid soln. with silica, strontium oxide and zinc oxide, cerium and manganese-doped | | | | |
| 368 | 101357-06-6 | Calcium oxide (CaO), solid soln. with silica, strontium oxide and zinc oxide, cerium and terbium-doped | | | | |
| 369 | 101357-07-7 | Calcium sulfide (CaS), solid soln. with strontium sulfide, bismuth and europium-doped | CaS | 72.143 | | |
| 370 | 101357-08-8 | Carbonic acid, manganese(2+) salt (1:1), solid soln. with aluminum oxide and cerium oxide (CeO2), chromium-doped | | | | |
| 371 | 101357-09-9 | Gadolinium oxide (Gd2O3), solid soln. with lanthanum oxide (La2O3) and yttrium oxide, europium-doped | | | | |
| 372 | 101357-10-2 | Gadolinium oxide (Gd2O3), solid soln. with lanthanum oxide (La2O3) and yttrium oxide, terbium-doped | | | | |
| 373 | 101357-11-3 | Gadolinium oxide (Gd2O3), solid soln. with lanthanum oxide (La2O3), sulfur and yttrium oxide, europium-doped | | | | |
| 374 | 101357-12-4 | Gadolinium oxide (Gd2O3), solid soln. with lanthanum oxide (La2O3), sulfur and yttrium oxide, terbium-doped | | | | |
| 375 | 101357-13-5 | Germanium oxide (GeO2), solid soln. with magnesium fluoride and magnesium oxide, manganese-doped | | | | |
| 376 | 101357-15-7 | Benzenamine, reaction products with aniline hydrochloride and nitrobenzene | C18H20ClN3O2 | 345.83 | | |
| 377 | 101357-16-8 | Benzenamine, reaction products with aniline hydrochloride and nitrobenzene, hydrochlorides | C18H21Cl2N3O2 | 382.29 | | |
| 378 | 101357-17-9 | Benzenamine, N,N-dimethyl-, oxidized | C8H11N | 121.17964 | | |
| 379 | 101357-18-0 | Benzenamine, N,N-dimethyl-, oxidized, hydrochlorides | | | | |
| 380 | 101357-19-1 | Benzenamine, N,N-dimethyl-, oxidized, molybdatetungstatephosphates | C8H11N | 121.17964 | | |
| 381 | 101357-20-4 | Iron, cyano oxalate complexes | | | | |
| 382 | 101357-21-5 | Phenol, 2-amino-4,6-dinitro-, reaction products with 2,4-dinitrophenol and sodium sulfide (Na2(Sx)) | | | | |
| 383 | 101357-22-6 | Phenol, 2-amino-4,6-dinitro-, reaction products with 2,4-dinitrophenol and sodium sulfide (Na2(Sx)), reduced | | | | |
| 384 | 101357-23-7 | Phenol, methylnitro-, reaction products with aniline and aniline hydrochloride | | | | |
| 385 | 101357-24-8 | Phenol, methylnitro-, reaction products with aniline and aniline hydrochloride, hydrochlorides | | | | |
| 386 | 101357-25-9 | Phenol, 2,4,6-trinitro-, reaction products with 2,4-dinitrophenol and sodium sulfide (Na2(Sx)) | | | | |
| 387 | 101357-26-0 | Phenol, 2,4,6-trinitro-, reaction products with 2,4-dinitrophenol and sodium sulfide (Na2(Sx)), reduced | | | | |
| 388 | 101357-27-1 | Silicic acid, aluminum lithium salt, sulfurized | | | | |
| 389 | 101357-28-2 | Silicic acid, aluminum potassium salt, sulfurized | | | | |
| 390 | 101357-29-3 | Silicic acid, aluminum silver salt, sulfurized | | | | |
| 391 | 101357-30-6 | Silicic acid aluminum sodium salt sulfurized | | | | |
| 392 | 101357-31-7 | Sulfuric acid, reaction products with aniline, aniline hydrochloride and methylnitrophenol, sodium salts | | | | |
| 393 | 101357-32-8 | NIGROSINE, WATER SOLUBLE, C.I. 50420, FOR MICROSCOPY | C18H23ClN3NaO6S | 467.9 | | |
| 394 | 101357-33-9 | Sulfuric acid, reaction products with aniline, aniline hydrochloride and 4-(phenylazo)benzenamine, sodium salts | C24H29ClN5NaO4S | 542.03 | | |
| 395 | 101357-35-1 | Sulfuric acid, reaction products with 6-methylquinoline and quinoline | C19H18N2O4S | 370.42 | | |
| 396 | 101357-36-2 | 1,2,3,4-Butanetetracarboxylic acid, polymer with 2,2-bis(hydroxymethyl)-1,3-propanediol and 3-hydroxy-2,2-dimethylpropanal, 1,2,2,6,6-pentamethyl-4-piperidinyl ester | C28H51NO14 | 625.70284 | | |
| 397 | 101357-37-3 | 1,2,3,4-Butanetetracarboxylic acid polymer with 2,2-bis(hydroxymethyl)-1,3-propane- diol and 3-hydroxy-2,2-dimethylpropanal, 2,2,6,6-tetramethyl-4-piperidinyl ester | C27H49NO14 | 611.67626 | | |
| 398 | 1013573-81-3 | 1013573-81-3 | C13H11BrClNO2S | 360.65394 | | |
| 399 | 101358-16-1 | 3,5,6-Triphenyl-2,3,5,6-tetraazabicyclo[2.1.1]hex-1-ene | C20H16N4 | 312.36784 | | |
| 400 | 101359-12-0 | 2,2,4,4,6,6-Hexabutyl-1,3,5,2,4,6-triselenatristannin | C24H54Se3Sn3 | 935.69 | | |
| 401 | 101359-27-7 | 1H,5H-Benzo[ij]quinolizin-2-ol, 2,3,6,7-tetrahydro- | C12H15NO | 189.25 | | |
| 402 | 101359-68-6 | actinopyrone A | C25H36O4 | 400.55094 | | |
| 403 | 101359-69-7 | actinopyrone B | C24H34O4 | 386.52436 | | |
| 404 | 101359-70-0 | actinopyrone C | C26H38O4 | 414.57752 | | |
| 405 | 101359-79-9 | aponeocarzinostatin | | | | |
| 406 | 101359-87-9 | MERCAPTAN-TERMINATED POLYMER | | | | |
| 407 | 101359-93-7 | sialyl-fucosyl-lacto-N-norhexaosylceramide | | | | |
| 408 | 10136-17-1 | NSC82139 | C20H27FO3 | 334.4249832 | | |
| 409 | 10136-57-9 | 5-(CHLOROMETHYL)QUINOLIN-8-OL HYDROCHLORIDE | C10H8ClNO | | | |
| 410 | 10136-59-1 | Urea, N-(3-chloropropyl)-N'-(5-nitro-2-thiazolyl)- | C7H9ClN4O3S | 264.69 | | |
| 411 | 10136-64-8 | 6-PHENYL-IMIDAZO[2,1-B][1,3,4]THIADIAZOL-2-YLAMINE | C10H8N4S | 216.26 | | |
| 412 | 10136-65-9 | 2-hydroxy-2,6,6-trimethylbicyclo[3.1.1]heptan-3-one | C10H16O2 | 168.23284 | 38.5 °C | |
| 413 | 10136-69-3 | Mercury,bis(2-pyrrolidinonato)- (8CI) | C8H12HgN2O2 | 368.78308 | | |
| 414 | 101360-40-1 | Quinifur | C25H34N4O12P2 | 644.504582 | | |
| 415 | 101361-01-7 | Ethanaminium,N,N-diethyl-N-methyl-2-[[[1-(phenylthio)cyclobutyl]carbonyl]oxy]-, iodide (1:1) | C18H28INO2S | 449.38989 | | |
| 416 | 101362-24-7 | Busan 1009 | C12H8N4S5 | 368.52 | | |
| 417 | 1013620-81-9 | N (2 - amino - 5 - methyl phenyl) -3- pyridine | C13H13N3O | 227.26 | | |
| 418 | 1013621-67-4 | RN15796148 | C23 H34 O4 Si | 402.6 | | |
| 419 | 1013621-70-9 | (S)-((R)-3-(3,4-dimethoxyphenyl)-1-(3-(2-morpholinoethoxy)phenyl)propyl) 1-(pentan-3-ylcarbamoyl)piperidine-2-carboxylate | C35H51N3O7 | 625.79534 | | |
| 420 | 1013621-73-2 | Acarbose EP Impurity G | C31H53NO23 | 807.75 | | |
| 421 | 1013621-79-8 | Acarbose D-Fructose Impurity | C25H43NO18 | 645.6 | >150°C (dec.) | |
| 422 | 1013624-61-7 | Pregabalin Impurity 12 | C7H11NO3 | 157.17 | | |
| 423 | 1013625-96-1 | (2R,6S)-2,6-Dimethylpiperazine | C6H14N2 | 114.18876 | | |
| 424 | 101363-10-4 | RUFLOXACIN | C17H18FN3O3S | 363.41 | | |
| 425 | 1013632-41-1 | 2-(2-phenylethoxy)propanoic acid | C11H14O3 | 194.23 | | |
| 426 | 1013634-99-5 | 7-Hydroxy-3-iodo-4H-chromen-4-one | C9H5IO3 | 288.04 | | |
| 427 | 101364-00-5 | L-Tyrosine, O-methyl-, 1,1-dimethylethyl ester | C14H21NO3 | 251.32 | | |
| 428 | 101364-27-6 | 1-(3-chloropropyl)-4-(3,4-dichlorophenyl)piperazine | C13H17Cl3N2 | 307.65 | | |
| 429 | 1013640-87-3 | Potassium 1H-Pyrazole-5-Trifluoroborate | C3H3BF3KN2 | 173.9738296 | 196-200℃ | |
| 430 | 1013642-97-1 | 2-Bromo-4-nitropyridin-3-ol | C5H3BrN2O3 | 218.99 | | |
| 431 | 1013642-98-2 | 7-broMo-2-(Methylthio)benzo[d]oxazole | C8H6BrNOS | 244.11 | | |
| 432 | 1013643-07-6 | 3-Pyridinol, 4-amino-2-bromo- | C5H5BrN2O | 189.01 | | |
| 433 | 1013643-09-8 | 7-broMo-1,3-benzoxazole-2-thiol | C7H4BrNOS | 230.08 | | |
| 434 | 1013643-15-6 | [2-Methyl-4-(4,4,5,5-tetraMethyl-[1,3,2]dioxaborolan-2-yl)phenyl]-Morpholin-4-yl-Methanone | C18H26BNO4 | 331.21 | | |
| 435 | 1013643-17-8 | 5-aMino-1,3-diMethylpyridin-2(1H)-one | C7H10N2O | 138.1671 | | |
| 436 | 1013643-18-9 | Boron, [2-[(4-bromophenyl)(5-chloro-2H-pyrrol-2-ylidene-κN)methyl]-5-chloro-1H-pyrrolato-κN]difluoro-, (T-4)- | C15H8BBrCl2F2N2 | 415.85 | | |
| 437 | 1013643-19-0 | Boron, [2-chloro-5-[(5-chloro-2H-pyrrol-2-ylidene-κN)(4-nitrophenyl)methyl]-1H-pyrrolato-κN]difluoro-, (T-4)- | C15H8BCl2F2N3O2 | 381.95 | | |
| 438 | 1013647-17-0 | [2,3'-Bipyridine]-5-carboxylic acid, 6'-chloro-6-(2-chlorophenoxy)- | C17H10Cl2N2O3 | 361.18 | | |
| 439 | 1013647-75-0 | 2,6-dichloro-3-Pyridinecarboxylic acid | C10H11Cl2NO2 | 248.11 | | |
| 440 | 1013648-04-8 | methyl 2,6-dichloro-4-methylnicotinate | C8H7Cl2NO2 | 220.05 | | |
| 441 | 1013649-09-6 | 2,3-Dihydro-6-methylginkgetin | C33H26O10 | 582.55 | | |
| 442 | 101365-08-6 | [3β-(β-D-Xylopyranosyloxy)-7β-hydroxycucurbita-5,24-dien-16β-yl]β-D-glucopyranoside | C41H68O12 | 752.97 | | |
| 443 | 101365-10-0 | [3β-(4-O-Acetyl-β-D-xylopyranosyloxy)-7β-hydroxycucurbita-5,24-dien-16β-yl]4-O,6-O-diacetyl-β-D-glucopyranoside | C47H74O15 | 879.09 | | |
| 444 | 101365-11-1 | 3β-(β-D-Xylopyranosyloxy)cucurbita-5,24-diene-7β,16β-diol | C35H58O7 | 590.84 | | |
| 445 | 101365-15-5 | oxymorphone phenylhydrazone | C23H25N3O3 | 391.46 | | |
| 446 | 101365-17-7 | oxymorphone 4-nitrophenylhydrazone | C23H24N4O5 | 436.46 | | |
| 447 | 101365-44-0 | Isofenphos-methyl | C13H20NO4PS | 317.34 | | |
| 448 | 101365-54-2 | MAF | C3H9As3Fe2O9 | 525.55296 | | |
| 449 | 101365-55-3 | Ethoxyacetyl fentanyl (hydrochloride) | C23H31ClN2O2 | 402.95744 | | |
| 450 | 101365-56-4 | Furanyl fentanyl (hydrochloride) | C24H27ClN2O2 | 410.93638 | | |
| 451 | 101365-58-6 | '-methoxy Fentanyl (hydrochloride) | C23H31ClN2O2 | 402.95744 | | |
| 452 | 101365-59-7 | Methoxyacetyl norfentanyl (hydrochloride) | C14H21ClN2O2 | 284.78174 | | |
| 453 | 101365-69-9 | Acetamide, 2-methoxy-N-[4-(methoxymethyl)-1-[2-(2-thienyl)ethyl]-4-piperidinyl]-N-phenyl- | C22H30N2O3S | 402.55 | | |
| 454 | 101365-73-5 | 4-Piperidinecarboxylic acid, 4-[(2-methoxyacetyl)phenylamino]-1-[2-(2-thienyl)ethyl]-, methyl ester, ethanedioate (1:) | C24H30N2O8S | 506.57 | | |
| 455 | 1013652-89-5 | methyl N-(4-chlorophenyl)-N'-cyanoimidothiocarbamate | C9H8ClN3S | 225.69792 | | |
| 456 | 101366-35-2 | SEMICARBAZIDE SULFATE | CH7N3O5S | 173.14838 | 143℃ | |
| 457 | 101366-50-1 | 3'-NITRO-BIPHENYL-4-SULFONYL CHLORIDE | C12H8ClNO4S | 297.71 | | |
| 458 | 101366-51-2 | 4-Methylbiphenyl-4-Sulfonyl Chloride | C13H11ClO2S | 266.75 | | |
| 459 | 101366-61-4 | 3-(4-HYDROXYMETHYLPHENOXY)PROPIONIC ACID | C10H12O4 | 196.2 | 148-152°C | |
| 460 | 101367-16-2 | p-broMoxylylphthaliMide | C16H12BrNO2 | 330.18 | | |
| 461 | 101368-74-5 | Cyanamide, (1-oxido-4-pyridinyl)- (9CI) | C6H5N3O | 135.12 | | |
| 462 | 1013692-78-8 | Phosphine, 1,1',1'',1'''-(silanetetrayltetra-4,1-phenylene)tetrakis[1,1-diphenyl- | C72H56P4Si | 1073.22 | | |
| 463 | 1013692-86-8 | Tetrakis(4-bromophenyl)silane | C24H16Br4Sn | 742.71 | 214 °C(Solv: chloroform (67-66-3)) | |
| 464 | 10137-65-2 | 6-Cyanohexanoic acid ethyl ester | C9H15NO2 | 169.22 | | |
| 465 | 10137-67-4 | 3-Cyanopropanoic acid ethyl ester | C6H9NO2 | 127.14 | | |
| 466 | 10137-69-6 | 3-Cyclohexenyltrichlorosilane | C6H9Cl3Si | 215.58 | | |
| 467 | 10137-73-2 | Dicyclopentylether | C10H18O | 154.25 | | |
| 468 | 10137-74-3 | Calcium chlorate | CaCl2O6 | 206.9804 | 340°C | |
| 469 | 10137-80-1 | N-(2-Ethylhexyl)aniline | C14H23N | 205.34 | | |
| 470 | 10137-87-8 | N-Ethyl-α-methylbenzenemethanamine | C10H15N | 149.24 | | |
| 471 | 10137-90-3 | 5-ethylnon-3-en-2-one | C11H20O | 168.2759 | | |
| 472 | 10137-96-9 | 2-[(2-Methylpentyl)oxy]ethanol | C8H18O2 | 146.23 | -45.1°C (estimate) | |
| 473 | 10137-98-1 | 2-[(1-Isobutyl-3,5-dimethylhexyl)oxy]ethanol | C14H30O2 | 230.39 | | |
| 474 | 101371-00-0 | 2-Butanone, O,O,O-(ethoxysilylidyne)trioxime | C14H29N3O4Si | 331.48 | | |
| 475 | 101371-01-1 | 2-Butanone, O-(triethoxysilyl)oxime | C10H23NO4Si | 249.38 | | |
| 476 | 101371-20-4 | 1-(2-Pentyl)-4-(3-pentyl)benzene | C16H26 | 218.38 | | |
| 477 | 101371-42-0 | methyl 2-hydroxy-5-{[(4-methylphenyl)sulfonyl]amino}benzoate | C15H15NO5S | 321.3483 | | |
| 478 | 101371-44-2 | 2-Hydroxy-5-methylsulfonylbenzoic acid methyl ester | C9H10O5S | 230.24 | | |
| 479 | 101372-99-0 | (E,E,Z)-4,6,10-Hexadecatrienyl acetate | C18H30O2 | 278.43 | | |
| 480 | 101373-00-6 | (E,Z,Z)-4,6,10-Hexadecatrien-1-ol | C16H28O | 236.39 | | |
| 481 | 101373-23-3 | 16-iodo-3-methylhexadecanoic acid | | | | |
| 482 | 101373-28-8 | Glycine, N-decyl-, monosodium salt | C12H24NNaO2 | 237.31423 | | |
| 483 | 101373-30-2 | Glycine, N-octadecyl-, sodium salt (1:1) | C20H42NNaO2 | 351.55 | | |
| 484 | 101374-00-9 | Ethanethioic acid, 2-(diphenylphosphinyl)-, S-methyl ester | C15H15O2PS | 290.32 | | |
| 485 | 101374-15-6 | Acetamide, N-[2-[methyl(3-methylphenyl)amino]ethyl]- | C12H18N2O | 206.28 | | |
| 486 | 101374-18-9 | Acetamide, N-[2-[(3-methoxyphenyl)methylamino]ethyl]- | C12H18N2O2 | 222.29 | 70-71 °C(Solv: ethyl ether (60-29-7); ligroine (8032-32-4)) | |
| 487 | 101375-70-6 | N(10)-bromoacetyl-5,8-dideazafolic acid | C23H22BrN5O7 | 560.35 | | |
| 488 | 1013750-35-0 | 3-?(2,?4-?Dimethoxyphenyl)?-?6-?(3,?4-?dimethoxyphenyl)?-?7H-?1,?2,?4-?triazolo[3,?4-?b]?[1,?3,?4]?thiadiazine | C20H20N4O4S | 412.46 | | |
| 489 | 1013750-77-0 | ML-030 | C20H20N4O4S | 412.46 | >182°C (dec.) | |
| 490 | 1013753-74-6 | (2S)-2-[[4-(1H-indole-3-carbonyl)piperazine-1-carbonyl]amino]-4-methylsulfanyl-butanoic acid | C19H24N4O4S | 404.48 | | |
| 491 | 1013753-99-5 | BC-1382 | C23H29N3O5S | 459.56 | 163 - 164°C | |
| 492 | 1013757-51-1 | (2R,3R)-2-(4-CHLOROPHENYL)-1-ETHYL-5-OXOPYRROLIDINE-3-CARBOXYLIC ACID | C13H14ClNO3 | 267.71 | | |
| 493 | 101376-19-6 | Morpholine, 3-[(phenylmethoxy)methyl]-, hydrochloride, (S)- (9CI) | C12H18ClNO2 | 243.73 | | |
| 494 | 101376-20-9 | Morpholine, 3-[(phenylmethoxy)methyl]-, hydrochloride, (R)- (9CI) | C12H18ClNO2 | 243.73 | | |
| 495 | 101376-25-4 | 3(S)-HYDROXYMETHYL-4-BENZYLMORPHOLINE | C12H17NO2 | 207.27 | 230-231 °C(Solv: ethanol (64-17-5); ethyl ether (60-29-7)) | |
| 496 | 101376-26-5 | (R)-4-BENZYL-3-HYDROXYMETHYLMORPHOLINE | C12H17NO2 | 207.27 | 229-230 °C(Solv: ethanol (64-17-5); ethyl ether (60-29-7)) | |
| 497 | 101376-27-6 | 3-((benzyloxy)methyl)morpholine | C12H17NO2 | 207.27 | | |
| 498 | 101376-29-8 | 1(4H)-Pyridinecarboxamide,4,4-dimethyl-(9CI) | C8H12N2O | 152.19 | | |
| 499 | 101376-73-2 | 2-Butenoic acid, 2-methyl-4-(phenylmethoxy)-, methyl ester, (E)- (9CI) | C13H16O3 | 220.26 | | |
| 500 | 1013764-74-3 | 2-methoxy-4-methylcyclohexanamine | C8H17NO | 143.23 | | |
| 501 | 101377-33-7 | 1,27-bis(oxiranyl)-8,16,24-tris(oxiranylmethoxy)-2,6,10,14,18,22,26-heptaoxaheptacosane-4,12,20-triol | C33H58O18 | 742.8 | | |
| 502 | 101377-34-8 | 1,19-bis(oxiranyl)-8,16-bis(oxiranylmethoxy)-2,6,10,14,18-pentaoxanonadecane-4,12-diol | C24H42O13 | 538.58 | | |
| 503 | 101377-62-2 | TRIMETHYLOLPROPANE | C6H14O3 | 134.17 | | |
| 504 | 101377-63-3 | anhydride | | | | |
| 505 | 101377-89-3 | Benzilic acid, 2-(9-azabicyclo[3.3.1]non-9-yl)ethyl ester, hydrochloride (7CI) | C24H30ClNO3 | 415.96 | | |
| 506 | 1013770-27-8 | (2R,3R)-2-(3,5-DICHLOROPHENYL)-1-ETHYL-6-OXOPIPERIDINE-3-CARBOXYLIC ACID | C14H15Cl2NO3 | 316.18 | | |
| 507 | 101379-65-1 | 4-METHOXYBENZALDEHYDE (5,6-DIPHENYL-1,2,4-TRIAZIN-3-YL)HYDRAZONE | C23H19N5O | 381.42986 | | |
| 508 | 1013791-69-9 | 2-({2-[(sec-butylamino)carbonyl]anilino}carbonyl)cyclohexanecarboxylic acid | C19H26N2O4 | 346.42 | | |
| 509 | 1013792-04-5 | (2R,3R)-2-(4-CHLOROPHENYL)-N-ETHYL-1-(2-METHOXYETHYL)PYRROLIDINE-3-CARBOXAMIDE | C16H23ClN2O2 | 310.82 | | |
| 510 | 1013792-05-6 | (3AR,9BS)-4-(4-CARBOXYPHENYL)-3A,4,5,9B-TETRAHYDRO-3H-CYCLOPENTA[C]QUINOLINE-8-CARBOXYLIC ACID | C20H17NO4 | 335.35 | | |
| 511 | 10138-01-9 | EUROPIUM NITRATE | EuN3O9 | 337.97 | | |
| 512 | 10138-02-0 | N-(2-aminoethyl)dodecanamide | C14H30N2O | 242.4 | 87-89 °C(Solv: ethanol (64-17-5); ethyl ether (60-29-7)) | |
| 513 | 10138-04-2 | Ammonium iron (III) sulfate | FeH5NO4S | 170.95 | 39–41℃ [ALD94] | very soluble H2O; insoluble alcohol [MER06] |
| 514 | 10138-10-0 | 4-Oxobutanoic acid ethyl ester | C6H10O3 | 130.14 | | |
| 515 | 10138-17-7 | 1,4-DIOXANE,2,6-DIMETHYL- | C6H12O2 | 116.16 | | |
| 516 | 10138-19-9 | 4-Heptyl-2,6-dimethylphenol | C15H24O | 220.35 | | |
| 517 | 10138-21-3 | VINYLETHYLDICHLOROSILANE | C4H8Cl2Si | 155.1 | | |
| 518 | 10138-32-6 | ETHYL 5-NORBORNENE-2-CARBOXYLATE (MIXTURE OF ENDO AND EXO) | C10H14O2 | 166.22 | | |
| 519 | 10138-34-8 | 2,3-epoxybutyric acid butyl ester | C8H14O3 | 158.19496 | | |
| 520 | 10138-36-0 | Di-(2-Ethylhexyl)4,5-Epoxytetrahydrophthalate | C24H42O5 | 410.59 | | |
| 521 | 10138-39-3 | 7-Oxabicyclo[4.1.0]heptane-3-carboxylicacid,4-methyl-,2-propenylester(9CI) | C11H16O3 | 196.24 | | |
| 522 | 10138-41-7 | Erbium(III) chloride | Cl3Er | 273.62 | 774°C(lit.) | Soluble in water, strong mineral acids. Slightly soluble in MeOH and THF. |
| 523 | 10138-43-9 | 1-Propanol, 3-(2-ethoxyethoxy)- | C7H16O3 | 148.2 | | |
| 524 | 10138-44-0 | 2-Ethoxy-3,4-dihydro-4-methyl-2H-pyran | C8H14O2 | 142.2 | | |
| 525 | 10138-46-2 | N-Ethylacetoacetamide | C6H11NO2 | 129.16 | | |
| 526 | 10138-47-3 | 2-[(1-Ethylpentyl)oxy]ethanol | C9H20O2 | 160.25 | | |
| 527 | 10138-52-0 | GADOLINIUM CHLORIDE | GdCl3 | 263.61 | 609°C | Soluble in water. |
| 528 | 10138-59-7 | 1,2-Cyclohexanedicarboxylic Acid Diethyl Ester | C12H20O4 | 228.28 | | |
| 529 | 10138-60-0 | (E)-hex-4-en-1-yn-3-ol | C6H8O | 96.13 | 25°C (estimate) | |
| 530 | 10138-62-2 | holmium trichloride | Cl3Ho | 271.29 | 718°C(lit.) | Soluble in water. |
| 531 | 10138-63-3 | PHENYL ETHYL LACTATE | C11H14O3 | 194.23 | | |
| 532 | 10138-74-6 | 2-(2-Hydroxyethylamino)-1-propanamine | C5H14N2O | 118.18 | | |
| 533 | 10138-79-1 | TRIS(2-CHLOROETHOXY)SILANE | C6H13Cl3O3Si | 267.61 | | |
| 534 | 10138-87-1 | 2-[2-[(1-Ethylpentyl)oxy]ethoxy]ethanol | C11H24O3 | 204.31 | | |
| 535 | 10138-89-3 | 1,1,3-TRIMETHOXYBUTANE | C7H16O3 | 148.2 | | |
| 536 | 10138-93-9 | TRIETHYLAMMONIUM PHOSPHATE | C6H18NO4P | 199.19 | | |
| 537 | 10138-94-0 | zinc bis(acetato-O)dioxouranate | C4H6O6UZn | 453.49 | | |
| 538 | 10138-99-5 | (2S)-2-Amino-3-dimethylaminopropanoic acid | C5H12N2O2 | 132.16 | | |
| 539 | 101380-00-1 | Direct Red 254 | | | | |
| 540 | 101380-54-5 | bovine parathyroid hormone (7-34) | C156H243N47O40S2 | 3481.02 | | |
| 541 | 1013813-81-4 | 4-{8-nitro-3H,3aH,4H,5H,9bH-cyclopenta[c]quinoli n-4-yl}phenol | C18H16N2O3 | 308.33 | | |
| 542 | 101382-24-5 | Benzenetricarboperoxoicacid, tris(1,1-dimethylethyl) ester (9CI) | C21H30O9 | | | |
| 543 | 101382-53-0 | 6-METHYL-2-OXO-1,2-DIHYDROQUINOLIN-3-CARBALDEHYDE | C11H9NO2 | 187.2 | >250° | |
| 544 | 101382-54-1 | 2-Hydroxy-8-Methyl-Quinoline-3-Carbaldehyde | C11H9NO2 | 187.19 | | |
| 545 | 101382-55-2 | 2-HYDROXY-7-METHOXY-QUINOLINE-3-CARBALDEHYDE | C11H9NO3 | 203.1941 | | |
| 546 | 101382-56-3 | 6,7-DiMethoxy-2-oxo-1,2-dihydro-quinoline-3-carbaldehyde | C12H11NO4 | 233.22004 | | |
| 547 | 101382-57-4 | (2E)-3-(2-oxo-1,2-dihydroquinolin-3-yl)prop-2-enoic acid | C12H9NO3 | 215.2 | | |
| 548 | 101383-02-2 | 4-(2-hydroxyethyl)benzene-1,3-diol | C8H10O3 | 154.16 | | |
| 549 | 101383-35-1 | Mulberrofuran Q | C34H24O10 | 592.54836 | | |
| 550 | 101383-39-5 | homohalichondrin B | C61H86O19 | 1123.32 | | |
| 551 | 101383-42-0 | 1-[(6R)-2-amino-4-oxo-5,6,7,8-tetrahydro-1H-pteridin-6-yl]propane-1,2- dione | C9H11N5O3 | 237.22 | | |
| 552 | 101383-79-3 | Benzothiazole, 2-(1-pentenyloxy)-, (E)- (9CI) | C12H13NOS | 219.3 | | |
| 553 | 1013835-89-6 | 1-(3-methoxyphenyl)-1H-pyrazole-4-carbaldehyde | C11H10N2O2 | 202.2093 | | |
| 554 | 1013835-99-8 | 1-(2-METHOXYPHENYL)-1H-PYRAZOLE-4-CARBALDEHYDE | C11H10N2O2 | 202.2093 | | |
| 555 | 1013837-41-6 | 4-(4-BROMOPHENYL)-1-TOSYL-1H-PYRAZOL-5-AMINE | C16H14BrN3 | 328.21 | | |
| 556 | 101384-60-5 | 5-chloro-1-methyl-2-oxo-1,2-dihydropyridine-3-carboxylic acid | C7H6ClNO3 | 187.58 | | |
| 557 | 101384-62-7 | 1-BENZYL-5-CHLORO-2-OXO-1,2-DIHYDRO-3-PYRIDINECARBOXYLIC ACID | C13H10ClNO3 | 263.68 | 169-171°C | |
| 558 | 101384-63-8 | 1-benzyl-5-bromo-2-oxo-1,2-dihydropyridine-3-carboxylic acid | C13H10BrNO3 | 308.13 | 165-168°C | |
| 559 | 101385-21-1 | N'-[(E)-(4-CYANOPHENYL)METHYLIDENE]BENZENESULFONOHYDRAZIDE | C14H11N3O2S | 285.32 | | |
| 560 | 101385-65-3 | Methylbromochlorofluoroacetate | C3H3BrClFO2 | 205.41 | | |
| 561 | 101385-69-7 | 2-chloro-1,3-dimethylimidazolidinium hexafluorophosphate | C5H10ClN2.F6P | 278.56 | 231-233 °C (lit.) | |
| 562 | 101385-90-4 | (S)-(-)-N-benzyl 3-hydroxypyrrolidine | C11H15NO | 177.24 | | |
| 563 | 101385-93-7 | N-Boc-3-pyrrolidinone | C9H15NO3 | 185.22 | 34-38 °C (lit.) | Insoluble in water. |
| 564 | 1013851-91-6 | Ethanone, 1-[5-methyl-1-[5-(trifluoromethyl)-2-pyridinyl]-1H-pyrazol-4-yl]- | C12H10F3N3O | 269.22 | | |
| 565 | 101386-86-1 | 1,3-Benzenediol, 5-[1-hydroxy-2-[[6-(4-phenylbutoxy)hexyl]amino]ethyl]- | C24H35NO4 | 401.54 | | |
| 566 | 101387-37-5 | 6-astatomethyl-19-norcholest-5(10)-en-3-ol | C27H45AtO | 596.6546 | | |
| 567 | 101387-97-7 | 5,7-Dihydro-2-[(4-methoxy-3-methyl-2-pyridinyl)methylthio]-5,5,7,7-tetramethylindeno[5,6-d]imidazol-6(1H)-one | C22H25N3O2S | 395.52 | | |
| 568 | 101387-98-8 | Ro 18-5364 | C22H25N3O3S | 411.5172 | | |
| 569 | 101388-47-0 | QUINABEN | C24H18N4O3 | 410.42 | | |
| 570 | 101388-78-7 | Acetaldehyde, [(3-hydroxy-2-pyridinyl)thio]-, O-methyloxime (9CI) | C8H10N2O2S | 198.24 | | |
| 571 | 101388-79-8 | Acetaldehyde, 2-[(1-oxido-2-pyridinyl)thio]-, O-methyloxime (9CI) | C8H10N2O2S | 198.24 | | |
| 572 | 1013883-02-7 | FMOC-4-[2-(BOC-AMINO)ETHOXY]-L-PHENYLALANINE | C31H34N2O7 | 546.61 | | |
| 573 | 101389-22-4 | 6-amino-1,3-dihydroindol-2-one:hydrochloride | C8H9ClN2O | 184.62 | | |
| 574 | 101389-75-7 | 1H-[1,4]Benzodioxino[2,3-c]pyrrole, 5-fluoro-2,3,3a,9a-tetrahydro-2-(phenylmethyl)-, (3aR,9aR)-rel- | C17H16FNO2 | 285.31 | | |
| 575 | 101389-86-0 | FLUPAROXAN | C10H10FNO2 | 195.19 | | |
| 576 | 10139-00-1 | armentomycin | C4H7Cl2NO2 | 172.01 | | |
| 577 | 10139-01-2 | 2'-NITROPHENYL-2-ACETAMIDO-2-DEOXY-ALPHA-D-GLUCOPYRANOSIDE | C14H18N2O8 | 342.3 | 208-210°C(lit.) | |
| 578 | 10139-02-3 | 4'-nitrophenyl-2-acetamido-2-deoxy-α-D-glucopyranoside | C14H18N2O8 | 342.3 | 264 °C | |
| 579 | 10139-04-5 | PHENYL 2-ACETAMIDO-2-DEOXY-ALPHA-D-GALACTOPYRANOSIDE | C14H19NO6 | 297.31 | 241 °C | |
| 580 | 10139-05-6 | D-Proline, 1-amino- (9CI) | C5H10N2O2 | 130.15 | 155-156°C | |
| 581 | 10139-06-7 | GAMMA-GLUTAMYL-1-AMINO-D-PROLINE | C10H17N3O5 | 259.26 | | |
| 582 | 10139-07-8 | L-Proline, 1-[(4-amino-4-carboxy-1-oxobutyl)amino]-, (S)- (9CI) | C10H17N3O5 | 259.26 | | |
| 583 | 10139-08-9 | Benzeneacetic acid, α-(hydroxymethyl)-, (3-endo)-8-(2-propyn-1-yl)-8-azabicyclo[3.2.1]oct-3-yl ester | C19H23NO3 | 313.39 | | |
| 584 | 10139-18-1 | alpha-D-glucose 1,6-bis(dihydrogen phosphate) | C6H14O12P2 | 340.115682 | | |
| 585 | 10139-25-0 | Proline, 1-amino- (9CI) | C5H10N2O2 | 130.15 | | |
| 586 | 10139-28-3 | ATKYNAZQGVYHIB-UHFFFAOYSA-N | C16H21NO3 | 275.35 | | |
| 587 | 10139-47-6 | Zinc iodide | I2Zn | 319.2 | 445 °C (lit.) | 333 g/100 mL |
| 588 | 10139-51-2 | Cerium(IV) ammonium nitrate | CeH4N2O3 | 220.16 | | |
| 589 | 10139-54-5 | Decanoic acid, cobalt salt | C20H38CoO4 | 401.44652 | | |
| 590 | 10139-57-8 | N-DECANOICACID,MANGANESESALT | | | | |
| 591 | 10139-58-9 | Rhodium(III) nitrate | N3O9Rh | 288.92 | | Soluble in alcohol, water, acetone |
| 592 | 10139-84-1 | 2,6-dihydroxy-4-methylacetophenone | C9H10O3 | 166.17 | 150-154 °C | |
| 593 | 10139-98-7 | deptropine methobromide | C24H30NO.Br | 428.411 | | |
| 594 | 101390-07-2 | 1,4-Benzodioxin, 5-fluoro-2,3-dihydro-2,3-bis[(phenylmethoxy)methyl]-, (2R,3R)-rel- | C24H23FO4 | 394.44 | | |
| 595 | 101390-16-3 | 1,4-Benzodioxin-2,3-dimethanol, 5-fluoro-2,3-dihydro-, (2R,3R)-rel- | C10H11FO4 | 214.19 | | |
| 596 | 101390-89-0 | [3aR,6aα,10aα,(-)]-5α-Acetoxy-3,3aα,4,5,6,6a,7,8,9,9a,10,10a-dodecahydro-6α,7β-dihydroxy-7-isopropyl-4β,9aβ-dimethyl-1-methylenedicyclopenta[a,d]cyclooctene-2(1H)-one | C22H34O5 | 378.5 | | |
| 597 | 101390-90-3 | Dodecahydro-3-isopropyl-6-methyl-9-methylene-3,10a-ethano-1H-cyclopenta[4,5]cycloocta[1,2-c]furan-1,4,5,8-tetrol 1,5-diacetate | C24H36O7 | 436.54 | | |
| 598 | 101390-91-4 | [2S,3aα,6aα,10aα,(-)]-9aβ-(Acetoxymethyl)tetradecahydro-7-isopropyl-4β-methyl-1-methylenedicyclopenta[a,d]cyclooctene-2β,5α,6α,7β-tetrol 5,6-diacetate | C26H40O8 | 480.59 | | |
| 599 | 101390-92-5 | [2S,3aα,6aα,10aα,(-)]-9aβ-(Acetoxymethyl)tetradecahydro-7-isopropyl-4β-methyl-1-methylenedicyclopenta[a,d]cyclooctene-2β,5α,6α,7β-tetrol 5-acetate | C24H38O7 | 438.55 | | |
| 600 | 101390-93-6 | 3,6-Cyclodecadiene-1,2-diol, 10-(1,5-dimethyl-4-hexenyl)-3,7-dimethyl- (9CI) | C20H34O2 | 306.48 | | |
| 601 | 1013905-12-8 | 2-(TRIFLUOROMETHYL)-5,6,7,8-TETRAHYDRO[1,2,4]TRIAZOLO[1,5-A]PYRAZINE HYDROCHLORIDE | C6H8ClF3N4 | 228.61 | | |
| 602 | 1013907-68-0 | L-Tyrosine, N-acetyl-O-[[3'-[[[4-(1-ethylpropyl)phenyl](1-Methylethyl)aMino]Methyl][1,1'-biphenyl]-4-yl]Methyl]- | C39H46N2O4 | 606.79354 | | |
| 603 | 1013909-91-5 | Pholidotol C | C15H14O4 | 258.27 | | |
| 604 | 101391-01-9 | 2,6-Octadiene-1,4-diol, 3,7-dimethyl-, (2E,4S)- | C10H18O2 | 170.25 | | |
| 605 | 101391-05-3 | bruceanol B | C27H36O11 | 536.57 | | |
| 606 | 101391-06-4 | bruceanol A | C28H30O11 | 542.54 | | |
| 607 | 101391-10-0 | Bicadinane T | C30H52 | 412.73 | | |
| 608 | 101391-45-1 | Bicyclo[1.1.0]butane, 1-bromo-2-methyl- (9CI) | C5H7Br | 147.01 | | |
| 609 | 1013911-90-4 | 1-Azetidineacetic acid, 3-[(1R)-1-[[(1,1-dimethylethyl)dimethylsilyl]oxy]ethyl]-2-oxo-4-[[[(2R)-tetrahydro-2-furanyl]carbonyl]thio]-, 2-propen-1-yl ester, (3S,4R)- | C21H35NO6SSi | 457.66 | | |
| 610 | 1013915-06-4 | tert-Butyl 6-(methylamino)hexylcarbamate | C12H26N2O2 | 230.35 | | |
| 611 | 1013915-71-3 | CRS3123 | C19H19Br2N3O2S | 513.25 | | |
| 612 | 1013915-99-5 | REP 3123 dihydrochloride | C19H19Br2N3O2S*2ClH | 586.16 | | |
| 613 | 1013916-37-4 | Pyrido[2,3-d]pyrimidin-7(8H)-one, 2-chloro-8-cyclopentyl-5-methyl- | C13H14ClN3O | 263.72 | 176 - 178°C | Slightly soluble in water. |
| 614 | 101392-11-4 | 2,6-Octadienal,8-(2,5-dihydroxyphenyl)-6-methyl-2-(4-methyl-3-penten-1-yl)-, (2E,6E)- | C21H28O3 | | | |
| 615 | 101392-12-5 | 1,4-Benzenediol,2-[(2E,6Z)-7-(hydroxymethyl)-3,11-dimethyl-2,6,10-dodecatrienyl]- (9CI) | C21H30O3 | 330.4611 | | |
| 616 | 101392-13-6 | Benzoic acid, 3-[(2E,6Z)-7-carboxy-3,11-dimethyl-2,6,10-dodecatrienyl]-4-hydroxy- (9CI) | C22H28O5 | 372.45 | | |
| 617 | 101392-59-0 | (S)-1-(triMethylsilyl)hex-1-yn-3-ol | C9H18OSi | 170.32412 | | |
| 618 | 101392-98-7 | Cinchonan-9-ol, 6'-methoxy-, (8α,9R)-, compd. with 4,4'-(1,1-dioxido-3H-2,1-benzoxathiol-3-ylidene)bis[2,6-dibromo-3-methylphenol] (1:1) (9CI) | C41H38Br4N2O7S | 1022.44 | | |
| 619 | 1013920-14-3 | Vorolanib Impurity 3 | C24H28FN5O3 | 453.52 | | |
| 620 | 1013920-15-4 | X-082 | C23H26FN5O3 | 439.48 | | |
| 621 | 1013920-62-1 | (S)-tert-Butyl 1-acetylpyrrolidin-3-ylcarbamate | C11H20N2O3 | 228.29 | | |
| 622 | 1013920-63-2 | 2-Methyl-2-propanyl [1-(3-pyridinyl)-4-piperidinyl]carbamate | C15H23N3O2 | 277.36 | | |
| 623 | 1013920-75-6 | Carbamic acid, N-[(4R)-2-ethyl-3-oxo-4-isoxazolidinyl]-, 1,1-dimethylethyl ester | C10H18N2O4 | 230.26 | | |
| 624 | 1013920-76-7 | 3-Isoxazolidinone, 4-amino-2-ethyl-, (4R)- | C5H10N2O2 | 130.15 | | |
| 625 | 1013920-83-6 | tert-Butyl 1-(morpholine-4-carbonyl)piperidin-4-ylcarbamate | C15H27N3O4 | 313.39 | | |
| 626 | 1013920-87-0 | tert-Butyl 1-(2-methoxyacetyl)piperidin-4-ylcarbamate | C13H24N2O4 | 272.34 | | |
| 627 | 1013921-00-0 | 1-(Chloroacetyl)-4-(tert-butoxycarbonyl)-aminopiperidine | C12H21ClN2O3 | 276.76 | | |
| 628 | 1013921-14-6 | 1-((S)-3-AMino-pyrrolidin-1-yl)-ethanone | C6H12N2O | 128.17228 | | |
| 629 | 1013921-36-2 | H2N-Peg4-Propyne | C11H21NO4 | 231.29 | | |
| 630 | 1013925-90-0 | (2S,4R)-4-[[(4-Fluoro-1,3-dihydro-2H-isoindol-2-yl)carbonyl]oxy]1,2-pyrrolidinedicarboxylic Acid 1-(1,1-Dimethylethyl) Ester | C19H23FN2O6 | 394.39 | | |
| 631 | 1013929-55-9 | 5-ISOXAZOLECARBOXYLIC ACID, 3-AMINO- | C4H4N2O3 | 128.09 | | |
| 632 | 1013931-27-5 | Isoquinoline, 1-iodo-6,7-dimethoxy- | C11H10INO2 | 315.11 | | |
| 633 | 1013931-64-0 | L-Proline, 1-(1-oxotetradecyl)-, sodium salt (1:1) | C19H35NO3.Na | 348.48 | | |
| 634 | 1013932-64-3 | 2-(4'-hydroxyphenyl)-N-methylindole | C15H13NO | 223.27 | 106-107 °C(Solv: hexane (110-54-3)) | |
| 635 | 1013932-65-4 | 1-methyl-2-m-tolyl-1H-indole | C16H15N | 221.3 | | |
| 636 | 1013933-37-3 | CP 376395 hydrochloride | C21H30N2O.HCl | 362.94 | | |
| 637 | 1013933-56-6 | 1-(2-(Phenanthren-9-yl)phenyl)propan-2-one | C23H18O | 310.39 | | |
| 638 | 1013936-87-2 | 2-Methyl-3-(5-methyl-pyrazol-1-yl)-propionic acid | C8H12N2O2 | 168.19 | | |
| 639 | 1013937-16-0 | (3α,4α,8α,9β,13α,14β,16β,17Z)-16-(Acetyloxy)-3-hydroxy-29-nordaMMara-17(20),24-dien-21-oic Acid | C31H48O5 | 500.71 | | |
| 640 | 1013937-63-7 | VTP-27999 (2,2,2-trifluoroacetate) | C28H42ClF3N4O7 | 639.11 | | |
| 641 | 1013937-87-5 | 1H,3H-Pyrrolo[1,2-c]oxazole-6-carboxylic acid, 6-(3-chloropropyl)tetrahydro-5-oxo-3-phenyl-, Methyl ester, (3R,7aS)- | C17H20ClNO4 | 337.798 | | |
| 642 | 1013937-92-2 | 2-Pyrrolidinone, 3-(3-chloropropyl)-5-(hydroxyMethyl)-, (3R,5S)- | C8H14ClNO2 | 191.65526 | | |
| 643 | 1013937-94-4 | Benzenesulfonic acid, 4-nitro-, [(2S,4R)-4-(3-chloropropyl)-5-oxo-2-pyrrolidinyl]methyl ester | C14H17ClN2O6S | 376.81 | | |
| 644 | 1013937-96-6 | (3R,5S)-tert-butyl 5-(azidomethyl)-3-(3-chloroprop yl)-2-oxopyrrolidine-1-carboxylate... | C13H21ClN4O3 | 316.78 | | |
| 645 | 1013937-97-7 | tert-Butyl ((2S,4R)-1-azido-7-chloro-4-(hydroxymet hyl)heptan-2-yl)carbamate... | C13H25ClN4O3 | 320.82 | | |
| 646 | 1013938-10-7 | tert-butyl 1-amino-3-(tetrahydro-2H-pyran-3-yl)propan-2-ylcarbamate | C13H26N2O3 | 258.36 | | |
| 647 | 101394-17-6 | 2,4(1H,3H)-Pyrimidinedione,1-(2,4-dichlorophenyl)dihydro-3-methyl- | C11H10Cl2N2O2 | 273.1153 | | |
| 648 | 101394-18-7 | 2,4(1H,3H)-Pyrimidinedione, dihydro-3-methyl-1-[4-(trifluoromethyl)phenyl]- | C12H11F3N2O2 | 272.22 | | |
| 649 | 101394-19-8 | 2,4(1H,3H)-Pyrimidinedione,3-(2,3-dichlorophenyl)dihydro-1-methyl- | C11H10Cl2N2O2 | 273.1153 | | |
| 650 | 101394-21-2 | 2,4(1H,3H)-Pyrimidinedione, 3-(2,4-dichlorophenyl)dihydro-1-methyl- | C11H10Cl2N2O2 | 273.12 | | |
| 651 | 101394-27-8 | 2,4(1H,3H)-Pyrimidinedione, dihydro-1-methyl-3-(1-naphthalenyl)- | C15H14N2O2 | 254.28 | | |
| 652 | 101394-50-7 | L 653150 | C22H28O6S | 420.52 | | |
| 653 | 1013941-83-7 | (3aS)-tetrahydro-3H-Pyrrolo[1,2-c][1,2,3]oxathiazole 1-oxide | C5H9NO2S | 147.19546 | | |
| 654 | 1013941-87-1 | (S)-3-Boc-4-isobutyl-1,2,3-oxathiazolidine 2,2-dioxide | C11H21NO5S | 279.35 | | |
| 655 | 101395-00-0 | Hexadecanoic acid, 11-[[O-6-deoxy-4-O-(2-methyl-1-oxopropyl)-β-D-glucopyranosyl-(1→4)-O-6-deoxy-2-O-[(2E)-2-methyl-1-oxo-2-butenyl]-α-L-mannopyranosyl-(1→2)-O-6-O-[(2S,3S)-3-hydroxy-2-methyl-1-oxobutyl]-β-D-glucopyranosyl-(1→2)-6-deoxy-β-D-galactopyranosyl]oxy]-, intramol. 1,3'''-ester, (11R)- (9CI) | C54H90O23 | 1107.28 | | |
| 656 | 101395-01-1 | Hexadecanoic acid, 11-[[O-6-deoxy-4-O-[(2S,3S)-3-hydroxy-2-methyl-1-oxobutyl]-β-D-glucopyranosyl-(1→4)-O-6-deoxy-2-O-[(2E)-2-methyl-1-oxo-2-butenyl]-α-L-mannopyranosyl-(1→2)-O-6-O-[(2S,3S)-3-hydroxy-2-methyl-1-oxobutyl]-β-D-glucopyranosyl-(1→2)-6-deoxy-β-D-galactopyranosyl]oxy]-, intramol. 1,3′′′-ester, (11R)- | C55H92O24 | 1137.31 | | |
| 657 | 101395-03-3 | β-D-Glucopyranoside, (2R,4S)-3,4-dihydro-4-hydroxy-6-(hydroxymethyl)-2-(4-hydroxyphenyl)-8-methyl-2H-1-benzopyran-5,7-diyl bis- | C29H38O16 | 642.6 | | |
| 658 | 101395-04-4 | 4H-1-Benzopyran-4-one,7-(b-D-glucopyranosyloxy)-2,3-dihydro-5-hydroxy-6-(methoxymethyl)-2-(4-methoxyphenyl)-8-methyl-,(2S)- | C25H30O11 | 506.4991 | | |
| 659 | 101395-23-7 | Phenol, 4-[10,15,20-tris(4-chlorophenyl)-21H,23H-porphin-5-yl]- | C44H27Cl3N4O | 734.07 | | |
| 660 | 101395-28-2 | Benzamide, 3-bromo-5-ethyl-N-[[(2S)-1-ethyl-2-pyrrolidinyl]methyl]-6-hydroxy-2-methoxy- | C17H25BrN2O3 | 385.3 | | |
| 661 | 101395-32-8 | SK&F 94461 | | | | |
| 662 | 101395-33-9 | Benzenepropanamide, 4-hydroxy-3-(iodo-125I)-N-(5-((2-(((4-methoxypheny l)methyl)-2-pyridinylamino)ethyl)methylamino)pentyl)- | C30H39IN4O3 | 629.55113 | | |
| 663 | 101395-45-3 | 3-Pentadecanone, 2,6,10,14-tetramethyl- | C19H38O | 282.5 | | |
| 664 | 101395-48-6 | Benzoic acid, 4-methyl-, 2-oxopropyl ester | C11H12O3 | 192.21 | | |
| 665 | 101395-49-7 | Benzoic acid, 4-methoxy-, 2-oxopropyl ester | C11H12O4 | 208.21 | | |
| 666 | 101395-71-5 | 2-Pyrazol-1-ylethylamin | C5H9N3 | 111.15 | | |
| 667 | 101395-72-6 | 2-(5-Methyl-pyrazol-1-yl)-ethylamine | C6H11N3 | 125.17 | | |
| 668 | 101395-77-1 | 1,3-diaziridino-2,4,6-triaza-1,3,5,5-tetraaminomethyl-1,3,5-triphosphorin | C8H24N9P3 | 339.26 | | |
| 669 | 101395-81-7 | 3-Penten-2-one, 5,5,5-trifluoro-, (3E)- (9CI) | C5H5F3O | 138.09 | | |
| 670 | 101396-04-7 | 25-hydroxyvitamin D3 3-(N-(4-azido-2-nitrophenyl)glycinate) | | | | |
| 671 | 101396-05-8 | 1-Propanaminium,3-carboxy-N,N,N-trimethyl-2-[(1-oxopropyl)amino]-, inner salt, (2R)- | C10H20N2O3 | 216.2774 | | |
| 672 | 101396-17-2 | mannopyranosylmethyl-4-nitrophenyltriazene | C13H18N4O8 | 358.3 | | |
| 673 | 101396-42-3 | Mequitazium | C21H25IN2S | 464.40607 | | |
| 674 | 101396-46-7 | 1-Azoniabicyclo[2.2.2]octane, 1-methyl-3-(10H-phenothiazin-10-ylmethyl)- | C21H25N2S+ | 337.5 | | |
| 675 | 101396-87-6 | Levocarnitine Impurity 3 | C6H15ClNO+ | 152.64 | | |
| 676 | 101396-91-2 | (S)-(-)-(3-Chloro-2-Hydroxypropyl)Trimethylammonium Chloride | C6H15Cl2NO | 188.095 | | |
| 677 | 101397-87-9 | HEPTANOYL-N-METHYL-GLUCAMIDE | C14H29NO6 | 307.38 | | |
| 678 | 101397-88-0 | D-Glucitol,1-deoxy-1-[methyl(1-oxohexyl)amino]- | C13H27NO6 | 293.36 | | |
| 679 | 101398-03-2 | N-(4-Ethoxyphenyl)-4-fluorobenzaMide, 97% | C15H14FNO2 | 259.28 | | |
| 680 | 101398-04-3 | N-(4-Ethylphenyl)-4-fluorobenzaMide, 97% | C15H14FNO | 243.28 | | |
| 681 | 101398-05-4 | N-(3-ethylphenyl)-4-fluorobenzamide | C15H14FNO | 243.2761632 | | |
| 682 | 101398-08-7 | 4-Fluoro-N-(2-fluorophenyl)benzaMide, 97% | C13H9F2NO | 233.21 | | |
| 683 | 101398-09-8 | 4-Fluoro-N-(3-fluorophenyl)benzaMide, 97% | C13H9F2NO | 233.21 | | |
| 684 | 101398-10-1 | N-(3-Chlorophenyl)-4-fluorobenzaMide, 97% | C13H9ClFNO | 249.67 | | |
| 685 | 101398-11-2 | N-(2,4-Dichlorophenyl)-4-fluorobenzaMide, 97% | C13H8Cl2FNO | 284.11 | | |
| 686 | 101398-15-6 | Benzamide, N-[2-[(2-benzoyl-4-chlorophenyl)amino]-2-oxoethyl]- | C22H17ClN2O3 | 392.83 | | |
| 687 | 101398-16-7 | Acetamide, N-[2-[(2-benzoyl-4-chlorophenyl)amino]-2-oxoethyl]-2-chloro- | C17H14Cl2N2O3 | 365.21 | | |
| 688 | 101398-17-8 | Benzamide, N-[3-[(2-benzoyl-4-chlorophenyl)amino]-3-oxopropyl]- | C23H19ClN2O3 | 406.86 | | |
| 689 | 101398-18-9 | 4-Morpholineacetamide, N-[2-[(2-benzoyl-4-chlorophenyl)amino]-2-oxoethyl]- | C21H22ClN3O4 | 415.87 | | |
| 690 | 101398-38-3 | 9H-Fluoren-9-one, 2-azido- | C13H7N3O | 221.22 | | |
| 691 | 101398-39-4 | Formamide,N-(2-bromo-2-propen-1-yl)- | C4H6BrNO | 164.00054 | | |
| 692 | 101398-40-7 | Formamide, N-methyl-N-(2,3,6,7-tetrahydro-1H,5H-benzo[ij]quinolizin-9-yl)- | C14H18N2O | 230.31 | | |
| 693 | 101398-42-9 | Methanimidamide,N'-9-acridinyl-N,N-dimethyl- | C16H15N3 | 249.31 | | |
| 694 | 101398-43-0 | N'-acridin-9-yl-N,N-dimethylmethanimidamide,iodomethane | C17H18IN3 | 391.24900 | | |
| 695 | 101398-44-1 | N-Benzo[1,2,5]thiadiazol-4-yl-N,N-dimethyl-formamidine | C9H10N4S | 206.27 | | |
| 696 | 101398-45-2 | Methanimidamide, N'-2,1,3-benzothiadiazol-4-yl-N,N-dimethyl-, compd. with iodomethane (1:1) | C10H13IN4S | 348.21 | | |
| 697 | 101398-46-3 | Methanimidamide, N,N-dimethyl-N'-[2-(phenylmethoxy)ethyl]- | C12H18N2O | 206.28 | | |
| 698 | 101398-47-4 | Methanimidamide, N'-(3-bromo-9-oxo-9H-fluoren-2-yl)-N,N-dimethyl- | C16H13BrN2O | 329.19 | | |
| 699 | 101398-48-5 | Methanimidamide, N'-[4-(1,1-dimethylethyl)cyclohexyl]-N,N-dimethyl- | C13H26N2 | 210.36 | | |
| 700 | 101398-49-6 | Methanimidamide, N,N-dimethyl-N'-[2-methyl-5-(1-methylethyl)phenyl]- | C13H20N2 | 204.31 | | |
| 701 | 101398-50-9 | Methanimidamide,N'-[3-(2-chloro-10H-phenothiazin-10-yl)propyl]-N,N-dimethyl-, hydrochloride(1:1) | C18H21Cl2N3S | 382.35044 | | |
| 702 | 101398-53-2 | Methanimidamide, N'-(10,11-dihydro-5H-dibenzo[a,d]cyclohepten-5-yl)-N,N-dimethyl- | C18H20N2 | 264.36 | | |
| 703 | 101398-54-3 | Methanimidamide,N'-[2-(1-aziridinyl)ethyl]-N,N-dimethyl- | C7H15N3 | 141.21 | | |
| 704 | 101398-55-4 | Methanimidamide, N'-4H-1-benzothiopyran-4-yl-N,N-dimethyl- | C12H14N2S | 218.32 | | |
| 705 | 101398-56-5 | Formamidine, N,N-dimethyl-N'-(2-biphenylyl)- | C15H16N2 | 224.3 | | |
| 706 | 101398-58-7 | Methanimidamide, N'-[2-(dimethylamino)ethyl]-N,N-dimethyl- | C7H17N3 | 143.23 | | |
| 707 | 101398-59-8 | Methanimidamide, N'-(2,3-dimethyl-1H-indol-5-yl)-N,N-dimethyl- | C13H17N3 | 215.29 | | |
| 708 | 101398-60-1 | Methanimidamide, N'-(diphenylmethyl)-N,N-dimethyl- | C16H18N2 | 238.33 | | |
| 709 | 101398-61-2 | Methanimidamide,N'-3-fluoranthenyl-N,N-dimethyl- | C19H16N2 | 272.343 | | |
| 710 | 101398-62-3 | Methanimidamide,N'-9H-fluoren-9-yl-N,N-dimethyl- | C16H16N2 | 236.31164 | | |
| 711 | 101398-63-4 | Methanimidamide, N'-(4,4-diethoxybutyl)-N,N-dimethyl- | C11H24N2O2 | 216.32 | | |
| 712 | 101398-64-5 | 1H-Azepin-1-amine, N-[(dimethylamino)methylene]hexahydro- | C9H19N3 | 169.27 | | |
| 713 | 101398-65-6 | Methanimidamide, N'-(2,3-dihydro-1H-inden-1-yl)-N,N-dimethyl- | C12H16N2 | 188.27 | | |
| 714 | 101398-66-7 | Methanimidamide, N'-5-isoquinolinyl-N,N-dimethyl- | C12H13N3 | 199.25 | | |
| 715 | 101398-67-8 | Methanimidamide, N'-(5-methoxy-2-benzothiazolyl)-N,N-dimethyl- | C11H13N3OS | 235.31 | | |
| 716 | 101398-68-9 | Methanimidamide,N'-[(4-methoxyphenyl)methyl]-N,N-dimethyl- | C11H16N2O | 192.25754 | | |
| 717 | 101398-69-0 | Methanimidamide,N,N-dimethyl-N'-(2-methyl-4-quinolinyl)- | C13H15N3 | 213.2783 | | |
| 718 | 101398-70-3 | Methanimidamide, N,N-dimethyl-N'-[1-(1-naphthalenyl)ethyl]- | C15H18N2 | 226.32 | | |
| 719 | 101398-71-4 | Methanimidamide,N,N-dimethyl-N'-[2-[(5-nitro-2-pyridinyl)amino]ethyl]- | C10H15N5O2 | 237.26 | | |
| 720 | 101398-72-5 | N1,N1-Dimethyl-N2-[3-(10H-phenothiazin-10-yl)propyl]formamidine | C18H21N3S | 311.44 | | |
| 721 | 101398-73-6 | Methanimidamide,N,N-dimethyl-N'-(2-phenylcyclopropyl)-, trans- (9CI) | C12H16N2 | 188.268 | | |
| 722 | 101398-74-7 | Methanimidamide, N,N-dimethyl-N'-3-quinolinyl- | C12H13N3 | 199.25 | | |
| 723 | 101398-75-8 | Methanimidamide, N,N-dimethyl-N'-(1,2,3,4-tetrahydro-9-acridinyl)- | C16H19N3 | 253.34 | | |
| 724 | 101398-76-9 | Methanimidamide,N,N-dimethyl-N'-(5,6,7,8-tetrahydro-1-naphthalenyl)- | C13H18N2 | 202.295 | | |
| 725 | 101398-77-0 | Methanimidamide, N,N-dimethyl-N'-[(tetrahydro-2H-pyran-2-yl)methyl]- | C9H18N2O | 170.25 | | |
| 726 | 101398-78-1 | Methanimidamide,N,N-dimethyl-N'-(2,2,6,6-tetramethyl-4-piperidinyl)- | C12H25N3 | 211.347 | | |
| 727 | 101398-80-5 | Methanimidamide, N,N-dimethyl-N'-(1-phenylcyclohexyl)- | C15H22N2 | 230.35 | | |
| 728 | 1013980-01-2 | 1-(2,4-Difluorophenyl)-5-(thiophen-2-yl)-1H-pyrazole-3-carboxylic Acid | C14H8F2N2O2S | 306.29 | | |
| 729 | 1013980-15-8 | CIS-2-TERT-BUTOXYCARBONYLAMINO-CYCLOOCTANECARBOXYLIC ACID | C14H25NO4 | 271.3526 | | |
| 730 | 1013980-64-7 | (2S,3S)-6-Oxo-1-phenethyl-2-phenylpiperidine-3-carboxylic acid | C20H21NO3 | 323.39 | | |
| 731 | 1013985-40-4 | (2S,4S)-6-AMINO-2-(TRIFLUOROMETHYL)CHROMAN-4-OL | C10H10F3NO2 | 233.19 | | |
| 732 | 1013987-11-5 | 1H-Pyrazole-4-carboxylic acid, 1-(4,6-dimethyl-2-pyrimidinyl)-5-(trifluoromethyl)- | C11H9F3N4O2 | 286.21 | | |
| 733 | 101399-43-3 | L-Alanine Benzyl Ester Benzenesulfonic Acid Salt Also See: A481515 | C16H19NO5S | 337.39 | | |
| 734 | 1013991-31-5 | N-[2-(4-chloro-3,5-dimethyl-1H-pyrazol-1-yl)ethyl]-2,4,6-trimethylbenzenesulfonamide | C16H22ClN3O2S | 355.88278 | | |
| 735 | 1013997-41-5 | L-Phenylalanine, N-[(1,1-dimethylethoxy)carbonyl]-4-(2-naphthalenyl)- | C24H25NO4 | 391.46 | | |
| 736 | 1013997-45-9 | Hydrazinecarboxylic acid, 2-[1-(4-methoxyphenyl)-2,5-dioxo-3-pyrrolidinyl]-, 1,1-dimethylethyl ester | C16H21N3O5 | 335.36 | | |
| 737 | 1013997-51-7 | (2S)-3-(decyloxy)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)propanoic acid | C22H23NO4 | 365.42 | | |